| /trunk/presentations/scripts/jquery-ui-1.8.16.custom.min.js |
|---|
| New file |
| 0,0 → 1,791 |
| /*! |
| * jQuery UI 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI |
| */ |
| (function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", |
| keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= |
| this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, |
| "overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": |
| "mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, |
| outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, |
| "tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& |
| a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&& |
| c.ui.isOverAxis(b,e,i)}})}})(jQuery); |
| ;/*! |
| * jQuery UI Widget 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Widget |
| */ |
| (function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]= |
| function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)): |
| d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options= |
| b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+ |
| "-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled", |
| c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); |
| ;/*! |
| * jQuery UI Mouse 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Mouse |
| * |
| * Depends: |
| * jquery.ui.widget.js |
| */ |
| (function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ |
| this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted= |
| this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& |
| !(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= |
| false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); |
| ;/* |
| * jQuery UI Position 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Position |
| */ |
| (function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, |
| left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= |
| k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= |
| m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= |
| d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= |
| a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), |
| g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); |
| ;/* |
| * jQuery UI Draggable 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Draggables |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.mouse.js |
| * jquery.ui.widget.js |
| */ |
| (function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== |
| "original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= |
| this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; |
| this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); |
| this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, |
| _mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= |
| false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, |
| 10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| |
| !d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& |
| a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= |
| this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), |
| 10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), |
| 10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, |
| (a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= |
| "hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), |
| 10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ |
| this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& |
| !(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left; |
| if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/ |
| b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version< |
| 526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b, |
| c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.16"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert}); |
| h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= |
| false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); |
| this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top; |
| c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& |
| this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity= |
| a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!= |
| "x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left< |
| c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()- |
| c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this, |
| width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&& |
| o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t= |
| p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&& |
| (p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"), |
| 10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); |
| ;/* |
| * jQuery UI Droppable 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Droppables |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| * jquery.ui.mouse.js |
| * jquery.ui.draggable.js |
| */ |
| (function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); |
| a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& |
| this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); |
| this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= |
| d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", |
| a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.16"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; |
| switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= |
| i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= |
| "none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| |
| a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parents(":not(body,html)").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance); |
| if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parents(":not(body,html)").unbind("scroll.droppable"); |
| a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery); |
| ;/* |
| * jQuery UI Resizable 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Resizables |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.mouse.js |
| * jquery.ui.widget.js |
| */ |
| (function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, |
| _proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), |
| top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= |
| this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", |
| nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== |
| String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); |
| this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); |
| var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= |
| false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); |
| this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= |
| {width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; |
| if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, |
| _mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, |
| {top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: |
| Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width= |
| b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&& |
| a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= |
| null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)|| |
| 0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ |
| a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ |
| c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); |
| b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), |
| 10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- |
| f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? |
| e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= |
| e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, |
| step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= |
| e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; |
| var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: |
| a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- |
| d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, |
| f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, |
| display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= |
| e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= |
| d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); |
| ;/* |
| * jQuery UI Selectable 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Selectables |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.mouse.js |
| * jquery.ui.widget.js |
| */ |
| (function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), |
| selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, |
| c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", |
| c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= |
| this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); |
| a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& |
| !a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= |
| e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.16"})})(jQuery); |
| ;/* |
| * jQuery UI Sortable 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Sortables |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.mouse.js |
| * jquery.ui.widget.js |
| */ |
| (function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); |
| this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== |
| "disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& |
| !b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, |
| left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; |
| this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= |
| document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); |
| return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< |
| b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- |
| b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, |
| a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], |
| e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); |
| c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): |
| this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, |
| dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, |
| toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| |
| this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); |
| var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, |
| _getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); |
| if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), |
| this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), |
| this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& |
| this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= |
| this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= |
| d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| |
| 0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", |
| a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- |
| f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b= |
| this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width== |
| ""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top= |
| this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a= |
| {top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), |
| 10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"? |
| document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), |
| 10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b= |
| this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&& |
| this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); |
| var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- |
| this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g- |
| this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0], |
| this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]= |
| "";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove", |
| f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, |
| this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", |
| a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, |
| _uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.16"})})(jQuery); |
| ;/* |
| * jQuery UI Accordion 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Accordion |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| */ |
| (function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); |
| a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); |
| if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", |
| function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= |
| this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); |
| this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); |
| b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); |
| a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ |
| c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; |
| if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); |
| if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), |
| e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| |
| e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", |
| "aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", |
| animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); |
| f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", |
| paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); |
| ;/* |
| * jQuery UI Autocomplete 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Autocomplete |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| * jquery.ui.position.js |
| */ |
| (function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= |
| false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= |
| a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; |
| this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& |
| a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); |
| d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& |
| b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= |
| this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); |
| this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| |
| b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; |
| d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, |
| "\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); |
| (function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", |
| -1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); |
| this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, |
| this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| |
| this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| |
| this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); |
| ;/* |
| * jQuery UI Button 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Button |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| */ |
| (function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!== |
| "boolean")this.options.disabled=this.element.propAttr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover"); |
| this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g= |
| false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed","true"); |
| var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE|| |
| d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== |
| "radio"){var a=this.element.parents().filter(":last"),c="label[for='"+this.element.attr("id")+"']";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element}, |
| widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); |
| b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.propAttr("disabled",true):this.element.propAttr("disabled",false);else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed", |
| "true"):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false")},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), |
| c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only": |
| "ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== |
| "ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); |
| b.Widget.prototype.destroy.call(this)}})})(jQuery); |
| ;/* |
| * jQuery UI Dialog 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Dialog |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| * jquery.ui.button.js |
| * jquery.ui.draggable.js |
| * jquery.ui.mouse.js |
| * jquery.ui.position.js |
| * jquery.ui.resizable.js |
| */ |
| (function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, |
| position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ |
| b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), |
| h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", |
| e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); |
| a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== |
| b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; |
| d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== |
| f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, |
| function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", |
| handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, |
| originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", |
| f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): |
| [a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); |
| if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): |
| e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= |
| this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- |
| b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), |
| create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&!d.isDefaultPrevented()&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()|| |
| c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& |
| c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+ |
| "px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); |
| ;/* |
| * jQuery UI Slider 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Slider |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.mouse.js |
| * jquery.ui.widget.js |
| */ |
| (function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=b.values&&b.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ |
| this.orientation+" ui-widget ui-widget-content ui-corner-all"+(b.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(b.range){if(b.range===true){if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); |
| this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", |
| g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? |
| (h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- |
| m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); |
| return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; |
| this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= |
| this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= |
| this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); |
| c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c<f))c=f;if(c!==this.values(b)){f=this.values();f[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:f});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c}); |
| a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value= |
| this._trimAlignValue(a);this._refreshValue();this._change(null,0)}else return this._value()},values:function(a,b){var c,f,e;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a): |
| this.value();else return this._values()},_setOption:function(a,b){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.propAttr("disabled",true);this.element.addClass("ui-disabled")}else{this.handles.propAttr("disabled",false);this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); |
| this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a]; |
| return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= |
| this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- |
| g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, |
| b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); |
| ;/* |
| * jQuery UI Tabs 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Tabs |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| */ |
| (function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& |
| e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= |
| d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| |
| (q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); |
| this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= |
| this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); |
| if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); |
| this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ |
| g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", |
| function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; |
| this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= |
| -1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; |
| d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= |
| d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, |
| e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); |
| j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); |
| if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, |
| this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, |
| load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, |
| "cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, |
| url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& |
| a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); |
| ;/* |
| * jQuery UI Datepicker 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Datepicker |
| * |
| * Depends: |
| * jquery.ui.core.js |
| */ |
| (function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= |
| "ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", |
| "Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", |
| minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false,disabled:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout", |
| function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); |
| b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, |
| setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, |
| "\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", |
| function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== |
| "focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): |
| d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, |
| b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= |
| 1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ |
| 2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= |
| d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= |
| a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, |
| "datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== |
| a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"? |
| d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e); |
| this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl"); |
| b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]&&d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]);if(a=d.datepicker._get(b,"onSelect")){c=d.datepicker._formatDate(b);a.apply(b.input?b.input[0]:null,[c,b])}else d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target, |
| a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c= |
| a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b, |
| "stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode); |
| return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", |
| a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= |
| "";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); |
| c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= |
| true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); |
| a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& |
| !a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), |
| h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= |
| this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); |
| this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, |
| _checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): |
| 0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? |
| "Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); |
| this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); |
| if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? |
| b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1<a.length&&a.charAt(A+1)==p)&&A++;return p},m=function(p){var D= |
| o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+=p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s= |
| function(){if(b.charAt(q)!=a.charAt(A))throw"Unexpected literal at position "+q;q++},q=0,A=0;A<a.length;A++)if(k)if(a.charAt(A)=="'"&&!o("'"))k=false;else s();else switch(a.charAt(A)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+ |
| 1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q);if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", |
| COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: |
| null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()- |
| (new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f= |
| 0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a); |
| var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date; |
| i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g= |
| Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()> |
| 12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& |
| a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? |
| new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); |
| n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, |
| g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& |
| a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+B+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+ |
| B+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O= |
| "";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&& |
| x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, |
| z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()== |
| P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+B+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?" ":L?'<span class="ui-state-default">'+ |
| r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>': |
| "");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" >";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&& |
| (!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, |
| e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" >";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ |
| (c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? |
| a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, |
| e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, |
| "dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; |
| if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== |
| "string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); |
| ;/* |
| * jQuery UI Progressbar 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Progressbar |
| * |
| * Depends: |
| * jquery.ui.core.js |
| * jquery.ui.widget.js |
| */ |
| (function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); |
| this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* |
| this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); |
| ;/* |
| * jQuery UI Effects 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/ |
| */ |
| jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], |
| 16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, |
| a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= |
| a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", |
| "borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, |
| 0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, |
| 211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, |
| d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; |
| f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, |
| [{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b= |
| 0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), |
| d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; |
| if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); |
| return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, |
| arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ |
| 2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, |
| d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, |
| a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, |
| d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g= |
| 0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158; |
| if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c, |
| a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); |
| ;/* |
| * jQuery UI Effects Blind 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Blind |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, |
| g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Bounce 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Bounce |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ |
| 3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); |
| b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Clip 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Clip |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, |
| c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Drop 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Drop |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== |
| "show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Explode 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Explode |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= |
| 0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ |
| e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Fade 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Fade |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Fold 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Fold |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], |
| 10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Highlight 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Highlight |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& |
| this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Pulsate 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Pulsate |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, |
| a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Scale 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Scale |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, |
| b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= |
| 1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], |
| p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; |
| if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); |
| a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); |
| child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, |
| n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Shake 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Shake |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= |
| (h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Slide 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Slide |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); |
| var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); |
| ;/* |
| * jQuery UI Effects Transfer 1.8.16 |
| * |
| * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * http://docs.jquery.com/UI/Effects/Transfer |
| * |
| * Depends: |
| * jquery.effects.core.js |
| */ |
| (function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); |
| b.dequeue()})})}})(jQuery); |
| ; |
| Property changes: |
| Added: svn:executable |
| +* |
| \ No newline at end of property |
| /trunk/presentations/scripts/jquery.easing-1.3.pack.js |
|---|
| New file |
| 0,0 → 1,72 |
| /* |
| * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ |
| * |
| * Uses the built in easing capabilities added In jQuery 1.1 |
| * to offer multiple easing options |
| * |
| * TERMS OF USE - jQuery Easing |
| * |
| * Open source under the BSD License. |
| * |
| * Copyright © 2008 George McGinley Smith |
| * All rights reserved. |
| * |
| * Redistribution and use in source and binary forms, with or without modification, |
| * are permitted provided that the following conditions are met: |
| * |
| * Redistributions of source code must retain the above copyright notice, this list of |
| * conditions and the following disclaimer. |
| * Redistributions in binary form must reproduce the above copyright notice, this list |
| * of conditions and the following disclaimer in the documentation and/or other materials |
| * provided with the distribution. |
| * |
| * Neither the name of the author nor the names of contributors may be used to endorse |
| * or promote products derived from this software without specific prior written permission. |
| * |
| * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY |
| * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF |
| * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE |
| * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, |
| * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE |
| * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED |
| * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING |
| * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED |
| * OF THE POSSIBILITY OF SUCH DAMAGE. |
| * |
| */ |
| // t: current time, b: begInnIng value, c: change In value, d: duration |
| eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('h.i[\'1a\']=h.i[\'z\'];h.O(h.i,{y:\'D\',z:9(x,t,b,c,d){6 h.i[h.i.y](x,t,b,c,d)},17:9(x,t,b,c,d){6 c*(t/=d)*t+b},D:9(x,t,b,c,d){6-c*(t/=d)*(t-2)+b},13:9(x,t,b,c,d){e((t/=d/2)<1)6 c/2*t*t+b;6-c/2*((--t)*(t-2)-1)+b},X:9(x,t,b,c,d){6 c*(t/=d)*t*t+b},U:9(x,t,b,c,d){6 c*((t=t/d-1)*t*t+1)+b},R:9(x,t,b,c,d){e((t/=d/2)<1)6 c/2*t*t*t+b;6 c/2*((t-=2)*t*t+2)+b},N:9(x,t,b,c,d){6 c*(t/=d)*t*t*t+b},M:9(x,t,b,c,d){6-c*((t=t/d-1)*t*t*t-1)+b},L:9(x,t,b,c,d){e((t/=d/2)<1)6 c/2*t*t*t*t+b;6-c/2*((t-=2)*t*t*t-2)+b},K:9(x,t,b,c,d){6 c*(t/=d)*t*t*t*t+b},J:9(x,t,b,c,d){6 c*((t=t/d-1)*t*t*t*t+1)+b},I:9(x,t,b,c,d){e((t/=d/2)<1)6 c/2*t*t*t*t*t+b;6 c/2*((t-=2)*t*t*t*t+2)+b},G:9(x,t,b,c,d){6-c*8.C(t/d*(8.g/2))+c+b},15:9(x,t,b,c,d){6 c*8.n(t/d*(8.g/2))+b},12:9(x,t,b,c,d){6-c/2*(8.C(8.g*t/d)-1)+b},Z:9(x,t,b,c,d){6(t==0)?b:c*8.j(2,10*(t/d-1))+b},Y:9(x,t,b,c,d){6(t==d)?b+c:c*(-8.j(2,-10*t/d)+1)+b},W:9(x,t,b,c,d){e(t==0)6 b;e(t==d)6 b+c;e((t/=d/2)<1)6 c/2*8.j(2,10*(t-1))+b;6 c/2*(-8.j(2,-10*--t)+2)+b},V:9(x,t,b,c,d){6-c*(8.o(1-(t/=d)*t)-1)+b},S:9(x,t,b,c,d){6 c*8.o(1-(t=t/d-1)*t)+b},Q:9(x,t,b,c,d){e((t/=d/2)<1)6-c/2*(8.o(1-t*t)-1)+b;6 c/2*(8.o(1-(t-=2)*t)+1)+b},P:9(x,t,b,c,d){f s=1.l;f p=0;f a=c;e(t==0)6 b;e((t/=d)==1)6 b+c;e(!p)p=d*.3;e(a<8.w(c)){a=c;f s=p/4}m f s=p/(2*8.g)*8.r(c/a);6-(a*8.j(2,10*(t-=1))*8.n((t*d-s)*(2*8.g)/p))+b},H:9(x,t,b,c,d){f s=1.l;f p=0;f a=c;e(t==0)6 b;e((t/=d)==1)6 b+c;e(!p)p=d*.3;e(a<8.w(c)){a=c;f s=p/4}m f s=p/(2*8.g)*8.r(c/a);6 a*8.j(2,-10*t)*8.n((t*d-s)*(2*8.g)/p)+c+b},T:9(x,t,b,c,d){f s=1.l;f p=0;f a=c;e(t==0)6 b;e((t/=d/2)==2)6 b+c;e(!p)p=d*(.3*1.5);e(a<8.w(c)){a=c;f s=p/4}m f s=p/(2*8.g)*8.r(c/a);e(t<1)6-.5*(a*8.j(2,10*(t-=1))*8.n((t*d-s)*(2*8.g)/p))+b;6 a*8.j(2,-10*(t-=1))*8.n((t*d-s)*(2*8.g)/p)*.5+c+b},F:9(x,t,b,c,d,s){e(s==u)s=1.l;6 c*(t/=d)*t*((s+1)*t-s)+b},E:9(x,t,b,c,d,s){e(s==u)s=1.l;6 c*((t=t/d-1)*t*((s+1)*t+s)+1)+b},16:9(x,t,b,c,d,s){e(s==u)s=1.l;e((t/=d/2)<1)6 c/2*(t*t*(((s*=(1.B))+1)*t-s))+b;6 c/2*((t-=2)*t*(((s*=(1.B))+1)*t+s)+2)+b},A:9(x,t,b,c,d){6 c-h.i.v(x,d-t,0,c,d)+b},v:9(x,t,b,c,d){e((t/=d)<(1/2.k)){6 c*(7.q*t*t)+b}m e(t<(2/2.k)){6 c*(7.q*(t-=(1.5/2.k))*t+.k)+b}m e(t<(2.5/2.k)){6 c*(7.q*(t-=(2.14/2.k))*t+.11)+b}m{6 c*(7.q*(t-=(2.18/2.k))*t+.19)+b}},1b:9(x,t,b,c,d){e(t<d/2)6 h.i.A(x,t*2,0,c,d)*.5+b;6 h.i.v(x,t*2-d,0,c,d)*.5+c*.5+b}});',62,74,'||||||return||Math|function|||||if|var|PI|jQuery|easing|pow|75|70158|else|sin|sqrt||5625|asin|||undefined|easeOutBounce|abs||def|swing|easeInBounce|525|cos|easeOutQuad|easeOutBack|easeInBack|easeInSine|easeOutElastic|easeInOutQuint|easeOutQuint|easeInQuint|easeInOutQuart|easeOutQuart|easeInQuart|extend|easeInElastic|easeInOutCirc|easeInOutCubic|easeOutCirc|easeInOutElastic|easeOutCubic|easeInCirc|easeInOutExpo|easeInCubic|easeOutExpo|easeInExpo||9375|easeInOutSine|easeInOutQuad|25|easeOutSine|easeInOutBack|easeInQuad|625|984375|jswing|easeInOutBounce'.split('|'),0,{})) |
| /* |
| * |
| * TERMS OF USE - EASING EQUATIONS |
| * |
| * Open source under the BSD License. |
| * |
| * Copyright © 2001 Robert Penner |
| * All rights reserved. |
| * |
| * Redistribution and use in source and binary forms, with or without modification, |
| * are permitted provided that the following conditions are met: |
| * |
| * Redistributions of source code must retain the above copyright notice, this list of |
| * conditions and the following disclaimer. |
| * Redistributions in binary form must reproduce the above copyright notice, this list |
| * of conditions and the following disclaimer in the documentation and/or other materials |
| * provided with the distribution. |
| * |
| * Neither the name of the author nor the names of contributors may be used to endorse |
| * or promote products derived from this software without specific prior written permission. |
| * |
| * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY |
| * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF |
| * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE |
| * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, |
| * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE |
| * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED |
| * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING |
| * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED |
| * OF THE POSSIBILITY OF SUCH DAMAGE. |
| * |
| */ |
| /trunk/presentations/scripts/jquery-1.7.js |
|---|
| New file |
| 0,0 → 1,9300 |
| /*! |
| * jQuery JavaScript Library v1.7 |
| * http://jquery.com/ |
| * |
| * Copyright 2011, John Resig |
| * Dual licensed under the MIT or GPL Version 2 licenses. |
| * http://jquery.org/license |
| * |
| * Includes Sizzle.js |
| * http://sizzlejs.com/ |
| * Copyright 2011, The Dojo Foundation |
| * Released under the MIT, BSD, and GPL Licenses. |
| * |
| * Date: Thu Nov 3 16:18:21 2011 -0400 |
| */ |
| (function( window, undefined ) { |
| // Use the correct document accordingly with window argument (sandbox) |
| var document = window.document, |
| navigator = window.navigator, |
| location = window.location; |
| var jQuery = (function() { |
| // Define a local copy of jQuery |
| var jQuery = function( selector, context ) { |
| // The jQuery object is actually just the init constructor 'enhanced' |
| return new jQuery.fn.init( selector, context, rootjQuery ); |
| }, |
| // Map over jQuery in case of overwrite |
| _jQuery = window.jQuery, |
| // Map over the $ in case of overwrite |
| _$ = window.$, |
| // A central reference to the root jQuery(document) |
| rootjQuery, |
| // A simple way to check for HTML strings or ID strings |
| // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) |
| quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, |
| // Check if a string has a non-whitespace character in it |
| rnotwhite = /\S/, |
| // Used for trimming whitespace |
| trimLeft = /^\s+/, |
| trimRight = /\s+$/, |
| // Check for digits |
| rdigit = /\d/, |
| // Match a standalone tag |
| rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, |
| // JSON RegExp |
| rvalidchars = /^[\],:{}\s]*$/, |
| rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, |
| rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, |
| rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, |
| // Useragent RegExp |
| rwebkit = /(webkit)[ \/]([\w.]+)/, |
| ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, |
| rmsie = /(msie) ([\w.]+)/, |
| rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, |
| // Matches dashed string for camelizing |
| rdashAlpha = /-([a-z]|[0-9])/ig, |
| rmsPrefix = /^-ms-/, |
| // Used by jQuery.camelCase as callback to replace() |
| fcamelCase = function( all, letter ) { |
| return ( letter + "" ).toUpperCase(); |
| }, |
| // Keep a UserAgent string for use with jQuery.browser |
| userAgent = navigator.userAgent, |
| // For matching the engine and version of the browser |
| browserMatch, |
| // The deferred used on DOM ready |
| readyList, |
| // The ready event handler |
| DOMContentLoaded, |
| // Save a reference to some core methods |
| toString = Object.prototype.toString, |
| hasOwn = Object.prototype.hasOwnProperty, |
| push = Array.prototype.push, |
| slice = Array.prototype.slice, |
| trim = String.prototype.trim, |
| indexOf = Array.prototype.indexOf, |
| // [[Class]] -> type pairs |
| class2type = {}; |
| jQuery.fn = jQuery.prototype = { |
| constructor: jQuery, |
| init: function( selector, context, rootjQuery ) { |
| var match, elem, ret, doc; |
| // Handle $(""), $(null), or $(undefined) |
| if ( !selector ) { |
| return this; |
| } |
| // Handle $(DOMElement) |
| if ( selector.nodeType ) { |
| this.context = this[0] = selector; |
| this.length = 1; |
| return this; |
| } |
| // The body element only exists once, optimize finding it |
| if ( selector === "body" && !context && document.body ) { |
| this.context = document; |
| this[0] = document.body; |
| this.selector = selector; |
| this.length = 1; |
| return this; |
| } |
| // Handle HTML strings |
| if ( typeof selector === "string" ) { |
| // Are we dealing with HTML string or an ID? |
| if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { |
| // Assume that strings that start and end with <> are HTML and skip the regex check |
| match = [ null, selector, null ]; |
| } else { |
| match = quickExpr.exec( selector ); |
| } |
| // Verify a match, and that no context was specified for #id |
| if ( match && (match[1] || !context) ) { |
| // HANDLE: $(html) -> $(array) |
| if ( match[1] ) { |
| context = context instanceof jQuery ? context[0] : context; |
| doc = ( context ? context.ownerDocument || context : document ); |
| // If a single string is passed in and it's a single tag |
| // just do a createElement and skip the rest |
| ret = rsingleTag.exec( selector ); |
| if ( ret ) { |
| if ( jQuery.isPlainObject( context ) ) { |
| selector = [ document.createElement( ret[1] ) ]; |
| jQuery.fn.attr.call( selector, context, true ); |
| } else { |
| selector = [ doc.createElement( ret[1] ) ]; |
| } |
| } else { |
| ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); |
| selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; |
| } |
| return jQuery.merge( this, selector ); |
| // HANDLE: $("#id") |
| } else { |
| elem = document.getElementById( match[2] ); |
| // Check parentNode to catch when Blackberry 4.6 returns |
| // nodes that are no longer in the document #6963 |
| if ( elem && elem.parentNode ) { |
| // Handle the case where IE and Opera return items |
| // by name instead of ID |
| if ( elem.id !== match[2] ) { |
| return rootjQuery.find( selector ); |
| } |
| // Otherwise, we inject the element directly into the jQuery object |
| this.length = 1; |
| this[0] = elem; |
| } |
| this.context = document; |
| this.selector = selector; |
| return this; |
| } |
| // HANDLE: $(expr, $(...)) |
| } else if ( !context || context.jquery ) { |
| return ( context || rootjQuery ).find( selector ); |
| // HANDLE: $(expr, context) |
| // (which is just equivalent to: $(context).find(expr) |
| } else { |
| return this.constructor( context ).find( selector ); |
| } |
| // HANDLE: $(function) |
| // Shortcut for document ready |
| } else if ( jQuery.isFunction( selector ) ) { |
| return rootjQuery.ready( selector ); |
| } |
| if ( selector.selector !== undefined ) { |
| this.selector = selector.selector; |
| this.context = selector.context; |
| } |
| return jQuery.makeArray( selector, this ); |
| }, |
| // Start with an empty selector |
| selector: "", |
| // The current version of jQuery being used |
| jquery: "1.7", |
| // The default length of a jQuery object is 0 |
| length: 0, |
| // The number of elements contained in the matched element set |
| size: function() { |
| return this.length; |
| }, |
| toArray: function() { |
| return slice.call( this, 0 ); |
| }, |
| // Get the Nth element in the matched element set OR |
| // Get the whole matched element set as a clean array |
| get: function( num ) { |
| return num == null ? |
| // Return a 'clean' array |
| this.toArray() : |
| // Return just the object |
| ( num < 0 ? this[ this.length + num ] : this[ num ] ); |
| }, |
| // Take an array of elements and push it onto the stack |
| // (returning the new matched element set) |
| pushStack: function( elems, name, selector ) { |
| // Build a new jQuery matched element set |
| var ret = this.constructor(); |
| if ( jQuery.isArray( elems ) ) { |
| push.apply( ret, elems ); |
| } else { |
| jQuery.merge( ret, elems ); |
| } |
| // Add the old object onto the stack (as a reference) |
| ret.prevObject = this; |
| ret.context = this.context; |
| if ( name === "find" ) { |
| ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; |
| } else if ( name ) { |
| ret.selector = this.selector + "." + name + "(" + selector + ")"; |
| } |
| // Return the newly-formed element set |
| return ret; |
| }, |
| // Execute a callback for every element in the matched set. |
| // (You can seed the arguments with an array of args, but this is |
| // only used internally.) |
| each: function( callback, args ) { |
| return jQuery.each( this, callback, args ); |
| }, |
| ready: function( fn ) { |
| // Attach the listeners |
| jQuery.bindReady(); |
| // Add the callback |
| readyList.add( fn ); |
| return this; |
| }, |
| eq: function( i ) { |
| return i === -1 ? |
| this.slice( i ) : |
| this.slice( i, +i + 1 ); |
| }, |
| first: function() { |
| return this.eq( 0 ); |
| }, |
| last: function() { |
| return this.eq( -1 ); |
| }, |
| slice: function() { |
| return this.pushStack( slice.apply( this, arguments ), |
| "slice", slice.call(arguments).join(",") ); |
| }, |
| map: function( callback ) { |
| return this.pushStack( jQuery.map(this, function( elem, i ) { |
| return callback.call( elem, i, elem ); |
| })); |
| }, |
| end: function() { |
| return this.prevObject || this.constructor(null); |
| }, |
| // For internal use only. |
| // Behaves like an Array's method, not like a jQuery method. |
| push: push, |
| sort: [].sort, |
| splice: [].splice |
| }; |
| // Give the init function the jQuery prototype for later instantiation |
| jQuery.fn.init.prototype = jQuery.fn; |
| jQuery.extend = jQuery.fn.extend = function() { |
| var options, name, src, copy, copyIsArray, clone, |
| target = arguments[0] || {}, |
| i = 1, |
| length = arguments.length, |
| deep = false; |
| // Handle a deep copy situation |
| if ( typeof target === "boolean" ) { |
| deep = target; |
| target = arguments[1] || {}; |
| // skip the boolean and the target |
| i = 2; |
| } |
| // Handle case when target is a string or something (possible in deep copy) |
| if ( typeof target !== "object" && !jQuery.isFunction(target) ) { |
| target = {}; |
| } |
| // extend jQuery itself if only one argument is passed |
| if ( length === i ) { |
| target = this; |
| --i; |
| } |
| for ( ; i < length; i++ ) { |
| // Only deal with non-null/undefined values |
| if ( (options = arguments[ i ]) != null ) { |
| // Extend the base object |
| for ( name in options ) { |
| src = target[ name ]; |
| copy = options[ name ]; |
| // Prevent never-ending loop |
| if ( target === copy ) { |
| continue; |
| } |
| // Recurse if we're merging plain objects or arrays |
| if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { |
| if ( copyIsArray ) { |
| copyIsArray = false; |
| clone = src && jQuery.isArray(src) ? src : []; |
| } else { |
| clone = src && jQuery.isPlainObject(src) ? src : {}; |
| } |
| // Never move original objects, clone them |
| target[ name ] = jQuery.extend( deep, clone, copy ); |
| // Don't bring in undefined values |
| } else if ( copy !== undefined ) { |
| target[ name ] = copy; |
| } |
| } |
| } |
| } |
| // Return the modified object |
| return target; |
| }; |
| jQuery.extend({ |
| noConflict: function( deep ) { |
| if ( window.$ === jQuery ) { |
| window.$ = _$; |
| } |
| if ( deep && window.jQuery === jQuery ) { |
| window.jQuery = _jQuery; |
| } |
| return jQuery; |
| }, |
| // Is the DOM ready to be used? Set to true once it occurs. |
| isReady: false, |
| // A counter to track how many items to wait for before |
| // the ready event fires. See #6781 |
| readyWait: 1, |
| // Hold (or release) the ready event |
| holdReady: function( hold ) { |
| if ( hold ) { |
| jQuery.readyWait++; |
| } else { |
| jQuery.ready( true ); |
| } |
| }, |
| // Handle when the DOM is ready |
| ready: function( wait ) { |
| // Either a released hold or an DOMready/load event and not yet ready |
| if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { |
| // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). |
| if ( !document.body ) { |
| return setTimeout( jQuery.ready, 1 ); |
| } |
| // Remember that the DOM is ready |
| jQuery.isReady = true; |
| // If a normal DOM Ready event fired, decrement, and wait if need be |
| if ( wait !== true && --jQuery.readyWait > 0 ) { |
| return; |
| } |
| // If there are functions bound, to execute |
| readyList.fireWith( document, [ jQuery ] ); |
| // Trigger any bound ready events |
| if ( jQuery.fn.trigger ) { |
| jQuery( document ).trigger( "ready" ).unbind( "ready" ); |
| } |
| } |
| }, |
| bindReady: function() { |
| if ( readyList ) { |
| return; |
| } |
| readyList = jQuery.Callbacks( "once memory" ); |
| // Catch cases where $(document).ready() is called after the |
| // browser event has already occurred. |
| if ( document.readyState === "complete" ) { |
| // Handle it asynchronously to allow scripts the opportunity to delay ready |
| return setTimeout( jQuery.ready, 1 ); |
| } |
| // Mozilla, Opera and webkit nightlies currently support this event |
| if ( document.addEventListener ) { |
| // Use the handy event callback |
| document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); |
| // A fallback to window.onload, that will always work |
| window.addEventListener( "load", jQuery.ready, false ); |
| // If IE event model is used |
| } else if ( document.attachEvent ) { |
| // ensure firing before onload, |
| // maybe late but safe also for iframes |
| document.attachEvent( "onreadystatechange", DOMContentLoaded ); |
| // A fallback to window.onload, that will always work |
| window.attachEvent( "onload", jQuery.ready ); |
| // If IE and not a frame |
| // continually check to see if the document is ready |
| var toplevel = false; |
| try { |
| toplevel = window.frameElement == null; |
| } catch(e) {} |
| if ( document.documentElement.doScroll && toplevel ) { |
| doScrollCheck(); |
| } |
| } |
| }, |
| // See test/unit/core.js for details concerning isFunction. |
| // Since version 1.3, DOM methods and functions like alert |
| // aren't supported. They return false on IE (#2968). |
| isFunction: function( obj ) { |
| return jQuery.type(obj) === "function"; |
| }, |
| isArray: Array.isArray || function( obj ) { |
| return jQuery.type(obj) === "array"; |
| }, |
| // A crude way of determining if an object is a window |
| isWindow: function( obj ) { |
| return obj && typeof obj === "object" && "setInterval" in obj; |
| }, |
| isNumeric: function( obj ) { |
| return obj != null && rdigit.test( obj ) && !isNaN( obj ); |
| }, |
| type: function( obj ) { |
| return obj == null ? |
| String( obj ) : |
| class2type[ toString.call(obj) ] || "object"; |
| }, |
| isPlainObject: function( obj ) { |
| // Must be an Object. |
| // Because of IE, we also have to check the presence of the constructor property. |
| // Make sure that DOM nodes and window objects don't pass through, as well |
| if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { |
| return false; |
| } |
| try { |
| // Not own constructor property must be Object |
| if ( obj.constructor && |
| !hasOwn.call(obj, "constructor") && |
| !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { |
| return false; |
| } |
| } catch ( e ) { |
| // IE8,9 Will throw exceptions on certain host objects #9897 |
| return false; |
| } |
| // Own properties are enumerated firstly, so to speed up, |
| // if last one is own, then all properties are own. |
| var key; |
| for ( key in obj ) {} |
| return key === undefined || hasOwn.call( obj, key ); |
| }, |
| isEmptyObject: function( obj ) { |
| for ( var name in obj ) { |
| return false; |
| } |
| return true; |
| }, |
| error: function( msg ) { |
| throw msg; |
| }, |
| parseJSON: function( data ) { |
| if ( typeof data !== "string" || !data ) { |
| return null; |
| } |
| // Make sure leading/trailing whitespace is removed (IE can't handle it) |
| data = jQuery.trim( data ); |
| // Attempt to parse using the native JSON parser first |
| if ( window.JSON && window.JSON.parse ) { |
| return window.JSON.parse( data ); |
| } |
| // Make sure the incoming data is actual JSON |
| // Logic borrowed from http://json.org/json2.js |
| if ( rvalidchars.test( data.replace( rvalidescape, "@" ) |
| .replace( rvalidtokens, "]" ) |
| .replace( rvalidbraces, "")) ) { |
| return ( new Function( "return " + data ) )(); |
| } |
| jQuery.error( "Invalid JSON: " + data ); |
| }, |
| // Cross-browser xml parsing |
| parseXML: function( data ) { |
| var xml, tmp; |
| try { |
| if ( window.DOMParser ) { // Standard |
| tmp = new DOMParser(); |
| xml = tmp.parseFromString( data , "text/xml" ); |
| } else { // IE |
| xml = new ActiveXObject( "Microsoft.XMLDOM" ); |
| xml.async = "false"; |
| xml.loadXML( data ); |
| } |
| } catch( e ) { |
| xml = undefined; |
| } |
| if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { |
| jQuery.error( "Invalid XML: " + data ); |
| } |
| return xml; |
| }, |
| noop: function() {}, |
| // Evaluates a script in a global context |
| // Workarounds based on findings by Jim Driscoll |
| // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context |
| globalEval: function( data ) { |
| if ( data && rnotwhite.test( data ) ) { |
| // We use execScript on Internet Explorer |
| // We use an anonymous function so that context is window |
| // rather than jQuery in Firefox |
| ( window.execScript || function( data ) { |
| window[ "eval" ].call( window, data ); |
| } )( data ); |
| } |
| }, |
| // Convert dashed to camelCase; used by the css and data modules |
| // Microsoft forgot to hump their vendor prefix (#9572) |
| camelCase: function( string ) { |
| return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); |
| }, |
| nodeName: function( elem, name ) { |
| return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); |
| }, |
| // args is for internal usage only |
| each: function( object, callback, args ) { |
| var name, i = 0, |
| length = object.length, |
| isObj = length === undefined || jQuery.isFunction( object ); |
| if ( args ) { |
| if ( isObj ) { |
| for ( name in object ) { |
| if ( callback.apply( object[ name ], args ) === false ) { |
| break; |
| } |
| } |
| } else { |
| for ( ; i < length; ) { |
| if ( callback.apply( object[ i++ ], args ) === false ) { |
| break; |
| } |
| } |
| } |
| // A special, fast, case for the most common use of each |
| } else { |
| if ( isObj ) { |
| for ( name in object ) { |
| if ( callback.call( object[ name ], name, object[ name ] ) === false ) { |
| break; |
| } |
| } |
| } else { |
| for ( ; i < length; ) { |
| if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { |
| break; |
| } |
| } |
| } |
| } |
| return object; |
| }, |
| // Use native String.trim function wherever possible |
| trim: trim ? |
| function( text ) { |
| return text == null ? |
| "" : |
| trim.call( text ); |
| } : |
| // Otherwise use our own trimming functionality |
| function( text ) { |
| return text == null ? |
| "" : |
| text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); |
| }, |
| // results is for internal usage only |
| makeArray: function( array, results ) { |
| var ret = results || []; |
| if ( array != null ) { |
| // The window, strings (and functions) also have 'length' |
| // The extra typeof function check is to prevent crashes |
| // in Safari 2 (See: #3039) |
| // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 |
| var type = jQuery.type( array ); |
| if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { |
| push.call( ret, array ); |
| } else { |
| jQuery.merge( ret, array ); |
| } |
| } |
| return ret; |
| }, |
| inArray: function( elem, array, i ) { |
| var len; |
| if ( array ) { |
| if ( indexOf ) { |
| return indexOf.call( array, elem, i ); |
| } |
| len = array.length; |
| i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; |
| for ( ; i < len; i++ ) { |
| // Skip accessing in sparse arrays |
| if ( i in array && array[ i ] === elem ) { |
| return i; |
| } |
| } |
| } |
| return -1; |
| }, |
| merge: function( first, second ) { |
| var i = first.length, |
| j = 0; |
| if ( typeof second.length === "number" ) { |
| for ( var l = second.length; j < l; j++ ) { |
| first[ i++ ] = second[ j ]; |
| } |
| } else { |
| while ( second[j] !== undefined ) { |
| first[ i++ ] = second[ j++ ]; |
| } |
| } |
| first.length = i; |
| return first; |
| }, |
| grep: function( elems, callback, inv ) { |
| var ret = [], retVal; |
| inv = !!inv; |
| // Go through the array, only saving the items |
| // that pass the validator function |
| for ( var i = 0, length = elems.length; i < length; i++ ) { |
| retVal = !!callback( elems[ i ], i ); |
| if ( inv !== retVal ) { |
| ret.push( elems[ i ] ); |
| } |
| } |
| return ret; |
| }, |
| // arg is for internal usage only |
| map: function( elems, callback, arg ) { |
| var value, key, ret = [], |
| i = 0, |
| length = elems.length, |
| // jquery objects are treated as arrays |
| isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; |
| // Go through the array, translating each of the items to their |
| if ( isArray ) { |
| for ( ; i < length; i++ ) { |
| value = callback( elems[ i ], i, arg ); |
| if ( value != null ) { |
| ret[ ret.length ] = value; |
| } |
| } |
| // Go through every key on the object, |
| } else { |
| for ( key in elems ) { |
| value = callback( elems[ key ], key, arg ); |
| if ( value != null ) { |
| ret[ ret.length ] = value; |
| } |
| } |
| } |
| // Flatten any nested arrays |
| return ret.concat.apply( [], ret ); |
| }, |
| // A global GUID counter for objects |
| guid: 1, |
| // Bind a function to a context, optionally partially applying any |
| // arguments. |
| proxy: function( fn, context ) { |
| if ( typeof context === "string" ) { |
| var tmp = fn[ context ]; |
| context = fn; |
| fn = tmp; |
| } |
| // Quick check to determine if target is callable, in the spec |
| // this throws a TypeError, but we will just return undefined. |
| if ( !jQuery.isFunction( fn ) ) { |
| return undefined; |
| } |
| // Simulated bind |
| var args = slice.call( arguments, 2 ), |
| proxy = function() { |
| return fn.apply( context, args.concat( slice.call( arguments ) ) ); |
| }; |
| // Set the guid of unique handler to the same of original handler, so it can be removed |
| proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; |
| return proxy; |
| }, |
| // Mutifunctional method to get and set values to a collection |
| // The value/s can optionally be executed if it's a function |
| access: function( elems, key, value, exec, fn, pass ) { |
| var length = elems.length; |
| // Setting many attributes |
| if ( typeof key === "object" ) { |
| for ( var k in key ) { |
| jQuery.access( elems, k, key[k], exec, fn, value ); |
| } |
| return elems; |
| } |
| // Setting one attribute |
| if ( value !== undefined ) { |
| // Optionally, function values get executed if exec is true |
| exec = !pass && exec && jQuery.isFunction(value); |
| for ( var i = 0; i < length; i++ ) { |
| fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); |
| } |
| return elems; |
| } |
| // Getting an attribute |
| return length ? fn( elems[0], key ) : undefined; |
| }, |
| now: function() { |
| return ( new Date() ).getTime(); |
| }, |
| // Use of jQuery.browser is frowned upon. |
| // More details: http://docs.jquery.com/Utilities/jQuery.browser |
| uaMatch: function( ua ) { |
| ua = ua.toLowerCase(); |
| var match = rwebkit.exec( ua ) || |
| ropera.exec( ua ) || |
| rmsie.exec( ua ) || |
| ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || |
| []; |
| return { browser: match[1] || "", version: match[2] || "0" }; |
| }, |
| sub: function() { |
| function jQuerySub( selector, context ) { |
| return new jQuerySub.fn.init( selector, context ); |
| } |
| jQuery.extend( true, jQuerySub, this ); |
| jQuerySub.superclass = this; |
| jQuerySub.fn = jQuerySub.prototype = this(); |
| jQuerySub.fn.constructor = jQuerySub; |
| jQuerySub.sub = this.sub; |
| jQuerySub.fn.init = function init( selector, context ) { |
| if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { |
| context = jQuerySub( context ); |
| } |
| return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); |
| }; |
| jQuerySub.fn.init.prototype = jQuerySub.fn; |
| var rootjQuerySub = jQuerySub(document); |
| return jQuerySub; |
| }, |
| browser: {} |
| }); |
| // Populate the class2type map |
| jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { |
| class2type[ "[object " + name + "]" ] = name.toLowerCase(); |
| }); |
| browserMatch = jQuery.uaMatch( userAgent ); |
| if ( browserMatch.browser ) { |
| jQuery.browser[ browserMatch.browser ] = true; |
| jQuery.browser.version = browserMatch.version; |
| } |
| // Deprecated, use jQuery.browser.webkit instead |
| if ( jQuery.browser.webkit ) { |
| jQuery.browser.safari = true; |
| } |
| // IE doesn't match non-breaking spaces with \s |
| if ( rnotwhite.test( "\xA0" ) ) { |
| trimLeft = /^[\s\xA0]+/; |
| trimRight = /[\s\xA0]+$/; |
| } |
| // All jQuery objects should point back to these |
| rootjQuery = jQuery(document); |
| // Cleanup functions for the document ready method |
| if ( document.addEventListener ) { |
| DOMContentLoaded = function() { |
| document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); |
| jQuery.ready(); |
| }; |
| } else if ( document.attachEvent ) { |
| DOMContentLoaded = function() { |
| // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). |
| if ( document.readyState === "complete" ) { |
| document.detachEvent( "onreadystatechange", DOMContentLoaded ); |
| jQuery.ready(); |
| } |
| }; |
| } |
| // The DOM ready check for Internet Explorer |
| function doScrollCheck() { |
| if ( jQuery.isReady ) { |
| return; |
| } |
| try { |
| // If IE is used, use the trick by Diego Perini |
| // http://javascript.nwbox.com/IEContentLoaded/ |
| document.documentElement.doScroll("left"); |
| } catch(e) { |
| setTimeout( doScrollCheck, 1 ); |
| return; |
| } |
| // and execute any waiting functions |
| jQuery.ready(); |
| } |
| // Expose jQuery as an AMD module, but only for AMD loaders that |
| // understand the issues with loading multiple versions of jQuery |
| // in a page that all might call define(). The loader will indicate |
| // they have special allowances for multiple jQuery versions by |
| // specifying define.amd.jQuery = true. Register as a named module, |
| // since jQuery can be concatenated with other files that may use define, |
| // but not use a proper concatenation script that understands anonymous |
| // AMD modules. A named AMD is safest and most robust way to register. |
| // Lowercase jquery is used because AMD module names are derived from |
| // file names, and jQuery is normally delivered in a lowercase file name. |
| if ( typeof define === "function" && define.amd && define.amd.jQuery ) { |
| define( "jquery", [], function () { return jQuery; } ); |
| } |
| return jQuery; |
| })(); |
| // String to Object flags format cache |
| var flagsCache = {}; |
| // Convert String-formatted flags into Object-formatted ones and store in cache |
| function createFlags( flags ) { |
| var object = flagsCache[ flags ] = {}, |
| i, length; |
| flags = flags.split( /\s+/ ); |
| for ( i = 0, length = flags.length; i < length; i++ ) { |
| object[ flags[i] ] = true; |
| } |
| return object; |
| } |
| /* |
| * Create a callback list using the following parameters: |
| * |
| * flags: an optional list of space-separated flags that will change how |
| * the callback list behaves |
| * |
| * By default a callback list will act like an event callback list and can be |
| * "fired" multiple times. |
| * |
| * Possible flags: |
| * |
| * once: will ensure the callback list can only be fired once (like a Deferred) |
| * |
| * memory: will keep track of previous values and will call any callback added |
| * after the list has been fired right away with the latest "memorized" |
| * values (like a Deferred) |
| * |
| * unique: will ensure a callback can only be added once (no duplicate in the list) |
| * |
| * stopOnFalse: interrupt callings when a callback returns false |
| * |
| */ |
| jQuery.Callbacks = function( flags ) { |
| // Convert flags from String-formatted to Object-formatted |
| // (we check in cache first) |
| flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; |
| var // Actual callback list |
| list = [], |
| // Stack of fire calls for repeatable lists |
| stack = [], |
| // Last fire value (for non-forgettable lists) |
| memory, |
| // Flag to know if list is currently firing |
| firing, |
| // First callback to fire (used internally by add and fireWith) |
| firingStart, |
| // End of the loop when firing |
| firingLength, |
| // Index of currently firing callback (modified by remove if needed) |
| firingIndex, |
| // Add one or several callbacks to the list |
| add = function( args ) { |
| var i, |
| length, |
| elem, |
| type, |
| actual; |
| for ( i = 0, length = args.length; i < length; i++ ) { |
| elem = args[ i ]; |
| type = jQuery.type( elem ); |
| if ( type === "array" ) { |
| // Inspect recursively |
| add( elem ); |
| } else if ( type === "function" ) { |
| // Add if not in unique mode and callback is not in |
| if ( !flags.unique || !self.has( elem ) ) { |
| list.push( elem ); |
| } |
| } |
| } |
| }, |
| // Fire callbacks |
| fire = function( context, args ) { |
| args = args || []; |
| memory = !flags.memory || [ context, args ]; |
| firing = true; |
| firingIndex = firingStart || 0; |
| firingStart = 0; |
| firingLength = list.length; |
| for ( ; list && firingIndex < firingLength; firingIndex++ ) { |
| if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { |
| memory = true; // Mark as halted |
| break; |
| } |
| } |
| firing = false; |
| if ( list ) { |
| if ( !flags.once ) { |
| if ( stack && stack.length ) { |
| memory = stack.shift(); |
| self.fireWith( memory[ 0 ], memory[ 1 ] ); |
| } |
| } else if ( memory === true ) { |
| self.disable(); |
| } else { |
| list = []; |
| } |
| } |
| }, |
| // Actual Callbacks object |
| self = { |
| // Add a callback or a collection of callbacks to the list |
| add: function() { |
| if ( list ) { |
| var length = list.length; |
| add( arguments ); |
| // Do we need to add the callbacks to the |
| // current firing batch? |
| if ( firing ) { |
| firingLength = list.length; |
| // With memory, if we're not firing then |
| // we should call right away, unless previous |
| // firing was halted (stopOnFalse) |
| } else if ( memory && memory !== true ) { |
| firingStart = length; |
| fire( memory[ 0 ], memory[ 1 ] ); |
| } |
| } |
| return this; |
| }, |
| // Remove a callback from the list |
| remove: function() { |
| if ( list ) { |
| var args = arguments, |
| argIndex = 0, |
| argLength = args.length; |
| for ( ; argIndex < argLength ; argIndex++ ) { |
| for ( var i = 0; i < list.length; i++ ) { |
| if ( args[ argIndex ] === list[ i ] ) { |
| // Handle firingIndex and firingLength |
| if ( firing ) { |
| if ( i <= firingLength ) { |
| firingLength--; |
| if ( i <= firingIndex ) { |
| firingIndex--; |
| } |
| } |
| } |
| // Remove the element |
| list.splice( i--, 1 ); |
| // If we have some unicity property then |
| // we only need to do this once |
| if ( flags.unique ) { |
| break; |
| } |
| } |
| } |
| } |
| } |
| return this; |
| }, |
| // Control if a given callback is in the list |
| has: function( fn ) { |
| if ( list ) { |
| var i = 0, |
| length = list.length; |
| for ( ; i < length; i++ ) { |
| if ( fn === list[ i ] ) { |
| return true; |
| } |
| } |
| } |
| return false; |
| }, |
| // Remove all callbacks from the list |
| empty: function() { |
| list = []; |
| return this; |
| }, |
| // Have the list do nothing anymore |
| disable: function() { |
| list = stack = memory = undefined; |
| return this; |
| }, |
| // Is it disabled? |
| disabled: function() { |
| return !list; |
| }, |
| // Lock the list in its current state |
| lock: function() { |
| stack = undefined; |
| if ( !memory || memory === true ) { |
| self.disable(); |
| } |
| return this; |
| }, |
| // Is it locked? |
| locked: function() { |
| return !stack; |
| }, |
| // Call all callbacks with the given context and arguments |
| fireWith: function( context, args ) { |
| if ( stack ) { |
| if ( firing ) { |
| if ( !flags.once ) { |
| stack.push( [ context, args ] ); |
| } |
| } else if ( !( flags.once && memory ) ) { |
| fire( context, args ); |
| } |
| } |
| return this; |
| }, |
| // Call all the callbacks with the given arguments |
| fire: function() { |
| self.fireWith( this, arguments ); |
| return this; |
| }, |
| // To know if the callbacks have already been called at least once |
| fired: function() { |
| return !!memory; |
| } |
| }; |
| return self; |
| }; |
| var // Static reference to slice |
| sliceDeferred = [].slice; |
| jQuery.extend({ |
| Deferred: function( func ) { |
| var doneList = jQuery.Callbacks( "once memory" ), |
| failList = jQuery.Callbacks( "once memory" ), |
| progressList = jQuery.Callbacks( "memory" ), |
| state = "pending", |
| lists = { |
| resolve: doneList, |
| reject: failList, |
| notify: progressList |
| }, |
| promise = { |
| done: doneList.add, |
| fail: failList.add, |
| progress: progressList.add, |
| state: function() { |
| return state; |
| }, |
| // Deprecated |
| isResolved: doneList.fired, |
| isRejected: failList.fired, |
| then: function( doneCallbacks, failCallbacks, progressCallbacks ) { |
| deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); |
| return this; |
| }, |
| always: function() { |
| return deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); |
| }, |
| pipe: function( fnDone, fnFail, fnProgress ) { |
| return jQuery.Deferred(function( newDefer ) { |
| jQuery.each( { |
| done: [ fnDone, "resolve" ], |
| fail: [ fnFail, "reject" ], |
| progress: [ fnProgress, "notify" ] |
| }, function( handler, data ) { |
| var fn = data[ 0 ], |
| action = data[ 1 ], |
| returned; |
| if ( jQuery.isFunction( fn ) ) { |
| deferred[ handler ](function() { |
| returned = fn.apply( this, arguments ); |
| if ( returned && jQuery.isFunction( returned.promise ) ) { |
| returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); |
| } else { |
| newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); |
| } |
| }); |
| } else { |
| deferred[ handler ]( newDefer[ action ] ); |
| } |
| }); |
| }).promise(); |
| }, |
| // Get a promise for this deferred |
| // If obj is provided, the promise aspect is added to the object |
| promise: function( obj ) { |
| if ( obj == null ) { |
| obj = promise; |
| } else { |
| for ( var key in promise ) { |
| obj[ key ] = promise[ key ]; |
| } |
| } |
| return obj; |
| } |
| }, |
| deferred = promise.promise({}), |
| key; |
| for ( key in lists ) { |
| deferred[ key ] = lists[ key ].fire; |
| deferred[ key + "With" ] = lists[ key ].fireWith; |
| } |
| // Handle state |
| deferred.done( function() { |
| state = "resolved"; |
| }, failList.disable, progressList.lock ).fail( function() { |
| state = "rejected"; |
| }, doneList.disable, progressList.lock ); |
| // Call given func if any |
| if ( func ) { |
| func.call( deferred, deferred ); |
| } |
| // All done! |
| return deferred; |
| }, |
| // Deferred helper |
| when: function( firstParam ) { |
| var args = sliceDeferred.call( arguments, 0 ), |
| i = 0, |
| length = args.length, |
| pValues = new Array( length ), |
| count = length, |
| pCount = length, |
| deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? |
| firstParam : |
| jQuery.Deferred(), |
| promise = deferred.promise(); |
| function resolveFunc( i ) { |
| return function( value ) { |
| args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; |
| if ( !( --count ) ) { |
| deferred.resolveWith( deferred, args ); |
| } |
| }; |
| } |
| function progressFunc( i ) { |
| return function( value ) { |
| pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; |
| deferred.notifyWith( promise, pValues ); |
| }; |
| } |
| if ( length > 1 ) { |
| for ( ; i < length; i++ ) { |
| if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { |
| args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); |
| } else { |
| --count; |
| } |
| } |
| if ( !count ) { |
| deferred.resolveWith( deferred, args ); |
| } |
| } else if ( deferred !== firstParam ) { |
| deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); |
| } |
| return promise; |
| } |
| }); |
| jQuery.support = (function() { |
| var div = document.createElement( "div" ), |
| documentElement = document.documentElement, |
| all, |
| a, |
| select, |
| opt, |
| input, |
| marginDiv, |
| support, |
| fragment, |
| body, |
| testElementParent, |
| testElement, |
| testElementStyle, |
| tds, |
| events, |
| eventName, |
| i, |
| isSupported; |
| // Preliminary tests |
| div.setAttribute("className", "t"); |
| div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/><nav></nav>"; |
| all = div.getElementsByTagName( "*" ); |
| a = div.getElementsByTagName( "a" )[ 0 ]; |
| // Can't get basic test support |
| if ( !all || !all.length || !a ) { |
| return {}; |
| } |
| // First batch of supports tests |
| select = document.createElement( "select" ); |
| opt = select.appendChild( document.createElement("option") ); |
| input = div.getElementsByTagName( "input" )[ 0 ]; |
| support = { |
| // IE strips leading whitespace when .innerHTML is used |
| leadingWhitespace: ( div.firstChild.nodeType === 3 ), |
| // Make sure that tbody elements aren't automatically inserted |
| // IE will insert them into empty tables |
| tbody: !div.getElementsByTagName( "tbody" ).length, |
| // Make sure that link elements get serialized correctly by innerHTML |
| // This requires a wrapper element in IE |
| htmlSerialize: !!div.getElementsByTagName( "link" ).length, |
| // Get the style information from getAttribute |
| // (IE uses .cssText instead) |
| style: /top/.test( a.getAttribute("style") ), |
| // Make sure that URLs aren't manipulated |
| // (IE normalizes it by default) |
| hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), |
| // Make sure that element opacity exists |
| // (IE uses filter instead) |
| // Use a regex to work around a WebKit issue. See #5145 |
| opacity: /^0.55/.test( a.style.opacity ), |
| // Verify style float existence |
| // (IE uses styleFloat instead of cssFloat) |
| cssFloat: !!a.style.cssFloat, |
| // Make sure unknown elements (like HTML5 elems) are handled appropriately |
| unknownElems: !!div.getElementsByTagName( "nav" ).length, |
| // Make sure that if no value is specified for a checkbox |
| // that it defaults to "on". |
| // (WebKit defaults to "" instead) |
| checkOn: ( input.value === "on" ), |
| // Make sure that a selected-by-default option has a working selected property. |
| // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) |
| optSelected: opt.selected, |
| // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) |
| getSetAttribute: div.className !== "t", |
| // Tests for enctype support on a form(#6743) |
| enctype: !!document.createElement("form").enctype, |
| // Will be defined later |
| submitBubbles: true, |
| changeBubbles: true, |
| focusinBubbles: false, |
| deleteExpando: true, |
| noCloneEvent: true, |
| inlineBlockNeedsLayout: false, |
| shrinkWrapBlocks: false, |
| reliableMarginRight: true |
| }; |
| // Make sure checked status is properly cloned |
| input.checked = true; |
| support.noCloneChecked = input.cloneNode( true ).checked; |
| // Make sure that the options inside disabled selects aren't marked as disabled |
| // (WebKit marks them as disabled) |
| select.disabled = true; |
| support.optDisabled = !opt.disabled; |
| // Test to see if it's possible to delete an expando from an element |
| // Fails in Internet Explorer |
| try { |
| delete div.test; |
| } catch( e ) { |
| support.deleteExpando = false; |
| } |
| if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { |
| div.attachEvent( "onclick", function() { |
| // Cloning a node shouldn't copy over any |
| // bound event handlers (IE does this) |
| support.noCloneEvent = false; |
| }); |
| div.cloneNode( true ).fireEvent( "onclick" ); |
| } |
| // Check if a radio maintains its value |
| // after being appended to the DOM |
| input = document.createElement("input"); |
| input.value = "t"; |
| input.setAttribute("type", "radio"); |
| support.radioValue = input.value === "t"; |
| input.setAttribute("checked", "checked"); |
| div.appendChild( input ); |
| fragment = document.createDocumentFragment(); |
| fragment.appendChild( div.lastChild ); |
| // WebKit doesn't clone checked state correctly in fragments |
| support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; |
| div.innerHTML = ""; |
| // Figure out if the W3C box model works as expected |
| div.style.width = div.style.paddingLeft = "1px"; |
| // We don't want to do body-related feature tests on frameset |
| // documents, which lack a body. So we use |
| // document.getElementsByTagName("body")[0], which is undefined in |
| // frameset documents, while document.body isn’t. (7398) |
| body = document.getElementsByTagName("body")[ 0 ]; |
| // We use our own, invisible, body unless the body is already present |
| // in which case we use a div (#9239) |
| testElement = document.createElement( body ? "div" : "body" ); |
| testElementStyle = { |
| visibility: "hidden", |
| width: 0, |
| height: 0, |
| border: 0, |
| margin: 0, |
| background: "none" |
| }; |
| if ( body ) { |
| jQuery.extend( testElementStyle, { |
| position: "absolute", |
| left: "-999px", |
| top: "-999px" |
| }); |
| } |
| for ( i in testElementStyle ) { |
| testElement.style[ i ] = testElementStyle[ i ]; |
| } |
| testElement.appendChild( div ); |
| testElementParent = body || documentElement; |
| testElementParent.insertBefore( testElement, testElementParent.firstChild ); |
| // Check if a disconnected checkbox will retain its checked |
| // value of true after appended to the DOM (IE6/7) |
| support.appendChecked = input.checked; |
| support.boxModel = div.offsetWidth === 2; |
| if ( "zoom" in div.style ) { |
| // Check if natively block-level elements act like inline-block |
| // elements when setting their display to 'inline' and giving |
| // them layout |
| // (IE < 8 does this) |
| div.style.display = "inline"; |
| div.style.zoom = 1; |
| support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); |
| // Check if elements with layout shrink-wrap their children |
| // (IE 6 does this) |
| div.style.display = ""; |
| div.innerHTML = "<div style='width:4px;'></div>"; |
| support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); |
| } |
| div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; |
| tds = div.getElementsByTagName( "td" ); |
| // Check if table cells still have offsetWidth/Height when they are set |
| // to display:none and there are still other visible table cells in a |
| // table row; if so, offsetWidth/Height are not reliable for use when |
| // determining if an element has been hidden directly using |
| // display:none (it is still safe to use offsets if a parent element is |
| // hidden; don safety goggles and see bug #4512 for more information). |
| // (only IE 8 fails this test) |
| isSupported = ( tds[ 0 ].offsetHeight === 0 ); |
| tds[ 0 ].style.display = ""; |
| tds[ 1 ].style.display = "none"; |
| // Check if empty table cells still have offsetWidth/Height |
| // (IE < 8 fail this test) |
| support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); |
| div.innerHTML = ""; |
| // Check if div with explicit width and no margin-right incorrectly |
| // gets computed margin-right based on width of container. For more |
| // info see bug #3333 |
| // Fails in WebKit before Feb 2011 nightlies |
| // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right |
| if ( document.defaultView && document.defaultView.getComputedStyle ) { |
| marginDiv = document.createElement( "div" ); |
| marginDiv.style.width = "0"; |
| marginDiv.style.marginRight = "0"; |
| div.appendChild( marginDiv ); |
| support.reliableMarginRight = |
| ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; |
| } |
| // Technique from Juriy Zaytsev |
| // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ |
| // We only care about the case where non-standard event systems |
| // are used, namely in IE. Short-circuiting here helps us to |
| // avoid an eval call (in setAttribute) which can cause CSP |
| // to go haywire. See: https://developer.mozilla.org/en/Security/CSP |
| if ( div.attachEvent ) { |
| for( i in { |
| submit: 1, |
| change: 1, |
| focusin: 1 |
| } ) { |
| eventName = "on" + i; |
| isSupported = ( eventName in div ); |
| if ( !isSupported ) { |
| div.setAttribute( eventName, "return;" ); |
| isSupported = ( typeof div[ eventName ] === "function" ); |
| } |
| support[ i + "Bubbles" ] = isSupported; |
| } |
| } |
| // Run fixed position tests at doc ready to avoid a crash |
| // related to the invisible body in IE8 |
| jQuery(function() { |
| var container, outer, inner, table, td, offsetSupport, |
| conMarginTop = 1, |
| ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;", |
| vb = "visibility:hidden;border:0;", |
| style = "style='" + ptlm + "border:5px solid #000;padding:0;'", |
| html = "<div " + style + "><div></div></div>" + |
| "<table " + style + " cellpadding='0' cellspacing='0'>" + |
| "<tr><td></td></tr></table>"; |
| // Reconstruct a container |
| body = document.getElementsByTagName("body")[0]; |
| if ( !body ) { |
| // Return for frameset docs that don't have a body |
| // These tests cannot be done |
| return; |
| } |
| container = document.createElement("div"); |
| container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; |
| body.insertBefore( container, body.firstChild ); |
| // Construct a test element |
| testElement = document.createElement("div"); |
| testElement.style.cssText = ptlm + vb; |
| testElement.innerHTML = html; |
| container.appendChild( testElement ); |
| outer = testElement.firstChild; |
| inner = outer.firstChild; |
| td = outer.nextSibling.firstChild.firstChild; |
| offsetSupport = { |
| doesNotAddBorder: ( inner.offsetTop !== 5 ), |
| doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) |
| }; |
| inner.style.position = "fixed"; |
| inner.style.top = "20px"; |
| // safari subtracts parent border width here which is 5px |
| offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); |
| inner.style.position = inner.style.top = ""; |
| outer.style.overflow = "hidden"; |
| outer.style.position = "relative"; |
| offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); |
| offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); |
| body.removeChild( container ); |
| testElement = container = null; |
| jQuery.extend( support, offsetSupport ); |
| }); |
| testElement.innerHTML = ""; |
| testElementParent.removeChild( testElement ); |
| // Null connected elements to avoid leaks in IE |
| testElement = fragment = select = opt = body = marginDiv = div = input = null; |
| return support; |
| })(); |
| // Keep track of boxModel |
| jQuery.boxModel = jQuery.support.boxModel; |
| var rbrace = /^(?:\{.*\}|\[.*\])$/, |
| rmultiDash = /([A-Z])/g; |
| jQuery.extend({ |
| cache: {}, |
| // Please use with caution |
| uuid: 0, |
| // Unique for each copy of jQuery on the page |
| // Non-digits removed to match rinlinejQuery |
| expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), |
| // The following elements throw uncatchable exceptions if you |
| // attempt to add expando properties to them. |
| noData: { |
| "embed": true, |
| // Ban all objects except for Flash (which handle expandos) |
| "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", |
| "applet": true |
| }, |
| hasData: function( elem ) { |
| elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; |
| return !!elem && !isEmptyDataObject( elem ); |
| }, |
| data: function( elem, name, data, pvt /* Internal Use Only */ ) { |
| if ( !jQuery.acceptData( elem ) ) { |
| return; |
| } |
| var privateCache, thisCache, ret, |
| internalKey = jQuery.expando, |
| getByName = typeof name === "string", |
| // We have to handle DOM nodes and JS objects differently because IE6-7 |
| // can't GC object references properly across the DOM-JS boundary |
| isNode = elem.nodeType, |
| // Only DOM nodes need the global jQuery cache; JS object data is |
| // attached directly to the object so GC can occur automatically |
| cache = isNode ? jQuery.cache : elem, |
| // Only defining an ID for JS objects if its cache already exists allows |
| // the code to shortcut on the same path as a DOM node with no cache |
| id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando, |
| isEvents = name === "events"; |
| // Avoid doing any more work than we need to when trying to get data on an |
| // object that has no data at all |
| if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { |
| return; |
| } |
| if ( !id ) { |
| // Only DOM nodes need a new unique ID for each element since their data |
| // ends up in the global cache |
| if ( isNode ) { |
| elem[ jQuery.expando ] = id = ++jQuery.uuid; |
| } else { |
| id = jQuery.expando; |
| } |
| } |
| if ( !cache[ id ] ) { |
| cache[ id ] = {}; |
| // Avoids exposing jQuery metadata on plain JS objects when the object |
| // is serialized using JSON.stringify |
| if ( !isNode ) { |
| cache[ id ].toJSON = jQuery.noop; |
| } |
| } |
| // An object can be passed to jQuery.data instead of a key/value pair; this gets |
| // shallow copied over onto the existing cache |
| if ( typeof name === "object" || typeof name === "function" ) { |
| if ( pvt ) { |
| cache[ id ] = jQuery.extend( cache[ id ], name ); |
| } else { |
| cache[ id ].data = jQuery.extend( cache[ id ].data, name ); |
| } |
| } |
| privateCache = thisCache = cache[ id ]; |
| // jQuery data() is stored in a separate object inside the object's internal data |
| // cache in order to avoid key collisions between internal data and user-defined |
| // data. |
| if ( !pvt ) { |
| if ( !thisCache.data ) { |
| thisCache.data = {}; |
| } |
| thisCache = thisCache.data; |
| } |
| if ( data !== undefined ) { |
| thisCache[ jQuery.camelCase( name ) ] = data; |
| } |
| // Users should not attempt to inspect the internal events object using jQuery.data, |
| // it is undocumented and subject to change. But does anyone listen? No. |
| if ( isEvents && !thisCache[ name ] ) { |
| return privateCache.events; |
| } |
| // Check for both converted-to-camel and non-converted data property names |
| // If a data property was specified |
| if ( getByName ) { |
| // First Try to find as-is property data |
| ret = thisCache[ name ]; |
| // Test for null|undefined property data |
| if ( ret == null ) { |
| // Try to find the camelCased property |
| ret = thisCache[ jQuery.camelCase( name ) ]; |
| } |
| } else { |
| ret = thisCache; |
| } |
| return ret; |
| }, |
| removeData: function( elem, name, pvt /* Internal Use Only */ ) { |
| if ( !jQuery.acceptData( elem ) ) { |
| return; |
| } |
| var thisCache, i, l, |
| // Reference to internal data cache key |
| internalKey = jQuery.expando, |
| isNode = elem.nodeType, |
| // See jQuery.data for more information |
| cache = isNode ? jQuery.cache : elem, |
| // See jQuery.data for more information |
| id = isNode ? elem[ jQuery.expando ] : jQuery.expando; |
| // If there is already no cache entry for this object, there is no |
| // purpose in continuing |
| if ( !cache[ id ] ) { |
| return; |
| } |
| if ( name ) { |
| thisCache = pvt ? cache[ id ] : cache[ id ].data; |
| if ( thisCache ) { |
| // Support space separated names |
| if ( jQuery.isArray( name ) ) { |
| name = name; |
| } else if ( name in thisCache ) { |
| name = [ name ]; |
| } else { |
| // split the camel cased version by spaces |
| name = jQuery.camelCase( name ); |
| if ( name in thisCache ) { |
| name = [ name ]; |
| } else { |
| name = name.split( " " ); |
| } |
| } |
| for ( i = 0, l = name.length; i < l; i++ ) { |
| delete thisCache[ name[i] ]; |
| } |
| // If there is no data left in the cache, we want to continue |
| // and let the cache object itself get destroyed |
| if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { |
| return; |
| } |
| } |
| } |
| // See jQuery.data for more information |
| if ( !pvt ) { |
| delete cache[ id ].data; |
| // Don't destroy the parent cache unless the internal data object |
| // had been the only thing left in it |
| if ( !isEmptyDataObject(cache[ id ]) ) { |
| return; |
| } |
| } |
| // Browsers that fail expando deletion also refuse to delete expandos on |
| // the window, but it will allow it on all other JS objects; other browsers |
| // don't care |
| // Ensure that `cache` is not a window object #10080 |
| if ( jQuery.support.deleteExpando || !cache.setInterval ) { |
| delete cache[ id ]; |
| } else { |
| cache[ id ] = null; |
| } |
| // We destroyed the cache and need to eliminate the expando on the node to avoid |
| // false lookups in the cache for entries that no longer exist |
| if ( isNode ) { |
| // IE does not allow us to delete expando properties from nodes, |
| // nor does it have a removeAttribute function on Document nodes; |
| // we must handle all of these cases |
| if ( jQuery.support.deleteExpando ) { |
| delete elem[ jQuery.expando ]; |
| } else if ( elem.removeAttribute ) { |
| elem.removeAttribute( jQuery.expando ); |
| } else { |
| elem[ jQuery.expando ] = null; |
| } |
| } |
| }, |
| // For internal use only. |
| _data: function( elem, name, data ) { |
| return jQuery.data( elem, name, data, true ); |
| }, |
| // A method for determining if a DOM node can handle the data expando |
| acceptData: function( elem ) { |
| if ( elem.nodeName ) { |
| var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; |
| if ( match ) { |
| return !(match === true || elem.getAttribute("classid") !== match); |
| } |
| } |
| return true; |
| } |
| }); |
| jQuery.fn.extend({ |
| data: function( key, value ) { |
| var parts, attr, name, |
| data = null; |
| if ( typeof key === "undefined" ) { |
| if ( this.length ) { |
| data = jQuery.data( this[0] ); |
| if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { |
| attr = this[0].attributes; |
| for ( var i = 0, l = attr.length; i < l; i++ ) { |
| name = attr[i].name; |
| if ( name.indexOf( "data-" ) === 0 ) { |
| name = jQuery.camelCase( name.substring(5) ); |
| dataAttr( this[0], name, data[ name ] ); |
| } |
| } |
| jQuery._data( this[0], "parsedAttrs", true ); |
| } |
| } |
| return data; |
| } else if ( typeof key === "object" ) { |
| return this.each(function() { |
| jQuery.data( this, key ); |
| }); |
| } |
| parts = key.split("."); |
| parts[1] = parts[1] ? "." + parts[1] : ""; |
| if ( value === undefined ) { |
| data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); |
| // Try to fetch any internally stored data first |
| if ( data === undefined && this.length ) { |
| data = jQuery.data( this[0], key ); |
| data = dataAttr( this[0], key, data ); |
| } |
| return data === undefined && parts[1] ? |
| this.data( parts[0] ) : |
| data; |
| } else { |
| return this.each(function() { |
| var $this = jQuery( this ), |
| args = [ parts[0], value ]; |
| $this.triggerHandler( "setData" + parts[1] + "!", args ); |
| jQuery.data( this, key, value ); |
| $this.triggerHandler( "changeData" + parts[1] + "!", args ); |
| }); |
| } |
| }, |
| removeData: function( key ) { |
| return this.each(function() { |
| jQuery.removeData( this, key ); |
| }); |
| } |
| }); |
| function dataAttr( elem, key, data ) { |
| // If nothing was found internally, try to fetch any |
| // data from the HTML5 data-* attribute |
| if ( data === undefined && elem.nodeType === 1 ) { |
| var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); |
| data = elem.getAttribute( name ); |
| if ( typeof data === "string" ) { |
| try { |
| data = data === "true" ? true : |
| data === "false" ? false : |
| data === "null" ? null : |
| jQuery.isNumeric( data ) ? parseFloat( data ) : |
| rbrace.test( data ) ? jQuery.parseJSON( data ) : |
| data; |
| } catch( e ) {} |
| // Make sure we set the data so it isn't changed later |
| jQuery.data( elem, key, data ); |
| } else { |
| data = undefined; |
| } |
| } |
| return data; |
| } |
| // checks a cache object for emptiness |
| function isEmptyDataObject( obj ) { |
| for ( var name in obj ) { |
| // if the public data object is empty, the private is still empty |
| if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { |
| continue; |
| } |
| if ( name !== "toJSON" ) { |
| return false; |
| } |
| } |
| return true; |
| } |
| function handleQueueMarkDefer( elem, type, src ) { |
| var deferDataKey = type + "defer", |
| queueDataKey = type + "queue", |
| markDataKey = type + "mark", |
| defer = jQuery._data( elem, deferDataKey ); |
| if ( defer && |
| ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && |
| ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { |
| // Give room for hard-coded callbacks to fire first |
| // and eventually mark/queue something else on the element |
| setTimeout( function() { |
| if ( !jQuery._data( elem, queueDataKey ) && |
| !jQuery._data( elem, markDataKey ) ) { |
| jQuery.removeData( elem, deferDataKey, true ); |
| defer.fire(); |
| } |
| }, 0 ); |
| } |
| } |
| jQuery.extend({ |
| _mark: function( elem, type ) { |
| if ( elem ) { |
| type = ( type || "fx" ) + "mark"; |
| jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); |
| } |
| }, |
| _unmark: function( force, elem, type ) { |
| if ( force !== true ) { |
| type = elem; |
| elem = force; |
| force = false; |
| } |
| if ( elem ) { |
| type = type || "fx"; |
| var key = type + "mark", |
| count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); |
| if ( count ) { |
| jQuery._data( elem, key, count ); |
| } else { |
| jQuery.removeData( elem, key, true ); |
| handleQueueMarkDefer( elem, type, "mark" ); |
| } |
| } |
| }, |
| queue: function( elem, type, data ) { |
| var q; |
| if ( elem ) { |
| type = ( type || "fx" ) + "queue"; |
| q = jQuery._data( elem, type ); |
| // Speed up dequeue by getting out quickly if this is just a lookup |
| if ( data ) { |
| if ( !q || jQuery.isArray(data) ) { |
| q = jQuery._data( elem, type, jQuery.makeArray(data) ); |
| } else { |
| q.push( data ); |
| } |
| } |
| return q || []; |
| } |
| }, |
| dequeue: function( elem, type ) { |
| type = type || "fx"; |
| var queue = jQuery.queue( elem, type ), |
| fn = queue.shift(), |
| hooks = {}; |
| // If the fx queue is dequeued, always remove the progress sentinel |
| if ( fn === "inprogress" ) { |
| fn = queue.shift(); |
| } |
| if ( fn ) { |
| // Add a progress sentinel to prevent the fx queue from being |
| // automatically dequeued |
| if ( type === "fx" ) { |
| queue.unshift( "inprogress" ); |
| } |
| jQuery._data( elem, type + ".run", hooks ); |
| fn.call( elem, function() { |
| jQuery.dequeue( elem, type ); |
| }, hooks ); |
| } |
| if ( !queue.length ) { |
| jQuery.removeData( elem, type + "queue " + type + ".run", true ); |
| handleQueueMarkDefer( elem, type, "queue" ); |
| } |
| } |
| }); |
| jQuery.fn.extend({ |
| queue: function( type, data ) { |
| if ( typeof type !== "string" ) { |
| data = type; |
| type = "fx"; |
| } |
| if ( data === undefined ) { |
| return jQuery.queue( this[0], type ); |
| } |
| return this.each(function() { |
| var queue = jQuery.queue( this, type, data ); |
| if ( type === "fx" && queue[0] !== "inprogress" ) { |
| jQuery.dequeue( this, type ); |
| } |
| }); |
| }, |
| dequeue: function( type ) { |
| return this.each(function() { |
| jQuery.dequeue( this, type ); |
| }); |
| }, |
| // Based off of the plugin by Clint Helfers, with permission. |
| // http://blindsignals.com/index.php/2009/07/jquery-delay/ |
| delay: function( time, type ) { |
| time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; |
| type = type || "fx"; |
| return this.queue( type, function( next, hooks ) { |
| var timeout = setTimeout( next, time ); |
| hooks.stop = function() { |
| clearTimeout( timeout ); |
| }; |
| }); |
| }, |
| clearQueue: function( type ) { |
| return this.queue( type || "fx", [] ); |
| }, |
| // Get a promise resolved when queues of a certain type |
| // are emptied (fx is the type by default) |
| promise: function( type, object ) { |
| if ( typeof type !== "string" ) { |
| object = type; |
| type = undefined; |
| } |
| type = type || "fx"; |
| var defer = jQuery.Deferred(), |
| elements = this, |
| i = elements.length, |
| count = 1, |
| deferDataKey = type + "defer", |
| queueDataKey = type + "queue", |
| markDataKey = type + "mark", |
| tmp; |
| function resolve() { |
| if ( !( --count ) ) { |
| defer.resolveWith( elements, [ elements ] ); |
| } |
| } |
| while( i-- ) { |
| if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || |
| ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || |
| jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && |
| jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { |
| count++; |
| tmp.add( resolve ); |
| } |
| } |
| resolve(); |
| return defer.promise(); |
| } |
| }); |
| var rclass = /[\n\t\r]/g, |
| rspace = /\s+/, |
| rreturn = /\r/g, |
| rtype = /^(?:button|input)$/i, |
| rfocusable = /^(?:button|input|object|select|textarea)$/i, |
| rclickable = /^a(?:rea)?$/i, |
| rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, |
| getSetAttribute = jQuery.support.getSetAttribute, |
| nodeHook, boolHook, fixSpecified; |
| jQuery.fn.extend({ |
| attr: function( name, value ) { |
| return jQuery.access( this, name, value, true, jQuery.attr ); |
| }, |
| removeAttr: function( name ) { |
| return this.each(function() { |
| jQuery.removeAttr( this, name ); |
| }); |
| }, |
| prop: function( name, value ) { |
| return jQuery.access( this, name, value, true, jQuery.prop ); |
| }, |
| removeProp: function( name ) { |
| name = jQuery.propFix[ name ] || name; |
| return this.each(function() { |
| // try/catch handles cases where IE balks (such as removing a property on window) |
| try { |
| this[ name ] = undefined; |
| delete this[ name ]; |
| } catch( e ) {} |
| }); |
| }, |
| addClass: function( value ) { |
| var classNames, i, l, elem, |
| setClass, c, cl; |
| if ( jQuery.isFunction( value ) ) { |
| return this.each(function( j ) { |
| jQuery( this ).addClass( value.call(this, j, this.className) ); |
| }); |
| } |
| if ( value && typeof value === "string" ) { |
| classNames = value.split( rspace ); |
| for ( i = 0, l = this.length; i < l; i++ ) { |
| elem = this[ i ]; |
| if ( elem.nodeType === 1 ) { |
| if ( !elem.className && classNames.length === 1 ) { |
| elem.className = value; |
| } else { |
| setClass = " " + elem.className + " "; |
| for ( c = 0, cl = classNames.length; c < cl; c++ ) { |
| if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { |
| setClass += classNames[ c ] + " "; |
| } |
| } |
| elem.className = jQuery.trim( setClass ); |
| } |
| } |
| } |
| } |
| return this; |
| }, |
| removeClass: function( value ) { |
| var classNames, i, l, elem, className, c, cl; |
| if ( jQuery.isFunction( value ) ) { |
| return this.each(function( j ) { |
| jQuery( this ).removeClass( value.call(this, j, this.className) ); |
| }); |
| } |
| if ( (value && typeof value === "string") || value === undefined ) { |
| classNames = ( value || "" ).split( rspace ); |
| for ( i = 0, l = this.length; i < l; i++ ) { |
| elem = this[ i ]; |
| if ( elem.nodeType === 1 && elem.className ) { |
| if ( value ) { |
| className = (" " + elem.className + " ").replace( rclass, " " ); |
| for ( c = 0, cl = classNames.length; c < cl; c++ ) { |
| className = className.replace(" " + classNames[ c ] + " ", " "); |
| } |
| elem.className = jQuery.trim( className ); |
| } else { |
| elem.className = ""; |
| } |
| } |
| } |
| } |
| return this; |
| }, |
| toggleClass: function( value, stateVal ) { |
| var type = typeof value, |
| isBool = typeof stateVal === "boolean"; |
| if ( jQuery.isFunction( value ) ) { |
| return this.each(function( i ) { |
| jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); |
| }); |
| } |
| return this.each(function() { |
| if ( type === "string" ) { |
| // toggle individual class names |
| var className, |
| i = 0, |
| self = jQuery( this ), |
| state = stateVal, |
| classNames = value.split( rspace ); |
| while ( (className = classNames[ i++ ]) ) { |
| // check each className given, space seperated list |
| state = isBool ? state : !self.hasClass( className ); |
| self[ state ? "addClass" : "removeClass" ]( className ); |
| } |
| } else if ( type === "undefined" || type === "boolean" ) { |
| if ( this.className ) { |
| // store className if set |
| jQuery._data( this, "__className__", this.className ); |
| } |
| // toggle whole className |
| this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; |
| } |
| }); |
| }, |
| hasClass: function( selector ) { |
| var className = " " + selector + " ", |
| i = 0, |
| l = this.length; |
| for ( ; i < l; i++ ) { |
| if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { |
| return true; |
| } |
| } |
| return false; |
| }, |
| val: function( value ) { |
| var hooks, ret, isFunction, |
| elem = this[0]; |
| if ( !arguments.length ) { |
| if ( elem ) { |
| hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { |
| return ret; |
| } |
| ret = elem.value; |
| return typeof ret === "string" ? |
| // handle most common string cases |
| ret.replace(rreturn, "") : |
| // handle cases where value is null/undef or number |
| ret == null ? "" : ret; |
| } |
| return undefined; |
| } |
| isFunction = jQuery.isFunction( value ); |
| return this.each(function( i ) { |
| var self = jQuery(this), val; |
| if ( this.nodeType !== 1 ) { |
| return; |
| } |
| if ( isFunction ) { |
| val = value.call( this, i, self.val() ); |
| } else { |
| val = value; |
| } |
| // Treat null/undefined as ""; convert numbers to string |
| if ( val == null ) { |
| val = ""; |
| } else if ( typeof val === "number" ) { |
| val += ""; |
| } else if ( jQuery.isArray( val ) ) { |
| val = jQuery.map(val, function ( value ) { |
| return value == null ? "" : value + ""; |
| }); |
| } |
| hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; |
| // If set returns undefined, fall back to normal setting |
| if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { |
| this.value = val; |
| } |
| }); |
| } |
| }); |
| jQuery.extend({ |
| valHooks: { |
| option: { |
| get: function( elem ) { |
| // attributes.value is undefined in Blackberry 4.7 but |
| // uses .value. See #6932 |
| var val = elem.attributes.value; |
| return !val || val.specified ? elem.value : elem.text; |
| } |
| }, |
| select: { |
| get: function( elem ) { |
| var value, i, max, option, |
| index = elem.selectedIndex, |
| values = [], |
| options = elem.options, |
| one = elem.type === "select-one"; |
| // Nothing was selected |
| if ( index < 0 ) { |
| return null; |
| } |
| // Loop through all the selected options |
| i = one ? index : 0; |
| max = one ? index + 1 : options.length; |
| for ( ; i < max; i++ ) { |
| option = options[ i ]; |
| // Don't return options that are disabled or in a disabled optgroup |
| if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && |
| (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { |
| // Get the specific value for the option |
| value = jQuery( option ).val(); |
| // We don't need an array for one selects |
| if ( one ) { |
| return value; |
| } |
| // Multi-Selects return an array |
| values.push( value ); |
| } |
| } |
| // Fixes Bug #2551 -- select.val() broken in IE after form.reset() |
| if ( one && !values.length && options.length ) { |
| return jQuery( options[ index ] ).val(); |
| } |
| return values; |
| }, |
| set: function( elem, value ) { |
| var values = jQuery.makeArray( value ); |
| jQuery(elem).find("option").each(function() { |
| this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; |
| }); |
| if ( !values.length ) { |
| elem.selectedIndex = -1; |
| } |
| return values; |
| } |
| } |
| }, |
| attrFn: { |
| val: true, |
| css: true, |
| html: true, |
| text: true, |
| data: true, |
| width: true, |
| height: true, |
| offset: true |
| }, |
| attr: function( elem, name, value, pass ) { |
| var ret, hooks, notxml, |
| nType = elem.nodeType; |
| // don't get/set attributes on text, comment and attribute nodes |
| if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { |
| return undefined; |
| } |
| if ( pass && name in jQuery.attrFn ) { |
| return jQuery( elem )[ name ]( value ); |
| } |
| // Fallback to prop when attributes are not supported |
| if ( !("getAttribute" in elem) ) { |
| return jQuery.prop( elem, name, value ); |
| } |
| notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); |
| // All attributes are lowercase |
| // Grab necessary hook if one is defined |
| if ( notxml ) { |
| name = name.toLowerCase(); |
| hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); |
| } |
| if ( value !== undefined ) { |
| if ( value === null ) { |
| jQuery.removeAttr( elem, name ); |
| return undefined; |
| } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { |
| return ret; |
| } else { |
| elem.setAttribute( name, "" + value ); |
| return value; |
| } |
| } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { |
| return ret; |
| } else { |
| ret = elem.getAttribute( name ); |
| // Non-existent attributes return null, we normalize to undefined |
| return ret === null ? |
| undefined : |
| ret; |
| } |
| }, |
| removeAttr: function( elem, value ) { |
| var propName, attrNames, name, l, |
| i = 0; |
| if ( elem.nodeType === 1 ) { |
| attrNames = ( value || "" ).split( rspace ); |
| l = attrNames.length; |
| for ( ; i < l; i++ ) { |
| name = attrNames[ i ].toLowerCase(); |
| propName = jQuery.propFix[ name ] || name; |
| // See #9699 for explanation of this approach (setting first, then removal) |
| jQuery.attr( elem, name, "" ); |
| elem.removeAttribute( getSetAttribute ? name : propName ); |
| // Set corresponding property to false for boolean attributes |
| if ( rboolean.test( name ) && propName in elem ) { |
| elem[ propName ] = false; |
| } |
| } |
| } |
| }, |
| attrHooks: { |
| type: { |
| set: function( elem, value ) { |
| // We can't allow the type property to be changed (since it causes problems in IE) |
| if ( rtype.test( elem.nodeName ) && elem.parentNode ) { |
| jQuery.error( "type property can't be changed" ); |
| } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { |
| // Setting the type on a radio button after the value resets the value in IE6-9 |
| // Reset value to it's default in case type is set after value |
| // This is for element creation |
| var val = elem.value; |
| elem.setAttribute( "type", value ); |
| if ( val ) { |
| elem.value = val; |
| } |
| return value; |
| } |
| } |
| }, |
| // Use the value property for back compat |
| // Use the nodeHook for button elements in IE6/7 (#1954) |
| value: { |
| get: function( elem, name ) { |
| if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { |
| return nodeHook.get( elem, name ); |
| } |
| return name in elem ? |
| elem.value : |
| null; |
| }, |
| set: function( elem, value, name ) { |
| if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { |
| return nodeHook.set( elem, value, name ); |
| } |
| // Does not return so that setAttribute is also used |
| elem.value = value; |
| } |
| } |
| }, |
| propFix: { |
| tabindex: "tabIndex", |
| readonly: "readOnly", |
| "for": "htmlFor", |
| "class": "className", |
| maxlength: "maxLength", |
| cellspacing: "cellSpacing", |
| cellpadding: "cellPadding", |
| rowspan: "rowSpan", |
| colspan: "colSpan", |
| usemap: "useMap", |
| frameborder: "frameBorder", |
| contenteditable: "contentEditable" |
| }, |
| prop: function( elem, name, value ) { |
| var ret, hooks, notxml, |
| nType = elem.nodeType; |
| // don't get/set properties on text, comment and attribute nodes |
| if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { |
| return undefined; |
| } |
| notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); |
| if ( notxml ) { |
| // Fix name and attach hooks |
| name = jQuery.propFix[ name ] || name; |
| hooks = jQuery.propHooks[ name ]; |
| } |
| if ( value !== undefined ) { |
| if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { |
| return ret; |
| } else { |
| return ( elem[ name ] = value ); |
| } |
| } else { |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { |
| return ret; |
| } else { |
| return elem[ name ]; |
| } |
| } |
| }, |
| propHooks: { |
| tabIndex: { |
| get: function( elem ) { |
| // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set |
| // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ |
| var attributeNode = elem.getAttributeNode("tabindex"); |
| return attributeNode && attributeNode.specified ? |
| parseInt( attributeNode.value, 10 ) : |
| rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? |
| 0 : |
| undefined; |
| } |
| } |
| } |
| }); |
| // Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) |
| jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; |
| // Hook for boolean attributes |
| boolHook = { |
| get: function( elem, name ) { |
| // Align boolean attributes with corresponding properties |
| // Fall back to attribute presence where some booleans are not supported |
| var attrNode, |
| property = jQuery.prop( elem, name ); |
| return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? |
| name.toLowerCase() : |
| undefined; |
| }, |
| set: function( elem, value, name ) { |
| var propName; |
| if ( value === false ) { |
| // Remove boolean attributes when set to false |
| jQuery.removeAttr( elem, name ); |
| } else { |
| // value is true since we know at this point it's type boolean and not false |
| // Set boolean attributes to the same name and set the DOM property |
| propName = jQuery.propFix[ name ] || name; |
| if ( propName in elem ) { |
| // Only set the IDL specifically if it already exists on the element |
| elem[ propName ] = true; |
| } |
| elem.setAttribute( name, name.toLowerCase() ); |
| } |
| return name; |
| } |
| }; |
| // IE6/7 do not support getting/setting some attributes with get/setAttribute |
| if ( !getSetAttribute ) { |
| fixSpecified = { |
| name: true, |
| id: true |
| }; |
| // Use this for any attribute in IE6/7 |
| // This fixes almost every IE6/7 issue |
| nodeHook = jQuery.valHooks.button = { |
| get: function( elem, name ) { |
| var ret; |
| ret = elem.getAttributeNode( name ); |
| return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? |
| ret.nodeValue : |
| undefined; |
| }, |
| set: function( elem, value, name ) { |
| // Set the existing or create a new attribute node |
| var ret = elem.getAttributeNode( name ); |
| if ( !ret ) { |
| ret = document.createAttribute( name ); |
| elem.setAttributeNode( ret ); |
| } |
| return ( ret.nodeValue = value + "" ); |
| } |
| }; |
| // Apply the nodeHook to tabindex |
| jQuery.attrHooks.tabindex.set = nodeHook.set; |
| // Set width and height to auto instead of 0 on empty string( Bug #8150 ) |
| // This is for removals |
| jQuery.each([ "width", "height" ], function( i, name ) { |
| jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { |
| set: function( elem, value ) { |
| if ( value === "" ) { |
| elem.setAttribute( name, "auto" ); |
| return value; |
| } |
| } |
| }); |
| }); |
| // Set contenteditable to false on removals(#10429) |
| // Setting to empty string throws an error as an invalid value |
| jQuery.attrHooks.contenteditable = { |
| get: nodeHook.get, |
| set: function( elem, value, name ) { |
| if ( value === "" ) { |
| value = "false"; |
| } |
| nodeHook.set( elem, value, name ); |
| } |
| }; |
| } |
| // Some attributes require a special call on IE |
| if ( !jQuery.support.hrefNormalized ) { |
| jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { |
| jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { |
| get: function( elem ) { |
| var ret = elem.getAttribute( name, 2 ); |
| return ret === null ? undefined : ret; |
| } |
| }); |
| }); |
| } |
| if ( !jQuery.support.style ) { |
| jQuery.attrHooks.style = { |
| get: function( elem ) { |
| // Return undefined in the case of empty string |
| // Normalize to lowercase since IE uppercases css property names |
| return elem.style.cssText.toLowerCase() || undefined; |
| }, |
| set: function( elem, value ) { |
| return ( elem.style.cssText = "" + value ); |
| } |
| }; |
| } |
| // Safari mis-reports the default selected property of an option |
| // Accessing the parent's selectedIndex property fixes it |
| if ( !jQuery.support.optSelected ) { |
| jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { |
| get: function( elem ) { |
| var parent = elem.parentNode; |
| if ( parent ) { |
| parent.selectedIndex; |
| // Make sure that it also works with optgroups, see #5701 |
| if ( parent.parentNode ) { |
| parent.parentNode.selectedIndex; |
| } |
| } |
| return null; |
| } |
| }); |
| } |
| // IE6/7 call enctype encoding |
| if ( !jQuery.support.enctype ) { |
| jQuery.propFix.enctype = "encoding"; |
| } |
| // Radios and checkboxes getter/setter |
| if ( !jQuery.support.checkOn ) { |
| jQuery.each([ "radio", "checkbox" ], function() { |
| jQuery.valHooks[ this ] = { |
| get: function( elem ) { |
| // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified |
| return elem.getAttribute("value") === null ? "on" : elem.value; |
| } |
| }; |
| }); |
| } |
| jQuery.each([ "radio", "checkbox" ], function() { |
| jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { |
| set: function( elem, value ) { |
| if ( jQuery.isArray( value ) ) { |
| return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); |
| } |
| } |
| }); |
| }); |
| var rnamespaces = /\.(.*)$/, |
| rformElems = /^(?:textarea|input|select)$/i, |
| rperiod = /\./g, |
| rspaces = / /g, |
| rescape = /[^\w\s.|`]/g, |
| rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, |
| rhoverHack = /\bhover(\.\S+)?/, |
| rkeyEvent = /^key/, |
| rmouseEvent = /^(?:mouse|contextmenu)|click/, |
| rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, |
| quickParse = function( selector ) { |
| var quick = rquickIs.exec( selector ); |
| if ( quick ) { |
| // 0 1 2 3 |
| // [ _, tag, id, class ] |
| quick[1] = ( quick[1] || "" ).toLowerCase(); |
| quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); |
| } |
| return quick; |
| }, |
| quickIs = function( elem, m ) { |
| return ( |
| (!m[1] || elem.nodeName.toLowerCase() === m[1]) && |
| (!m[2] || elem.id === m[2]) && |
| (!m[3] || m[3].test( elem.className )) |
| ); |
| }, |
| hoverHack = function( events ) { |
| return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); |
| }; |
| /* |
| * Helper functions for managing events -- not part of the public interface. |
| * Props to Dean Edwards' addEvent library for many of the ideas. |
| */ |
| jQuery.event = { |
| add: function( elem, types, handler, data, selector ) { |
| var elemData, eventHandle, events, |
| t, tns, type, namespaces, handleObj, |
| handleObjIn, quick, handlers, special; |
| // Don't attach events to noData or text/comment nodes (allow plain objects tho) |
| if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { |
| return; |
| } |
| // Caller can pass in an object of custom data in lieu of the handler |
| if ( handler.handler ) { |
| handleObjIn = handler; |
| handler = handleObjIn.handler; |
| } |
| // Make sure that the handler has a unique ID, used to find/remove it later |
| if ( !handler.guid ) { |
| handler.guid = jQuery.guid++; |
| } |
| // Init the element's event structure and main handler, if this is the first |
| events = elemData.events; |
| if ( !events ) { |
| elemData.events = events = {}; |
| } |
| eventHandle = elemData.handle; |
| if ( !eventHandle ) { |
| elemData.handle = eventHandle = function( e ) { |
| // Discard the second event of a jQuery.event.trigger() and |
| // when an event is called after a page has unloaded |
| return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? |
| jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : |
| undefined; |
| }; |
| // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events |
| eventHandle.elem = elem; |
| } |
| // Handle multiple events separated by a space |
| // jQuery(...).bind("mouseover mouseout", fn); |
| types = hoverHack(types).split( " " ); |
| for ( t = 0; t < types.length; t++ ) { |
| tns = rtypenamespace.exec( types[t] ) || []; |
| type = tns[1]; |
| namespaces = ( tns[2] || "" ).split( "." ).sort(); |
| // If event changes its type, use the special event handlers for the changed type |
| special = jQuery.event.special[ type ] || {}; |
| // If selector defined, determine special event api type, otherwise given type |
| type = ( selector ? special.delegateType : special.bindType ) || type; |
| // Update special based on newly reset type |
| special = jQuery.event.special[ type ] || {}; |
| // handleObj is passed to all event handlers |
| handleObj = jQuery.extend({ |
| type: type, |
| origType: tns[1], |
| data: data, |
| handler: handler, |
| guid: handler.guid, |
| selector: selector, |
| namespace: namespaces.join(".") |
| }, handleObjIn ); |
| // Delegated event; pre-analyze selector so it's processed quickly on event dispatch |
| if ( selector ) { |
| handleObj.quick = quickParse( selector ); |
| if ( !handleObj.quick && jQuery.expr.match.POS.test( selector ) ) { |
| handleObj.isPositional = true; |
| } |
| } |
| // Init the event handler queue if we're the first |
| handlers = events[ type ]; |
| if ( !handlers ) { |
| handlers = events[ type ] = []; |
| handlers.delegateCount = 0; |
| // Only use addEventListener/attachEvent if the special events handler returns false |
| if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { |
| // Bind the global event handler to the element |
| if ( elem.addEventListener ) { |
| elem.addEventListener( type, eventHandle, false ); |
| } else if ( elem.attachEvent ) { |
| elem.attachEvent( "on" + type, eventHandle ); |
| } |
| } |
| } |
| if ( special.add ) { |
| special.add.call( elem, handleObj ); |
| if ( !handleObj.handler.guid ) { |
| handleObj.handler.guid = handler.guid; |
| } |
| } |
| // Add to the element's handler list, delegates in front |
| if ( selector ) { |
| handlers.splice( handlers.delegateCount++, 0, handleObj ); |
| } else { |
| handlers.push( handleObj ); |
| } |
| // Keep track of which events have ever been used, for event optimization |
| jQuery.event.global[ type ] = true; |
| } |
| // Nullify elem to prevent memory leaks in IE |
| elem = null; |
| }, |
| global: {}, |
| // Detach an event or set of events from an element |
| remove: function( elem, types, handler, selector ) { |
| var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), |
| t, tns, type, namespaces, origCount, |
| j, events, special, handle, eventType, handleObj; |
| if ( !elemData || !(events = elemData.events) ) { |
| return; |
| } |
| // Once for each type.namespace in types; type may be omitted |
| types = hoverHack( types || "" ).split(" "); |
| for ( t = 0; t < types.length; t++ ) { |
| tns = rtypenamespace.exec( types[t] ) || []; |
| type = tns[1]; |
| namespaces = tns[2]; |
| // Unbind all events (on this namespace, if provided) for the element |
| if ( !type ) { |
| namespaces = namespaces? "." + namespaces : ""; |
| for ( j in events ) { |
| jQuery.event.remove( elem, j + namespaces, handler, selector ); |
| } |
| return; |
| } |
| special = jQuery.event.special[ type ] || {}; |
| type = ( selector? special.delegateType : special.bindType ) || type; |
| eventType = events[ type ] || []; |
| origCount = eventType.length; |
| namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; |
| // Only need to loop for special events or selective removal |
| if ( handler || namespaces || selector || special.remove ) { |
| for ( j = 0; j < eventType.length; j++ ) { |
| handleObj = eventType[ j ]; |
| if ( !handler || handler.guid === handleObj.guid ) { |
| if ( !namespaces || namespaces.test( handleObj.namespace ) ) { |
| if ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) { |
| eventType.splice( j--, 1 ); |
| if ( handleObj.selector ) { |
| eventType.delegateCount--; |
| } |
| if ( special.remove ) { |
| special.remove.call( elem, handleObj ); |
| } |
| } |
| } |
| } |
| } |
| } else { |
| // Removing all events |
| eventType.length = 0; |
| } |
| // Remove generic event handler if we removed something and no more handlers exist |
| // (avoids potential for endless recursion during removal of special event handlers) |
| if ( eventType.length === 0 && origCount !== eventType.length ) { |
| if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { |
| jQuery.removeEvent( elem, type, elemData.handle ); |
| } |
| delete events[ type ]; |
| } |
| } |
| // Remove the expando if it's no longer used |
| if ( jQuery.isEmptyObject( events ) ) { |
| handle = elemData.handle; |
| if ( handle ) { |
| handle.elem = null; |
| } |
| // removeData also checks for emptiness and clears the expando if empty |
| // so use it instead of delete |
| jQuery.removeData( elem, [ "events", "handle" ], true ); |
| } |
| }, |
| // Events that are safe to short-circuit if no handlers are attached. |
| // Native DOM events should not be added, they may have inline handlers. |
| customEvent: { |
| "getData": true, |
| "setData": true, |
| "changeData": true |
| }, |
| trigger: function( event, data, elem, onlyHandlers ) { |
| // Don't do events on text and comment nodes |
| if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { |
| return; |
| } |
| // Event object or event type |
| var type = event.type || event, |
| namespaces = [], |
| cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; |
| if ( type.indexOf( "!" ) >= 0 ) { |
| // Exclusive events trigger only for the exact event (no namespaces) |
| type = type.slice(0, -1); |
| exclusive = true; |
| } |
| if ( type.indexOf( "." ) >= 0 ) { |
| // Namespaced trigger; create a regexp to match event type in handle() |
| namespaces = type.split("."); |
| type = namespaces.shift(); |
| namespaces.sort(); |
| } |
| if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { |
| // No jQuery handlers for this event type, and it can't have inline handlers |
| return; |
| } |
| // Caller can pass in an Event, Object, or just an event type string |
| event = typeof event === "object" ? |
| // jQuery.Event object |
| event[ jQuery.expando ] ? event : |
| // Object literal |
| new jQuery.Event( type, event ) : |
| // Just the event type (string) |
| new jQuery.Event( type ); |
| event.type = type; |
| event.isTrigger = true; |
| event.exclusive = exclusive; |
| event.namespace = namespaces.join( "." ); |
| event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; |
| ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; |
| // triggerHandler() and global events don't bubble or run the default action |
| if ( onlyHandlers || !elem ) { |
| event.preventDefault(); |
| } |
| // Handle a global trigger |
| if ( !elem ) { |
| // TODO: Stop taunting the data cache; remove global events and always attach to document |
| cache = jQuery.cache; |
| for ( i in cache ) { |
| if ( cache[ i ].events && cache[ i ].events[ type ] ) { |
| jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); |
| } |
| } |
| return; |
| } |
| // Clean up the event in case it is being reused |
| event.result = undefined; |
| if ( !event.target ) { |
| event.target = elem; |
| } |
| // Clone any incoming data and prepend the event, creating the handler arg list |
| data = data != null ? jQuery.makeArray( data ) : []; |
| data.unshift( event ); |
| // Allow special events to draw outside the lines |
| special = jQuery.event.special[ type ] || {}; |
| if ( special.trigger && special.trigger.apply( elem, data ) === false ) { |
| return; |
| } |
| // Determine event propagation path in advance, per W3C events spec (#9951) |
| // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) |
| eventPath = [[ elem, special.bindType || type ]]; |
| if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { |
| bubbleType = special.delegateType || type; |
| old = null; |
| for ( cur = elem.parentNode; cur; cur = cur.parentNode ) { |
| eventPath.push([ cur, bubbleType ]); |
| old = cur; |
| } |
| // Only add window if we got to document (e.g., not plain obj or detached DOM) |
| if ( old && old === elem.ownerDocument ) { |
| eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); |
| } |
| } |
| // Fire handlers on the event path |
| for ( i = 0; i < eventPath.length; i++ ) { |
| cur = eventPath[i][0]; |
| event.type = eventPath[i][1]; |
| handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); |
| if ( handle ) { |
| handle.apply( cur, data ); |
| } |
| handle = ontype && cur[ ontype ]; |
| if ( handle && jQuery.acceptData( cur ) ) { |
| handle.apply( cur, data ); |
| } |
| if ( event.isPropagationStopped() ) { |
| break; |
| } |
| } |
| event.type = type; |
| // If nobody prevented the default action, do it now |
| if ( !event.isDefaultPrevented() ) { |
| if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && |
| !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { |
| // Call a native DOM method on the target with the same name name as the event. |
| // Can't use an .isFunction() check here because IE6/7 fails that test. |
| // Don't do default actions on window, that's where global variables be (#6170) |
| // IE<9 dies on focus/blur to hidden element (#1486) |
| if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { |
| // Don't re-trigger an onFOO event when we call its FOO() method |
| old = elem[ ontype ]; |
| if ( old ) { |
| elem[ ontype ] = null; |
| } |
| // Prevent re-triggering of the same event, since we already bubbled it above |
| jQuery.event.triggered = type; |
| elem[ type ](); |
| jQuery.event.triggered = undefined; |
| if ( old ) { |
| elem[ ontype ] = old; |
| } |
| } |
| } |
| } |
| return event.result; |
| }, |
| dispatch: function( event ) { |
| // Make a writable jQuery.Event from the native event object |
| event = jQuery.event.fix( event || window.event ); |
| var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), |
| delegateCount = handlers.delegateCount, |
| args = [].slice.call( arguments, 0 ), |
| run_all = !event.exclusive && !event.namespace, |
| specialHandle = ( jQuery.event.special[ event.type ] || {} ).handle, |
| handlerQueue = [], |
| i, j, cur, ret, selMatch, matched, matches, handleObj, sel, hit, related; |
| // Use the fix-ed jQuery.Event rather than the (read-only) native event |
| args[0] = event; |
| event.delegateTarget = this; |
| // Determine handlers that should run if there are delegated events |
| // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) |
| if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { |
| for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { |
| selMatch = {}; |
| matches = []; |
| for ( i = 0; i < delegateCount; i++ ) { |
| handleObj = handlers[ i ]; |
| sel = handleObj.selector; |
| hit = selMatch[ sel ]; |
| if ( handleObj.isPositional ) { |
| // Since .is() does not work for positionals; see http://jsfiddle.net/eJ4yd/3/ |
| hit = ( hit || (selMatch[ sel ] = jQuery( sel )) ).index( cur ) >= 0; |
| } else if ( hit === undefined ) { |
| hit = selMatch[ sel ] = ( handleObj.quick ? quickIs( cur, handleObj.quick ) : jQuery( cur ).is( sel ) ); |
| } |
| if ( hit ) { |
| matches.push( handleObj ); |
| } |
| } |
| if ( matches.length ) { |
| handlerQueue.push({ elem: cur, matches: matches }); |
| } |
| } |
| } |
| // Add the remaining (directly-bound) handlers |
| if ( handlers.length > delegateCount ) { |
| handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); |
| } |
| // Run delegates first; they may want to stop propagation beneath us |
| for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { |
| matched = handlerQueue[ i ]; |
| event.currentTarget = matched.elem; |
| for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { |
| handleObj = matched.matches[ j ]; |
| // Triggered event must either 1) be non-exclusive and have no namespace, or |
| // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). |
| if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { |
| event.data = handleObj.data; |
| event.handleObj = handleObj; |
| ret = ( specialHandle || handleObj.handler ).apply( matched.elem, args ); |
| if ( ret !== undefined ) { |
| event.result = ret; |
| if ( ret === false ) { |
| event.preventDefault(); |
| event.stopPropagation(); |
| } |
| } |
| } |
| } |
| } |
| return event.result; |
| }, |
| // Includes some event props shared by KeyEvent and MouseEvent |
| // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** |
| props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), |
| fixHooks: {}, |
| keyHooks: { |
| props: "char charCode key keyCode".split(" "), |
| filter: function( event, original ) { |
| // Add which for key events |
| if ( event.which == null ) { |
| event.which = original.charCode != null ? original.charCode : original.keyCode; |
| } |
| return event; |
| } |
| }, |
| mouseHooks: { |
| props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement wheelDelta".split(" "), |
| filter: function( event, original ) { |
| var eventDoc, doc, body, |
| button = original.button, |
| fromElement = original.fromElement; |
| // Calculate pageX/Y if missing and clientX/Y available |
| if ( event.pageX == null && original.clientX != null ) { |
| eventDoc = event.target.ownerDocument || document; |
| doc = eventDoc.documentElement; |
| body = eventDoc.body; |
| event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); |
| event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); |
| } |
| // Add relatedTarget, if necessary |
| if ( !event.relatedTarget && fromElement ) { |
| event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; |
| } |
| // Add which for click: 1 === left; 2 === middle; 3 === right |
| // Note: button is not normalized, so don't use it |
| if ( !event.which && button !== undefined ) { |
| event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); |
| } |
| return event; |
| } |
| }, |
| fix: function( event ) { |
| if ( event[ jQuery.expando ] ) { |
| return event; |
| } |
| // Create a writable copy of the event object and normalize some properties |
| var i, prop, |
| originalEvent = event, |
| fixHook = jQuery.event.fixHooks[ event.type ] || {}, |
| copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; |
| event = jQuery.Event( originalEvent ); |
| for ( i = copy.length; i; ) { |
| prop = copy[ --i ]; |
| event[ prop ] = originalEvent[ prop ]; |
| } |
| // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) |
| if ( !event.target ) { |
| event.target = originalEvent.srcElement || document; |
| } |
| // Target should not be a text node (#504, Safari) |
| if ( event.target.nodeType === 3 ) { |
| event.target = event.target.parentNode; |
| } |
| // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) |
| if ( event.metaKey === undefined ) { |
| event.metaKey = event.ctrlKey; |
| } |
| return fixHook.filter? fixHook.filter( event, originalEvent ) : event; |
| }, |
| special: { |
| ready: { |
| // Make sure the ready event is setup |
| setup: jQuery.bindReady |
| }, |
| focus: { |
| delegateType: "focusin", |
| noBubble: true |
| }, |
| blur: { |
| delegateType: "focusout", |
| noBubble: true |
| }, |
| beforeunload: { |
| setup: function( data, namespaces, eventHandle ) { |
| // We only want to do this special case on windows |
| if ( jQuery.isWindow( this ) ) { |
| this.onbeforeunload = eventHandle; |
| } |
| }, |
| teardown: function( namespaces, eventHandle ) { |
| if ( this.onbeforeunload === eventHandle ) { |
| this.onbeforeunload = null; |
| } |
| } |
| } |
| }, |
| simulate: function( type, elem, event, bubble ) { |
| // Piggyback on a donor event to simulate a different one. |
| // Fake originalEvent to avoid donor's stopPropagation, but if the |
| // simulated event prevents default then we do the same on the donor. |
| var e = jQuery.extend( |
| new jQuery.Event(), |
| event, |
| { type: type, |
| isSimulated: true, |
| originalEvent: {} |
| } |
| ); |
| if ( bubble ) { |
| jQuery.event.trigger( e, null, elem ); |
| } else { |
| jQuery.event.dispatch.call( elem, e ); |
| } |
| if ( e.isDefaultPrevented() ) { |
| event.preventDefault(); |
| } |
| } |
| }; |
| // Some plugins are using, but it's undocumented/deprecated and will be removed. |
| // The 1.7 special event interface should provide all the hooks needed now. |
| jQuery.event.handle = jQuery.event.dispatch; |
| jQuery.removeEvent = document.removeEventListener ? |
| function( elem, type, handle ) { |
| if ( elem.removeEventListener ) { |
| elem.removeEventListener( type, handle, false ); |
| } |
| } : |
| function( elem, type, handle ) { |
| if ( elem.detachEvent ) { |
| elem.detachEvent( "on" + type, handle ); |
| } |
| }; |
| jQuery.Event = function( src, props ) { |
| // Allow instantiation without the 'new' keyword |
| if ( !(this instanceof jQuery.Event) ) { |
| return new jQuery.Event( src, props ); |
| } |
| // Event object |
| if ( src && src.type ) { |
| this.originalEvent = src; |
| this.type = src.type; |
| // Events bubbling up the document may have been marked as prevented |
| // by a handler lower down the tree; reflect the correct value. |
| this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || |
| src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; |
| // Event type |
| } else { |
| this.type = src; |
| } |
| // Put explicitly provided properties onto the event object |
| if ( props ) { |
| jQuery.extend( this, props ); |
| } |
| // Create a timestamp if incoming event doesn't have one |
| this.timeStamp = src && src.timeStamp || jQuery.now(); |
| // Mark it as fixed |
| this[ jQuery.expando ] = true; |
| }; |
| function returnFalse() { |
| return false; |
| } |
| function returnTrue() { |
| return true; |
| } |
| // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding |
| // http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html |
| jQuery.Event.prototype = { |
| preventDefault: function() { |
| this.isDefaultPrevented = returnTrue; |
| var e = this.originalEvent; |
| if ( !e ) { |
| return; |
| } |
| // if preventDefault exists run it on the original event |
| if ( e.preventDefault ) { |
| e.preventDefault(); |
| // otherwise set the returnValue property of the original event to false (IE) |
| } else { |
| e.returnValue = false; |
| } |
| }, |
| stopPropagation: function() { |
| this.isPropagationStopped = returnTrue; |
| var e = this.originalEvent; |
| if ( !e ) { |
| return; |
| } |
| // if stopPropagation exists run it on the original event |
| if ( e.stopPropagation ) { |
| e.stopPropagation(); |
| } |
| // otherwise set the cancelBubble property of the original event to true (IE) |
| e.cancelBubble = true; |
| }, |
| stopImmediatePropagation: function() { |
| this.isImmediatePropagationStopped = returnTrue; |
| this.stopPropagation(); |
| }, |
| isDefaultPrevented: returnFalse, |
| isPropagationStopped: returnFalse, |
| isImmediatePropagationStopped: returnFalse |
| }; |
| // Create mouseenter/leave events using mouseover/out and event-time checks |
| jQuery.each({ |
| mouseenter: "mouseover", |
| mouseleave: "mouseout" |
| }, function( orig, fix ) { |
| jQuery.event.special[ orig ] = jQuery.event.special[ fix ] = { |
| delegateType: fix, |
| bindType: fix, |
| handle: function( event ) { |
| var target = this, |
| related = event.relatedTarget, |
| handleObj = event.handleObj, |
| selector = handleObj.selector, |
| oldType, ret; |
| // For a real mouseover/out, always call the handler; for |
| // mousenter/leave call the handler if related is outside the target. |
| // NB: No relatedTarget if the mouse left/entered the browser window |
| if ( !related || handleObj.origType === event.type || (related !== target && !jQuery.contains( target, related )) ) { |
| oldType = event.type; |
| event.type = handleObj.origType; |
| ret = handleObj.handler.apply( this, arguments ); |
| event.type = oldType; |
| } |
| return ret; |
| } |
| }; |
| }); |
| // IE submit delegation |
| if ( !jQuery.support.submitBubbles ) { |
| jQuery.event.special.submit = { |
| setup: function() { |
| // Only need this for delegated form submit events |
| if ( jQuery.nodeName( this, "form" ) ) { |
| return false; |
| } |
| // Lazy-add a submit handler when a descendant form may potentially be submitted |
| jQuery.event.add( this, "click._submit keypress._submit", function( e ) { |
| // Node name check avoids a VML-related crash in IE (#9807) |
| var elem = e.target, |
| form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; |
| if ( form && !form._submit_attached ) { |
| jQuery.event.add( form, "submit._submit", function( event ) { |
| // Form was submitted, bubble the event up the tree |
| if ( this.parentNode ) { |
| jQuery.event.simulate( "submit", this.parentNode, event, true ); |
| } |
| }); |
| form._submit_attached = true; |
| } |
| }); |
| // return undefined since we don't need an event listener |
| }, |
| teardown: function() { |
| // Only need this for delegated form submit events |
| if ( jQuery.nodeName( this, "form" ) ) { |
| return false; |
| } |
| // Remove delegated handlers; cleanData eventually reaps submit handlers attached above |
| jQuery.event.remove( this, "._submit" ); |
| } |
| }; |
| } |
| // IE change delegation and checkbox/radio fix |
| if ( !jQuery.support.changeBubbles ) { |
| jQuery.event.special.change = { |
| setup: function() { |
| if ( rformElems.test( this.nodeName ) ) { |
| // IE doesn't fire change on a check/radio until blur; trigger it on click |
| // after a propertychange. Eat the blur-change in special.change.handle. |
| // This still fires onchange a second time for check/radio after blur. |
| if ( this.type === "checkbox" || this.type === "radio" ) { |
| jQuery.event.add( this, "propertychange._change", function( event ) { |
| if ( event.originalEvent.propertyName === "checked" ) { |
| this._just_changed = true; |
| } |
| }); |
| jQuery.event.add( this, "click._change", function( event ) { |
| if ( this._just_changed ) { |
| this._just_changed = false; |
| jQuery.event.simulate( "change", this, event, true ); |
| } |
| }); |
| } |
| return false; |
| } |
| // Delegated event; lazy-add a change handler on descendant inputs |
| jQuery.event.add( this, "beforeactivate._change", function( e ) { |
| var elem = e.target; |
| if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { |
| jQuery.event.add( elem, "change._change", function( event ) { |
| if ( this.parentNode && !event.isSimulated ) { |
| jQuery.event.simulate( "change", this.parentNode, event, true ); |
| } |
| }); |
| elem._change_attached = true; |
| } |
| }); |
| }, |
| handle: function( event ) { |
| var elem = event.target; |
| // Swallow native change events from checkbox/radio, we already triggered them above |
| if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { |
| return event.handleObj.handler.apply( this, arguments ); |
| } |
| }, |
| teardown: function() { |
| jQuery.event.remove( this, "._change" ); |
| return rformElems.test( this.nodeName ); |
| } |
| }; |
| } |
| // Create "bubbling" focus and blur events |
| if ( !jQuery.support.focusinBubbles ) { |
| jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { |
| // Attach a single capturing handler while someone wants focusin/focusout |
| var attaches = 0, |
| handler = function( event ) { |
| jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); |
| }; |
| jQuery.event.special[ fix ] = { |
| setup: function() { |
| if ( attaches++ === 0 ) { |
| document.addEventListener( orig, handler, true ); |
| } |
| }, |
| teardown: function() { |
| if ( --attaches === 0 ) { |
| document.removeEventListener( orig, handler, true ); |
| } |
| } |
| }; |
| }); |
| } |
| jQuery.fn.extend({ |
| on: function( types, selector, data, fn, /*INTERNAL*/ one ) { |
| var origFn, type; |
| // Types can be a map of types/handlers |
| if ( typeof types === "object" ) { |
| // ( types-Object, selector, data ) |
| if ( typeof selector !== "string" ) { |
| // ( types-Object, data ) |
| data = selector; |
| selector = undefined; |
| } |
| for ( type in types ) { |
| this.on( type, selector, data, types[ type ], one ); |
| } |
| return this; |
| } |
| if ( data == null && fn == null ) { |
| // ( types, fn ) |
| fn = selector; |
| data = selector = undefined; |
| } else if ( fn == null ) { |
| if ( typeof selector === "string" ) { |
| // ( types, selector, fn ) |
| fn = data; |
| data = undefined; |
| } else { |
| // ( types, data, fn ) |
| fn = data; |
| data = selector; |
| selector = undefined; |
| } |
| } |
| if ( fn === false ) { |
| fn = returnFalse; |
| } else if ( !fn ) { |
| return this; |
| } |
| if ( one === 1 ) { |
| origFn = fn; |
| fn = function( event ) { |
| // Can use an empty set, since event contains the info |
| jQuery().off( event ); |
| return origFn.apply( this, arguments ); |
| }; |
| // Use same guid so caller can remove using origFn |
| fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); |
| } |
| return this.each( function() { |
| jQuery.event.add( this, types, fn, data, selector ); |
| }); |
| }, |
| one: function( types, selector, data, fn ) { |
| return this.on.call( this, types, selector, data, fn, 1 ); |
| }, |
| off: function( types, selector, fn ) { |
| if ( types && types.preventDefault && types.handleObj ) { |
| // ( event ) dispatched jQuery.Event |
| var handleObj = types.handleObj; |
| jQuery( types.delegateTarget ).off( |
| handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, |
| handleObj.selector, |
| handleObj.handler |
| ); |
| return this; |
| } |
| if ( typeof types === "object" ) { |
| // ( types-object [, selector] ) |
| for ( var type in types ) { |
| this.off( type, selector, types[ type ] ); |
| } |
| return this; |
| } |
| if ( selector === false || typeof selector === "function" ) { |
| // ( types [, fn] ) |
| fn = selector; |
| selector = undefined; |
| } |
| if ( fn === false ) { |
| fn = returnFalse; |
| } |
| return this.each(function() { |
| jQuery.event.remove( this, types, fn, selector ); |
| }); |
| }, |
| bind: function( types, data, fn ) { |
| return this.on( types, null, data, fn ); |
| }, |
| unbind: function( types, fn ) { |
| return this.off( types, null, fn ); |
| }, |
| live: function( types, data, fn ) { |
| jQuery( this.context ).on( types, this.selector, data, fn ); |
| return this; |
| }, |
| die: function( types, fn ) { |
| jQuery( this.context ).off( types, this.selector || "**", fn ); |
| return this; |
| }, |
| delegate: function( selector, types, data, fn ) { |
| return this.on( types, selector, data, fn ); |
| }, |
| undelegate: function( selector, types, fn ) { |
| // ( namespace ) or ( selector, types [, fn] ) |
| return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); |
| }, |
| trigger: function( type, data ) { |
| return this.each(function() { |
| jQuery.event.trigger( type, data, this ); |
| }); |
| }, |
| triggerHandler: function( type, data ) { |
| if ( this[0] ) { |
| return jQuery.event.trigger( type, data, this[0], true ); |
| } |
| }, |
| toggle: function( fn ) { |
| // Save reference to arguments for access in closure |
| var args = arguments, |
| guid = fn.guid || jQuery.guid++, |
| i = 0, |
| toggler = function( event ) { |
| // Figure out which function to execute |
| var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; |
| jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); |
| // Make sure that clicks stop |
| event.preventDefault(); |
| // and execute the function |
| return args[ lastToggle ].apply( this, arguments ) || false; |
| }; |
| // link all the functions, so any of them can unbind this click handler |
| toggler.guid = guid; |
| while ( i < args.length ) { |
| args[ i++ ].guid = guid; |
| } |
| return this.click( toggler ); |
| }, |
| hover: function( fnOver, fnOut ) { |
| return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); |
| } |
| }); |
| jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + |
| "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + |
| "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { |
| // Handle event binding |
| jQuery.fn[ name ] = function( data, fn ) { |
| if ( fn == null ) { |
| fn = data; |
| data = null; |
| } |
| return arguments.length > 0 ? |
| this.bind( name, data, fn ) : |
| this.trigger( name ); |
| }; |
| if ( jQuery.attrFn ) { |
| jQuery.attrFn[ name ] = true; |
| } |
| if ( rkeyEvent.test( name ) ) { |
| jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; |
| } |
| if ( rmouseEvent.test( name ) ) { |
| jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; |
| } |
| }); |
| /*! |
| * Sizzle CSS Selector Engine |
| * Copyright 2011, The Dojo Foundation |
| * Released under the MIT, BSD, and GPL Licenses. |
| * More information: http://sizzlejs.com/ |
| */ |
| (function(){ |
| var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, |
| expando = "sizcache" + (Math.random() + '').replace('.', ''), |
| done = 0, |
| toString = Object.prototype.toString, |
| hasDuplicate = false, |
| baseHasDuplicate = true, |
| rBackslash = /\\/g, |
| rReturn = /\r\n/g, |
| rNonWord = /\W/; |
| // Here we check if the JavaScript engine is using some sort of |
| // optimization where it does not always call our comparision |
| // function. If that is the case, discard the hasDuplicate value. |
| // Thus far that includes Google Chrome. |
| [0, 0].sort(function() { |
| baseHasDuplicate = false; |
| return 0; |
| }); |
| var Sizzle = function( selector, context, results, seed ) { |
| results = results || []; |
| context = context || document; |
| var origContext = context; |
| if ( context.nodeType !== 1 && context.nodeType !== 9 ) { |
| return []; |
| } |
| if ( !selector || typeof selector !== "string" ) { |
| return results; |
| } |
| var m, set, checkSet, extra, ret, cur, pop, i, |
| prune = true, |
| contextXML = Sizzle.isXML( context ), |
| parts = [], |
| soFar = selector; |
| // Reset the position of the chunker regexp (start from head) |
| do { |
| chunker.exec( "" ); |
| m = chunker.exec( soFar ); |
| if ( m ) { |
| soFar = m[3]; |
| parts.push( m[1] ); |
| if ( m[2] ) { |
| extra = m[3]; |
| break; |
| } |
| } |
| } while ( m ); |
| if ( parts.length > 1 && origPOS.exec( selector ) ) { |
| if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { |
| set = posProcess( parts[0] + parts[1], context, seed ); |
| } else { |
| set = Expr.relative[ parts[0] ] ? |
| [ context ] : |
| Sizzle( parts.shift(), context ); |
| while ( parts.length ) { |
| selector = parts.shift(); |
| if ( Expr.relative[ selector ] ) { |
| selector += parts.shift(); |
| } |
| set = posProcess( selector, set, seed ); |
| } |
| } |
| } else { |
| // Take a shortcut and set the context if the root selector is an ID |
| // (but not if it'll be faster if the inner selector is an ID) |
| if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && |
| Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { |
| ret = Sizzle.find( parts.shift(), context, contextXML ); |
| context = ret.expr ? |
| Sizzle.filter( ret.expr, ret.set )[0] : |
| ret.set[0]; |
| } |
| if ( context ) { |
| ret = seed ? |
| { expr: parts.pop(), set: makeArray(seed) } : |
| Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); |
| set = ret.expr ? |
| Sizzle.filter( ret.expr, ret.set ) : |
| ret.set; |
| if ( parts.length > 0 ) { |
| checkSet = makeArray( set ); |
| } else { |
| prune = false; |
| } |
| while ( parts.length ) { |
| cur = parts.pop(); |
| pop = cur; |
| if ( !Expr.relative[ cur ] ) { |
| cur = ""; |
| } else { |
| pop = parts.pop(); |
| } |
| if ( pop == null ) { |
| pop = context; |
| } |
| Expr.relative[ cur ]( checkSet, pop, contextXML ); |
| } |
| } else { |
| checkSet = parts = []; |
| } |
| } |
| if ( !checkSet ) { |
| checkSet = set; |
| } |
| if ( !checkSet ) { |
| Sizzle.error( cur || selector ); |
| } |
| if ( toString.call(checkSet) === "[object Array]" ) { |
| if ( !prune ) { |
| results.push.apply( results, checkSet ); |
| } else if ( context && context.nodeType === 1 ) { |
| for ( i = 0; checkSet[i] != null; i++ ) { |
| if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { |
| results.push( set[i] ); |
| } |
| } |
| } else { |
| for ( i = 0; checkSet[i] != null; i++ ) { |
| if ( checkSet[i] && checkSet[i].nodeType === 1 ) { |
| results.push( set[i] ); |
| } |
| } |
| } |
| } else { |
| makeArray( checkSet, results ); |
| } |
| if ( extra ) { |
| Sizzle( extra, origContext, results, seed ); |
| Sizzle.uniqueSort( results ); |
| } |
| return results; |
| }; |
| Sizzle.uniqueSort = function( results ) { |
| if ( sortOrder ) { |
| hasDuplicate = baseHasDuplicate; |
| results.sort( sortOrder ); |
| if ( hasDuplicate ) { |
| for ( var i = 1; i < results.length; i++ ) { |
| if ( results[i] === results[ i - 1 ] ) { |
| results.splice( i--, 1 ); |
| } |
| } |
| } |
| } |
| return results; |
| }; |
| Sizzle.matches = function( expr, set ) { |
| return Sizzle( expr, null, null, set ); |
| }; |
| Sizzle.matchesSelector = function( node, expr ) { |
| return Sizzle( expr, null, null, [node] ).length > 0; |
| }; |
| Sizzle.find = function( expr, context, isXML ) { |
| var set, i, len, match, type, left; |
| if ( !expr ) { |
| return []; |
| } |
| for ( i = 0, len = Expr.order.length; i < len; i++ ) { |
| type = Expr.order[i]; |
| if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { |
| left = match[1]; |
| match.splice( 1, 1 ); |
| if ( left.substr( left.length - 1 ) !== "\\" ) { |
| match[1] = (match[1] || "").replace( rBackslash, "" ); |
| set = Expr.find[ type ]( match, context, isXML ); |
| if ( set != null ) { |
| expr = expr.replace( Expr.match[ type ], "" ); |
| break; |
| } |
| } |
| } |
| } |
| if ( !set ) { |
| set = typeof context.getElementsByTagName !== "undefined" ? |
| context.getElementsByTagName( "*" ) : |
| []; |
| } |
| return { set: set, expr: expr }; |
| }; |
| Sizzle.filter = function( expr, set, inplace, not ) { |
| var match, anyFound, |
| type, found, item, filter, left, |
| i, pass, |
| old = expr, |
| result = [], |
| curLoop = set, |
| isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); |
| while ( expr && set.length ) { |
| for ( type in Expr.filter ) { |
| if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { |
| filter = Expr.filter[ type ]; |
| left = match[1]; |
| anyFound = false; |
| match.splice(1,1); |
| if ( left.substr( left.length - 1 ) === "\\" ) { |
| continue; |
| } |
| if ( curLoop === result ) { |
| result = []; |
| } |
| if ( Expr.preFilter[ type ] ) { |
| match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); |
| if ( !match ) { |
| anyFound = found = true; |
| } else if ( match === true ) { |
| continue; |
| } |
| } |
| if ( match ) { |
| for ( i = 0; (item = curLoop[i]) != null; i++ ) { |
| if ( item ) { |
| found = filter( item, match, i, curLoop ); |
| pass = not ^ found; |
| if ( inplace && found != null ) { |
| if ( pass ) { |
| anyFound = true; |
| } else { |
| curLoop[i] = false; |
| } |
| } else if ( pass ) { |
| result.push( item ); |
| anyFound = true; |
| } |
| } |
| } |
| } |
| if ( found !== undefined ) { |
| if ( !inplace ) { |
| curLoop = result; |
| } |
| expr = expr.replace( Expr.match[ type ], "" ); |
| if ( !anyFound ) { |
| return []; |
| } |
| break; |
| } |
| } |
| } |
| // Improper expression |
| if ( expr === old ) { |
| if ( anyFound == null ) { |
| Sizzle.error( expr ); |
| } else { |
| break; |
| } |
| } |
| old = expr; |
| } |
| return curLoop; |
| }; |
| Sizzle.error = function( msg ) { |
| throw "Syntax error, unrecognized expression: " + msg; |
| }; |
| /** |
| * Utility function for retreiving the text value of an array of DOM nodes |
| * @param {Array|Element} elem |
| */ |
| var getText = Sizzle.getText = function( elem ) { |
| var i, node, |
| nodeType = elem.nodeType, |
| ret = ""; |
| if ( nodeType ) { |
| if ( nodeType === 1 ) { |
| // Use textContent || innerText for elements |
| if ( typeof elem.textContent === 'string' ) { |
| return elem.textContent; |
| } else if ( typeof elem.innerText === 'string' ) { |
| // Replace IE's carriage returns |
| return elem.innerText.replace( rReturn, '' ); |
| } else { |
| // Traverse it's children |
| for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { |
| ret += getText( elem ); |
| } |
| } |
| } else if ( nodeType === 3 || nodeType === 4 ) { |
| return elem.nodeValue; |
| } |
| } else { |
| // If no nodeType, this is expected to be an array |
| for ( i = 0; (node = elem[i]); i++ ) { |
| // Do not traverse comment nodes |
| if ( node.nodeType !== 8 ) { |
| ret += getText( node ); |
| } |
| } |
| } |
| return ret; |
| }; |
| var Expr = Sizzle.selectors = { |
| order: [ "ID", "NAME", "TAG" ], |
| match: { |
| ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, |
| CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, |
| NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, |
| ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, |
| TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, |
| CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, |
| POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, |
| PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ |
| }, |
| leftMatch: {}, |
| attrMap: { |
| "class": "className", |
| "for": "htmlFor" |
| }, |
| attrHandle: { |
| href: function( elem ) { |
| return elem.getAttribute( "href" ); |
| }, |
| type: function( elem ) { |
| return elem.getAttribute( "type" ); |
| } |
| }, |
| relative: { |
| "+": function(checkSet, part){ |
| var isPartStr = typeof part === "string", |
| isTag = isPartStr && !rNonWord.test( part ), |
| isPartStrNotTag = isPartStr && !isTag; |
| if ( isTag ) { |
| part = part.toLowerCase(); |
| } |
| for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { |
| if ( (elem = checkSet[i]) ) { |
| while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} |
| checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? |
| elem || false : |
| elem === part; |
| } |
| } |
| if ( isPartStrNotTag ) { |
| Sizzle.filter( part, checkSet, true ); |
| } |
| }, |
| ">": function( checkSet, part ) { |
| var elem, |
| isPartStr = typeof part === "string", |
| i = 0, |
| l = checkSet.length; |
| if ( isPartStr && !rNonWord.test( part ) ) { |
| part = part.toLowerCase(); |
| for ( ; i < l; i++ ) { |
| elem = checkSet[i]; |
| if ( elem ) { |
| var parent = elem.parentNode; |
| checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; |
| } |
| } |
| } else { |
| for ( ; i < l; i++ ) { |
| elem = checkSet[i]; |
| if ( elem ) { |
| checkSet[i] = isPartStr ? |
| elem.parentNode : |
| elem.parentNode === part; |
| } |
| } |
| if ( isPartStr ) { |
| Sizzle.filter( part, checkSet, true ); |
| } |
| } |
| }, |
| "": function(checkSet, part, isXML){ |
| var nodeCheck, |
| doneName = done++, |
| checkFn = dirCheck; |
| if ( typeof part === "string" && !rNonWord.test( part ) ) { |
| part = part.toLowerCase(); |
| nodeCheck = part; |
| checkFn = dirNodeCheck; |
| } |
| checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); |
| }, |
| "~": function( checkSet, part, isXML ) { |
| var nodeCheck, |
| doneName = done++, |
| checkFn = dirCheck; |
| if ( typeof part === "string" && !rNonWord.test( part ) ) { |
| part = part.toLowerCase(); |
| nodeCheck = part; |
| checkFn = dirNodeCheck; |
| } |
| checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); |
| } |
| }, |
| find: { |
| ID: function( match, context, isXML ) { |
| if ( typeof context.getElementById !== "undefined" && !isXML ) { |
| var m = context.getElementById(match[1]); |
| // Check parentNode to catch when Blackberry 4.6 returns |
| // nodes that are no longer in the document #6963 |
| return m && m.parentNode ? [m] : []; |
| } |
| }, |
| NAME: function( match, context ) { |
| if ( typeof context.getElementsByName !== "undefined" ) { |
| var ret = [], |
| results = context.getElementsByName( match[1] ); |
| for ( var i = 0, l = results.length; i < l; i++ ) { |
| if ( results[i].getAttribute("name") === match[1] ) { |
| ret.push( results[i] ); |
| } |
| } |
| return ret.length === 0 ? null : ret; |
| } |
| }, |
| TAG: function( match, context ) { |
| if ( typeof context.getElementsByTagName !== "undefined" ) { |
| return context.getElementsByTagName( match[1] ); |
| } |
| } |
| }, |
| preFilter: { |
| CLASS: function( match, curLoop, inplace, result, not, isXML ) { |
| match = " " + match[1].replace( rBackslash, "" ) + " "; |
| if ( isXML ) { |
| return match; |
| } |
| for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { |
| if ( elem ) { |
| if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { |
| if ( !inplace ) { |
| result.push( elem ); |
| } |
| } else if ( inplace ) { |
| curLoop[i] = false; |
| } |
| } |
| } |
| return false; |
| }, |
| ID: function( match ) { |
| return match[1].replace( rBackslash, "" ); |
| }, |
| TAG: function( match, curLoop ) { |
| return match[1].replace( rBackslash, "" ).toLowerCase(); |
| }, |
| CHILD: function( match ) { |
| if ( match[1] === "nth" ) { |
| if ( !match[2] ) { |
| Sizzle.error( match[0] ); |
| } |
| match[2] = match[2].replace(/^\+|\s*/g, ''); |
| // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' |
| var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( |
| match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || |
| !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); |
| // calculate the numbers (first)n+(last) including if they are negative |
| match[2] = (test[1] + (test[2] || 1)) - 0; |
| match[3] = test[3] - 0; |
| } |
| else if ( match[2] ) { |
| Sizzle.error( match[0] ); |
| } |
| // TODO: Move to normal caching system |
| match[0] = done++; |
| return match; |
| }, |
| ATTR: function( match, curLoop, inplace, result, not, isXML ) { |
| var name = match[1] = match[1].replace( rBackslash, "" ); |
| if ( !isXML && Expr.attrMap[name] ) { |
| match[1] = Expr.attrMap[name]; |
| } |
| // Handle if an un-quoted value was used |
| match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); |
| if ( match[2] === "~=" ) { |
| match[4] = " " + match[4] + " "; |
| } |
| return match; |
| }, |
| PSEUDO: function( match, curLoop, inplace, result, not ) { |
| if ( match[1] === "not" ) { |
| // If we're dealing with a complex expression, or a simple one |
| if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { |
| match[3] = Sizzle(match[3], null, null, curLoop); |
| } else { |
| var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); |
| if ( !inplace ) { |
| result.push.apply( result, ret ); |
| } |
| return false; |
| } |
| } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { |
| return true; |
| } |
| return match; |
| }, |
| POS: function( match ) { |
| match.unshift( true ); |
| return match; |
| } |
| }, |
| filters: { |
| enabled: function( elem ) { |
| return elem.disabled === false && elem.type !== "hidden"; |
| }, |
| disabled: function( elem ) { |
| return elem.disabled === true; |
| }, |
| checked: function( elem ) { |
| return elem.checked === true; |
| }, |
| selected: function( elem ) { |
| // Accessing this property makes selected-by-default |
| // options in Safari work properly |
| if ( elem.parentNode ) { |
| elem.parentNode.selectedIndex; |
| } |
| return elem.selected === true; |
| }, |
| parent: function( elem ) { |
| return !!elem.firstChild; |
| }, |
| empty: function( elem ) { |
| return !elem.firstChild; |
| }, |
| has: function( elem, i, match ) { |
| return !!Sizzle( match[3], elem ).length; |
| }, |
| header: function( elem ) { |
| return (/h\d/i).test( elem.nodeName ); |
| }, |
| text: function( elem ) { |
| var attr = elem.getAttribute( "type" ), type = elem.type; |
| // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) |
| // use getAttribute instead to test this case |
| return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); |
| }, |
| radio: function( elem ) { |
| return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; |
| }, |
| checkbox: function( elem ) { |
| return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; |
| }, |
| file: function( elem ) { |
| return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; |
| }, |
| password: function( elem ) { |
| return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; |
| }, |
| submit: function( elem ) { |
| var name = elem.nodeName.toLowerCase(); |
| return (name === "input" || name === "button") && "submit" === elem.type; |
| }, |
| image: function( elem ) { |
| return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; |
| }, |
| reset: function( elem ) { |
| var name = elem.nodeName.toLowerCase(); |
| return (name === "input" || name === "button") && "reset" === elem.type; |
| }, |
| button: function( elem ) { |
| var name = elem.nodeName.toLowerCase(); |
| return name === "input" && "button" === elem.type || name === "button"; |
| }, |
| input: function( elem ) { |
| return (/input|select|textarea|button/i).test( elem.nodeName ); |
| }, |
| focus: function( elem ) { |
| return elem === elem.ownerDocument.activeElement; |
| } |
| }, |
| setFilters: { |
| first: function( elem, i ) { |
| return i === 0; |
| }, |
| last: function( elem, i, match, array ) { |
| return i === array.length - 1; |
| }, |
| even: function( elem, i ) { |
| return i % 2 === 0; |
| }, |
| odd: function( elem, i ) { |
| return i % 2 === 1; |
| }, |
| lt: function( elem, i, match ) { |
| return i < match[3] - 0; |
| }, |
| gt: function( elem, i, match ) { |
| return i > match[3] - 0; |
| }, |
| nth: function( elem, i, match ) { |
| return match[3] - 0 === i; |
| }, |
| eq: function( elem, i, match ) { |
| return match[3] - 0 === i; |
| } |
| }, |
| filter: { |
| PSEUDO: function( elem, match, i, array ) { |
| var name = match[1], |
| filter = Expr.filters[ name ]; |
| if ( filter ) { |
| return filter( elem, i, match, array ); |
| } else if ( name === "contains" ) { |
| return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; |
| } else if ( name === "not" ) { |
| var not = match[3]; |
| for ( var j = 0, l = not.length; j < l; j++ ) { |
| if ( not[j] === elem ) { |
| return false; |
| } |
| } |
| return true; |
| } else { |
| Sizzle.error( name ); |
| } |
| }, |
| CHILD: function( elem, match ) { |
| var first, last, |
| doneName, parent, cache, |
| count, diff, |
| type = match[1], |
| node = elem; |
| switch ( type ) { |
| case "only": |
| case "first": |
| while ( (node = node.previousSibling) ) { |
| if ( node.nodeType === 1 ) { |
| return false; |
| } |
| } |
| if ( type === "first" ) { |
| return true; |
| } |
| node = elem; |
| case "last": |
| while ( (node = node.nextSibling) ) { |
| if ( node.nodeType === 1 ) { |
| return false; |
| } |
| } |
| return true; |
| case "nth": |
| first = match[2]; |
| last = match[3]; |
| if ( first === 1 && last === 0 ) { |
| return true; |
| } |
| doneName = match[0]; |
| parent = elem.parentNode; |
| if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { |
| count = 0; |
| for ( node = parent.firstChild; node; node = node.nextSibling ) { |
| if ( node.nodeType === 1 ) { |
| node.nodeIndex = ++count; |
| } |
| } |
| parent[ expando ] = doneName; |
| } |
| diff = elem.nodeIndex - last; |
| if ( first === 0 ) { |
| return diff === 0; |
| } else { |
| return ( diff % first === 0 && diff / first >= 0 ); |
| } |
| } |
| }, |
| ID: function( elem, match ) { |
| return elem.nodeType === 1 && elem.getAttribute("id") === match; |
| }, |
| TAG: function( elem, match ) { |
| return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; |
| }, |
| CLASS: function( elem, match ) { |
| return (" " + (elem.className || elem.getAttribute("class")) + " ") |
| .indexOf( match ) > -1; |
| }, |
| ATTR: function( elem, match ) { |
| var name = match[1], |
| result = Sizzle.attr ? |
| Sizzle.attr( elem, name ) : |
| Expr.attrHandle[ name ] ? |
| Expr.attrHandle[ name ]( elem ) : |
| elem[ name ] != null ? |
| elem[ name ] : |
| elem.getAttribute( name ), |
| value = result + "", |
| type = match[2], |
| check = match[4]; |
| return result == null ? |
| type === "!=" : |
| !type && Sizzle.attr ? |
| result != null : |
| type === "=" ? |
| value === check : |
| type === "*=" ? |
| value.indexOf(check) >= 0 : |
| type === "~=" ? |
| (" " + value + " ").indexOf(check) >= 0 : |
| !check ? |
| value && result !== false : |
| type === "!=" ? |
| value !== check : |
| type === "^=" ? |
| value.indexOf(check) === 0 : |
| type === "$=" ? |
| value.substr(value.length - check.length) === check : |
| type === "|=" ? |
| value === check || value.substr(0, check.length + 1) === check + "-" : |
| false; |
| }, |
| POS: function( elem, match, i, array ) { |
| var name = match[2], |
| filter = Expr.setFilters[ name ]; |
| if ( filter ) { |
| return filter( elem, i, match, array ); |
| } |
| } |
| } |
| }; |
| var origPOS = Expr.match.POS, |
| fescape = function(all, num){ |
| return "\\" + (num - 0 + 1); |
| }; |
| for ( var type in Expr.match ) { |
| Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); |
| Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); |
| } |
| var makeArray = function( array, results ) { |
| array = Array.prototype.slice.call( array, 0 ); |
| if ( results ) { |
| results.push.apply( results, array ); |
| return results; |
| } |
| return array; |
| }; |
| // Perform a simple check to determine if the browser is capable of |
| // converting a NodeList to an array using builtin methods. |
| // Also verifies that the returned array holds DOM nodes |
| // (which is not the case in the Blackberry browser) |
| try { |
| Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; |
| // Provide a fallback method if it does not work |
| } catch( e ) { |
| makeArray = function( array, results ) { |
| var i = 0, |
| ret = results || []; |
| if ( toString.call(array) === "[object Array]" ) { |
| Array.prototype.push.apply( ret, array ); |
| } else { |
| if ( typeof array.length === "number" ) { |
| for ( var l = array.length; i < l; i++ ) { |
| ret.push( array[i] ); |
| } |
| } else { |
| for ( ; array[i]; i++ ) { |
| ret.push( array[i] ); |
| } |
| } |
| } |
| return ret; |
| }; |
| } |
| var sortOrder, siblingCheck; |
| if ( document.documentElement.compareDocumentPosition ) { |
| sortOrder = function( a, b ) { |
| if ( a === b ) { |
| hasDuplicate = true; |
| return 0; |
| } |
| if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { |
| return a.compareDocumentPosition ? -1 : 1; |
| } |
| return a.compareDocumentPosition(b) & 4 ? -1 : 1; |
| }; |
| } else { |
| sortOrder = function( a, b ) { |
| // The nodes are identical, we can exit early |
| if ( a === b ) { |
| hasDuplicate = true; |
| return 0; |
| // Fallback to using sourceIndex (in IE) if it's available on both nodes |
| } else if ( a.sourceIndex && b.sourceIndex ) { |
| return a.sourceIndex - b.sourceIndex; |
| } |
| var al, bl, |
| ap = [], |
| bp = [], |
| aup = a.parentNode, |
| bup = b.parentNode, |
| cur = aup; |
| // If the nodes are siblings (or identical) we can do a quick check |
| if ( aup === bup ) { |
| return siblingCheck( a, b ); |
| // If no parents were found then the nodes are disconnected |
| } else if ( !aup ) { |
| return -1; |
| } else if ( !bup ) { |
| return 1; |
| } |
| // Otherwise they're somewhere else in the tree so we need |
| // to build up a full list of the parentNodes for comparison |
| while ( cur ) { |
| ap.unshift( cur ); |
| cur = cur.parentNode; |
| } |
| cur = bup; |
| while ( cur ) { |
| bp.unshift( cur ); |
| cur = cur.parentNode; |
| } |
| al = ap.length; |
| bl = bp.length; |
| // Start walking down the tree looking for a discrepancy |
| for ( var i = 0; i < al && i < bl; i++ ) { |
| if ( ap[i] !== bp[i] ) { |
| return siblingCheck( ap[i], bp[i] ); |
| } |
| } |
| // We ended someplace up the tree so do a sibling check |
| return i === al ? |
| siblingCheck( a, bp[i], -1 ) : |
| siblingCheck( ap[i], b, 1 ); |
| }; |
| siblingCheck = function( a, b, ret ) { |
| if ( a === b ) { |
| return ret; |
| } |
| var cur = a.nextSibling; |
| while ( cur ) { |
| if ( cur === b ) { |
| return -1; |
| } |
| cur = cur.nextSibling; |
| } |
| return 1; |
| }; |
| } |
| // Check to see if the browser returns elements by name when |
| // querying by getElementById (and provide a workaround) |
| (function(){ |
| // We're going to inject a fake input element with a specified name |
| var form = document.createElement("div"), |
| id = "script" + (new Date()).getTime(), |
| root = document.documentElement; |
| form.innerHTML = "<a name='" + id + "'/>"; |
| // Inject it into the root element, check its status, and remove it quickly |
| root.insertBefore( form, root.firstChild ); |
| // The workaround has to do additional checks after a getElementById |
| // Which slows things down for other browsers (hence the branching) |
| if ( document.getElementById( id ) ) { |
| Expr.find.ID = function( match, context, isXML ) { |
| if ( typeof context.getElementById !== "undefined" && !isXML ) { |
| var m = context.getElementById(match[1]); |
| return m ? |
| m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? |
| [m] : |
| undefined : |
| []; |
| } |
| }; |
| Expr.filter.ID = function( elem, match ) { |
| var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); |
| return elem.nodeType === 1 && node && node.nodeValue === match; |
| }; |
| } |
| root.removeChild( form ); |
| // release memory in IE |
| root = form = null; |
| })(); |
| (function(){ |
| // Check to see if the browser returns only elements |
| // when doing getElementsByTagName("*") |
| // Create a fake element |
| var div = document.createElement("div"); |
| div.appendChild( document.createComment("") ); |
| // Make sure no comments are found |
| if ( div.getElementsByTagName("*").length > 0 ) { |
| Expr.find.TAG = function( match, context ) { |
| var results = context.getElementsByTagName( match[1] ); |
| // Filter out possible comments |
| if ( match[1] === "*" ) { |
| var tmp = []; |
| for ( var i = 0; results[i]; i++ ) { |
| if ( results[i].nodeType === 1 ) { |
| tmp.push( results[i] ); |
| } |
| } |
| results = tmp; |
| } |
| return results; |
| }; |
| } |
| // Check to see if an attribute returns normalized href attributes |
| div.innerHTML = "<a href='#'></a>"; |
| if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && |
| div.firstChild.getAttribute("href") !== "#" ) { |
| Expr.attrHandle.href = function( elem ) { |
| return elem.getAttribute( "href", 2 ); |
| }; |
| } |
| // release memory in IE |
| div = null; |
| })(); |
| if ( document.querySelectorAll ) { |
| (function(){ |
| var oldSizzle = Sizzle, |
| div = document.createElement("div"), |
| id = "__sizzle__"; |
| div.innerHTML = "<p class='TEST'></p>"; |
| // Safari can't handle uppercase or unicode characters when |
| // in quirks mode. |
| if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { |
| return; |
| } |
| Sizzle = function( query, context, extra, seed ) { |
| context = context || document; |
| // Only use querySelectorAll on non-XML documents |
| // (ID selectors don't work in non-HTML documents) |
| if ( !seed && !Sizzle.isXML(context) ) { |
| // See if we find a selector to speed up |
| var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); |
| if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { |
| // Speed-up: Sizzle("TAG") |
| if ( match[1] ) { |
| return makeArray( context.getElementsByTagName( query ), extra ); |
| // Speed-up: Sizzle(".CLASS") |
| } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { |
| return makeArray( context.getElementsByClassName( match[2] ), extra ); |
| } |
| } |
| if ( context.nodeType === 9 ) { |
| // Speed-up: Sizzle("body") |
| // The body element only exists once, optimize finding it |
| if ( query === "body" && context.body ) { |
| return makeArray( [ context.body ], extra ); |
| // Speed-up: Sizzle("#ID") |
| } else if ( match && match[3] ) { |
| var elem = context.getElementById( match[3] ); |
| // Check parentNode to catch when Blackberry 4.6 returns |
| // nodes that are no longer in the document #6963 |
| if ( elem && elem.parentNode ) { |
| // Handle the case where IE and Opera return items |
| // by name instead of ID |
| if ( elem.id === match[3] ) { |
| return makeArray( [ elem ], extra ); |
| } |
| } else { |
| return makeArray( [], extra ); |
| } |
| } |
| try { |
| return makeArray( context.querySelectorAll(query), extra ); |
| } catch(qsaError) {} |
| // qSA works strangely on Element-rooted queries |
| // We can work around this by specifying an extra ID on the root |
| // and working up from there (Thanks to Andrew Dupont for the technique) |
| // IE 8 doesn't work on object elements |
| } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { |
| var oldContext = context, |
| old = context.getAttribute( "id" ), |
| nid = old || id, |
| hasParent = context.parentNode, |
| relativeHierarchySelector = /^\s*[+~]/.test( query ); |
| if ( !old ) { |
| context.setAttribute( "id", nid ); |
| } else { |
| nid = nid.replace( /'/g, "\\$&" ); |
| } |
| if ( relativeHierarchySelector && hasParent ) { |
| context = context.parentNode; |
| } |
| try { |
| if ( !relativeHierarchySelector || hasParent ) { |
| return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); |
| } |
| } catch(pseudoError) { |
| } finally { |
| if ( !old ) { |
| oldContext.removeAttribute( "id" ); |
| } |
| } |
| } |
| } |
| return oldSizzle(query, context, extra, seed); |
| }; |
| for ( var prop in oldSizzle ) { |
| Sizzle[ prop ] = oldSizzle[ prop ]; |
| } |
| // release memory in IE |
| div = null; |
| })(); |
| } |
| (function(){ |
| var html = document.documentElement, |
| matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; |
| if ( matches ) { |
| // Check to see if it's possible to do matchesSelector |
| // on a disconnected node (IE 9 fails this) |
| var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), |
| pseudoWorks = false; |
| try { |
| // This should fail with an exception |
| // Gecko does not error, returns false instead |
| matches.call( document.documentElement, "[test!='']:sizzle" ); |
| } catch( pseudoError ) { |
| pseudoWorks = true; |
| } |
| Sizzle.matchesSelector = function( node, expr ) { |
| // Make sure that attribute selectors are quoted |
| expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); |
| if ( !Sizzle.isXML( node ) ) { |
| try { |
| if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { |
| var ret = matches.call( node, expr ); |
| // IE 9's matchesSelector returns false on disconnected nodes |
| if ( ret || !disconnectedMatch || |
| // As well, disconnected nodes are said to be in a document |
| // fragment in IE 9, so check for that |
| node.document && node.document.nodeType !== 11 ) { |
| return ret; |
| } |
| } |
| } catch(e) {} |
| } |
| return Sizzle(expr, null, null, [node]).length > 0; |
| }; |
| } |
| })(); |
| (function(){ |
| var div = document.createElement("div"); |
| div.innerHTML = "<div class='test e'></div><div class='test'></div>"; |
| // Opera can't find a second classname (in 9.6) |
| // Also, make sure that getElementsByClassName actually exists |
| if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { |
| return; |
| } |
| // Safari caches class attributes, doesn't catch changes (in 3.2) |
| div.lastChild.className = "e"; |
| if ( div.getElementsByClassName("e").length === 1 ) { |
| return; |
| } |
| Expr.order.splice(1, 0, "CLASS"); |
| Expr.find.CLASS = function( match, context, isXML ) { |
| if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { |
| return context.getElementsByClassName(match[1]); |
| } |
| }; |
| // release memory in IE |
| div = null; |
| })(); |
| function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { |
| for ( var i = 0, l = checkSet.length; i < l; i++ ) { |
| var elem = checkSet[i]; |
| if ( elem ) { |
| var match = false; |
| elem = elem[dir]; |
| while ( elem ) { |
| if ( elem[ expando ] === doneName ) { |
| match = checkSet[elem.sizset]; |
| break; |
| } |
| if ( elem.nodeType === 1 && !isXML ){ |
| elem[ expando ] = doneName; |
| elem.sizset = i; |
| } |
| if ( elem.nodeName.toLowerCase() === cur ) { |
| match = elem; |
| break; |
| } |
| elem = elem[dir]; |
| } |
| checkSet[i] = match; |
| } |
| } |
| } |
| function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { |
| for ( var i = 0, l = checkSet.length; i < l; i++ ) { |
| var elem = checkSet[i]; |
| if ( elem ) { |
| var match = false; |
| elem = elem[dir]; |
| while ( elem ) { |
| if ( elem[ expando ] === doneName ) { |
| match = checkSet[elem.sizset]; |
| break; |
| } |
| if ( elem.nodeType === 1 ) { |
| if ( !isXML ) { |
| elem[ expando ] = doneName; |
| elem.sizset = i; |
| } |
| if ( typeof cur !== "string" ) { |
| if ( elem === cur ) { |
| match = true; |
| break; |
| } |
| } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { |
| match = elem; |
| break; |
| } |
| } |
| elem = elem[dir]; |
| } |
| checkSet[i] = match; |
| } |
| } |
| } |
| if ( document.documentElement.contains ) { |
| Sizzle.contains = function( a, b ) { |
| return a !== b && (a.contains ? a.contains(b) : true); |
| }; |
| } else if ( document.documentElement.compareDocumentPosition ) { |
| Sizzle.contains = function( a, b ) { |
| return !!(a.compareDocumentPosition(b) & 16); |
| }; |
| } else { |
| Sizzle.contains = function() { |
| return false; |
| }; |
| } |
| Sizzle.isXML = function( elem ) { |
| // documentElement is verified for cases where it doesn't yet exist |
| // (such as loading iframes in IE - #4833) |
| var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; |
| return documentElement ? documentElement.nodeName !== "HTML" : false; |
| }; |
| var posProcess = function( selector, context, seed ) { |
| var match, |
| tmpSet = [], |
| later = "", |
| root = context.nodeType ? [context] : context; |
| // Position selectors must be done after the filter |
| // And so must :not(positional) so we move all PSEUDOs to the end |
| while ( (match = Expr.match.PSEUDO.exec( selector )) ) { |
| later += match[0]; |
| selector = selector.replace( Expr.match.PSEUDO, "" ); |
| } |
| selector = Expr.relative[selector] ? selector + "*" : selector; |
| for ( var i = 0, l = root.length; i < l; i++ ) { |
| Sizzle( selector, root[i], tmpSet, seed ); |
| } |
| return Sizzle.filter( later, tmpSet ); |
| }; |
| // EXPOSE |
| // Override sizzle attribute retrieval |
| Sizzle.attr = jQuery.attr; |
| Sizzle.selectors.attrMap = {}; |
| jQuery.find = Sizzle; |
| jQuery.expr = Sizzle.selectors; |
| jQuery.expr[":"] = jQuery.expr.filters; |
| jQuery.unique = Sizzle.uniqueSort; |
| jQuery.text = Sizzle.getText; |
| jQuery.isXMLDoc = Sizzle.isXML; |
| jQuery.contains = Sizzle.contains; |
| })(); |
| var runtil = /Until$/, |
| rparentsprev = /^(?:parents|prevUntil|prevAll)/, |
| // Note: This RegExp should be improved, or likely pulled from Sizzle |
| rmultiselector = /,/, |
| isSimple = /^.[^:#\[\.,]*$/, |
| slice = Array.prototype.slice, |
| POS = jQuery.expr.match.POS, |
| // methods guaranteed to produce a unique set when starting from a unique set |
| guaranteedUnique = { |
| children: true, |
| contents: true, |
| next: true, |
| prev: true |
| }; |
| jQuery.fn.extend({ |
| find: function( selector ) { |
| var self = this, |
| i, l; |
| if ( typeof selector !== "string" ) { |
| return jQuery( selector ).filter(function() { |
| for ( i = 0, l = self.length; i < l; i++ ) { |
| if ( jQuery.contains( self[ i ], this ) ) { |
| return true; |
| } |
| } |
| }); |
| } |
| var ret = this.pushStack( "", "find", selector ), |
| length, n, r; |
| for ( i = 0, l = this.length; i < l; i++ ) { |
| length = ret.length; |
| jQuery.find( selector, this[i], ret ); |
| if ( i > 0 ) { |
| // Make sure that the results are unique |
| for ( n = length; n < ret.length; n++ ) { |
| for ( r = 0; r < length; r++ ) { |
| if ( ret[r] === ret[n] ) { |
| ret.splice(n--, 1); |
| break; |
| } |
| } |
| } |
| } |
| } |
| return ret; |
| }, |
| has: function( target ) { |
| var targets = jQuery( target ); |
| return this.filter(function() { |
| for ( var i = 0, l = targets.length; i < l; i++ ) { |
| if ( jQuery.contains( this, targets[i] ) ) { |
| return true; |
| } |
| } |
| }); |
| }, |
| not: function( selector ) { |
| return this.pushStack( winnow(this, selector, false), "not", selector); |
| }, |
| filter: function( selector ) { |
| return this.pushStack( winnow(this, selector, true), "filter", selector ); |
| }, |
| is: function( selector ) { |
| return !!selector && ( |
| typeof selector === "string" ? |
| // If this is a positional selector, check membership in the returned set |
| // so $("p:first").is("p:last") won't return true for a doc with two "p". |
| POS.test( selector ) ? |
| jQuery( selector, this.context ).index( this[0] ) >= 0 : |
| jQuery.filter( selector, this ).length > 0 : |
| this.filter( selector ).length > 0 ); |
| }, |
| closest: function( selectors, context ) { |
| var ret = [], i, l, cur = this[0]; |
| // Array (deprecated as of jQuery 1.7) |
| if ( jQuery.isArray( selectors ) ) { |
| var level = 1; |
| while ( cur && cur.ownerDocument && cur !== context ) { |
| for ( i = 0; i < selectors.length; i++ ) { |
| if ( jQuery( cur ).is( selectors[ i ] ) ) { |
| ret.push({ selector: selectors[ i ], elem: cur, level: level }); |
| } |
| } |
| cur = cur.parentNode; |
| level++; |
| } |
| return ret; |
| } |
| // String |
| var pos = POS.test( selectors ) || typeof selectors !== "string" ? |
| jQuery( selectors, context || this.context ) : |
| 0; |
| for ( i = 0, l = this.length; i < l; i++ ) { |
| cur = this[i]; |
| while ( cur ) { |
| if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { |
| ret.push( cur ); |
| break; |
| } else { |
| cur = cur.parentNode; |
| if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { |
| break; |
| } |
| } |
| } |
| } |
| ret = ret.length > 1 ? jQuery.unique( ret ) : ret; |
| return this.pushStack( ret, "closest", selectors ); |
| }, |
| // Determine the position of an element within |
| // the matched set of elements |
| index: function( elem ) { |
| // No argument, return index in parent |
| if ( !elem ) { |
| return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; |
| } |
| // index in selector |
| if ( typeof elem === "string" ) { |
| return jQuery.inArray( this[0], jQuery( elem ) ); |
| } |
| // Locate the position of the desired element |
| return jQuery.inArray( |
| // If it receives a jQuery object, the first element is used |
| elem.jquery ? elem[0] : elem, this ); |
| }, |
| add: function( selector, context ) { |
| var set = typeof selector === "string" ? |
| jQuery( selector, context ) : |
| jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), |
| all = jQuery.merge( this.get(), set ); |
| return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? |
| all : |
| jQuery.unique( all ) ); |
| }, |
| andSelf: function() { |
| return this.add( this.prevObject ); |
| } |
| }); |
| // A painfully simple check to see if an element is disconnected |
| // from a document (should be improved, where feasible). |
| function isDisconnected( node ) { |
| return !node || !node.parentNode || node.parentNode.nodeType === 11; |
| } |
| jQuery.each({ |
| parent: function( elem ) { |
| var parent = elem.parentNode; |
| return parent && parent.nodeType !== 11 ? parent : null; |
| }, |
| parents: function( elem ) { |
| return jQuery.dir( elem, "parentNode" ); |
| }, |
| parentsUntil: function( elem, i, until ) { |
| return jQuery.dir( elem, "parentNode", until ); |
| }, |
| next: function( elem ) { |
| return jQuery.nth( elem, 2, "nextSibling" ); |
| }, |
| prev: function( elem ) { |
| return jQuery.nth( elem, 2, "previousSibling" ); |
| }, |
| nextAll: function( elem ) { |
| return jQuery.dir( elem, "nextSibling" ); |
| }, |
| prevAll: function( elem ) { |
| return jQuery.dir( elem, "previousSibling" ); |
| }, |
| nextUntil: function( elem, i, until ) { |
| return jQuery.dir( elem, "nextSibling", until ); |
| }, |
| prevUntil: function( elem, i, until ) { |
| return jQuery.dir( elem, "previousSibling", until ); |
| }, |
| siblings: function( elem ) { |
| return jQuery.sibling( elem.parentNode.firstChild, elem ); |
| }, |
| children: function( elem ) { |
| return jQuery.sibling( elem.firstChild ); |
| }, |
| contents: function( elem ) { |
| return jQuery.nodeName( elem, "iframe" ) ? |
| elem.contentDocument || elem.contentWindow.document : |
| jQuery.makeArray( elem.childNodes ); |
| } |
| }, function( name, fn ) { |
| jQuery.fn[ name ] = function( until, selector ) { |
| var ret = jQuery.map( this, fn, until ), |
| // The variable 'args' was introduced in |
| // https://github.com/jquery/jquery/commit/52a0238 |
| // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. |
| // http://code.google.com/p/v8/issues/detail?id=1050 |
| args = slice.call(arguments); |
| if ( !runtil.test( name ) ) { |
| selector = until; |
| } |
| if ( selector && typeof selector === "string" ) { |
| ret = jQuery.filter( selector, ret ); |
| } |
| ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; |
| if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { |
| ret = ret.reverse(); |
| } |
| return this.pushStack( ret, name, args.join(",") ); |
| }; |
| }); |
| jQuery.extend({ |
| filter: function( expr, elems, not ) { |
| if ( not ) { |
| expr = ":not(" + expr + ")"; |
| } |
| return elems.length === 1 ? |
| jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : |
| jQuery.find.matches(expr, elems); |
| }, |
| dir: function( elem, dir, until ) { |
| var matched = [], |
| cur = elem[ dir ]; |
| while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { |
| if ( cur.nodeType === 1 ) { |
| matched.push( cur ); |
| } |
| cur = cur[dir]; |
| } |
| return matched; |
| }, |
| nth: function( cur, result, dir, elem ) { |
| result = result || 1; |
| var num = 0; |
| for ( ; cur; cur = cur[dir] ) { |
| if ( cur.nodeType === 1 && ++num === result ) { |
| break; |
| } |
| } |
| return cur; |
| }, |
| sibling: function( n, elem ) { |
| var r = []; |
| for ( ; n; n = n.nextSibling ) { |
| if ( n.nodeType === 1 && n !== elem ) { |
| r.push( n ); |
| } |
| } |
| return r; |
| } |
| }); |
| // Implement the identical functionality for filter and not |
| function winnow( elements, qualifier, keep ) { |
| // Can't pass null or undefined to indexOf in Firefox 4 |
| // Set to 0 to skip string check |
| qualifier = qualifier || 0; |
| if ( jQuery.isFunction( qualifier ) ) { |
| return jQuery.grep(elements, function( elem, i ) { |
| var retVal = !!qualifier.call( elem, i, elem ); |
| return retVal === keep; |
| }); |
| } else if ( qualifier.nodeType ) { |
| return jQuery.grep(elements, function( elem, i ) { |
| return ( elem === qualifier ) === keep; |
| }); |
| } else if ( typeof qualifier === "string" ) { |
| var filtered = jQuery.grep(elements, function( elem ) { |
| return elem.nodeType === 1; |
| }); |
| if ( isSimple.test( qualifier ) ) { |
| return jQuery.filter(qualifier, filtered, !keep); |
| } else { |
| qualifier = jQuery.filter( qualifier, filtered ); |
| } |
| } |
| return jQuery.grep(elements, function( elem, i ) { |
| return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; |
| }); |
| } |
| function createSafeFragment( document ) { |
| var list = nodeNames.split( " " ), |
| safeFrag = document.createDocumentFragment(); |
| if ( safeFrag.createElement ) { |
| while ( list.length ) { |
| safeFrag.createElement( |
| list.pop() |
| ); |
| } |
| } |
| return safeFrag; |
| } |
| var nodeNames = "abbr article aside audio canvas datalist details figcaption figure footer " + |
| "header hgroup mark meter nav output progress section summary time video", |
| rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, |
| rleadingWhitespace = /^\s+/, |
| rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, |
| rtagName = /<([\w:]+)/, |
| rtbody = /<tbody/i, |
| rhtml = /<|&#?\w+;/, |
| rnoInnerhtml = /<(?:script|style)/i, |
| rnocache = /<(?:script|object|embed|option|style)/i, |
| rnoshimcache = new RegExp("<(?:" + nodeNames.replace(" ", "|") + ")", "i"), |
| // checked="checked" or checked |
| rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, |
| rscriptType = /\/(java|ecma)script/i, |
| rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, |
| wrapMap = { |
| option: [ 1, "<select multiple='multiple'>", "</select>" ], |
| legend: [ 1, "<fieldset>", "</fieldset>" ], |
| thead: [ 1, "<table>", "</table>" ], |
| tr: [ 2, "<table><tbody>", "</tbody></table>" ], |
| td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], |
| col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], |
| area: [ 1, "<map>", "</map>" ], |
| _default: [ 0, "", "" ] |
| }, |
| safeFragment = createSafeFragment( document ); |
| wrapMap.optgroup = wrapMap.option; |
| wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; |
| wrapMap.th = wrapMap.td; |
| // IE can't serialize <link> and <script> tags normally |
| if ( !jQuery.support.htmlSerialize ) { |
| wrapMap._default = [ 1, "div<div>", "</div>" ]; |
| } |
| jQuery.fn.extend({ |
| text: function( text ) { |
| if ( jQuery.isFunction(text) ) { |
| return this.each(function(i) { |
| var self = jQuery( this ); |
| self.text( text.call(this, i, self.text()) ); |
| }); |
| } |
| if ( typeof text !== "object" && text !== undefined ) { |
| return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); |
| } |
| return jQuery.text( this ); |
| }, |
| wrapAll: function( html ) { |
| if ( jQuery.isFunction( html ) ) { |
| return this.each(function(i) { |
| jQuery(this).wrapAll( html.call(this, i) ); |
| }); |
| } |
| if ( this[0] ) { |
| // The elements to wrap the target around |
| var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); |
| if ( this[0].parentNode ) { |
| wrap.insertBefore( this[0] ); |
| } |
| wrap.map(function() { |
| var elem = this; |
| while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { |
| elem = elem.firstChild; |
| } |
| return elem; |
| }).append( this ); |
| } |
| return this; |
| }, |
| wrapInner: function( html ) { |
| if ( jQuery.isFunction( html ) ) { |
| return this.each(function(i) { |
| jQuery(this).wrapInner( html.call(this, i) ); |
| }); |
| } |
| return this.each(function() { |
| var self = jQuery( this ), |
| contents = self.contents(); |
| if ( contents.length ) { |
| contents.wrapAll( html ); |
| } else { |
| self.append( html ); |
| } |
| }); |
| }, |
| wrap: function( html ) { |
| return this.each(function() { |
| jQuery( this ).wrapAll( html ); |
| }); |
| }, |
| unwrap: function() { |
| return this.parent().each(function() { |
| if ( !jQuery.nodeName( this, "body" ) ) { |
| jQuery( this ).replaceWith( this.childNodes ); |
| } |
| }).end(); |
| }, |
| append: function() { |
| return this.domManip(arguments, true, function( elem ) { |
| if ( this.nodeType === 1 ) { |
| this.appendChild( elem ); |
| } |
| }); |
| }, |
| prepend: function() { |
| return this.domManip(arguments, true, function( elem ) { |
| if ( this.nodeType === 1 ) { |
| this.insertBefore( elem, this.firstChild ); |
| } |
| }); |
| }, |
| before: function() { |
| if ( this[0] && this[0].parentNode ) { |
| return this.domManip(arguments, false, function( elem ) { |
| this.parentNode.insertBefore( elem, this ); |
| }); |
| } else if ( arguments.length ) { |
| var set = jQuery(arguments[0]); |
| set.push.apply( set, this.toArray() ); |
| return this.pushStack( set, "before", arguments ); |
| } |
| }, |
| after: function() { |
| if ( this[0] && this[0].parentNode ) { |
| return this.domManip(arguments, false, function( elem ) { |
| this.parentNode.insertBefore( elem, this.nextSibling ); |
| }); |
| } else if ( arguments.length ) { |
| var set = this.pushStack( this, "after", arguments ); |
| set.push.apply( set, jQuery(arguments[0]).toArray() ); |
| return set; |
| } |
| }, |
| // keepData is for internal use only--do not document |
| remove: function( selector, keepData ) { |
| for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { |
| if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { |
| if ( !keepData && elem.nodeType === 1 ) { |
| jQuery.cleanData( elem.getElementsByTagName("*") ); |
| jQuery.cleanData( [ elem ] ); |
| } |
| if ( elem.parentNode ) { |
| elem.parentNode.removeChild( elem ); |
| } |
| } |
| } |
| return this; |
| }, |
| empty: function() { |
| for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { |
| // Remove element nodes and prevent memory leaks |
| if ( elem.nodeType === 1 ) { |
| jQuery.cleanData( elem.getElementsByTagName("*") ); |
| } |
| // Remove any remaining nodes |
| while ( elem.firstChild ) { |
| elem.removeChild( elem.firstChild ); |
| } |
| } |
| return this; |
| }, |
| clone: function( dataAndEvents, deepDataAndEvents ) { |
| dataAndEvents = dataAndEvents == null ? false : dataAndEvents; |
| deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; |
| return this.map( function () { |
| return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); |
| }); |
| }, |
| html: function( value ) { |
| if ( value === undefined ) { |
| return this[0] && this[0].nodeType === 1 ? |
| this[0].innerHTML.replace(rinlinejQuery, "") : |
| null; |
| // See if we can take a shortcut and just use innerHTML |
| } else if ( typeof value === "string" && !rnoInnerhtml.test( value ) && |
| (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && |
| !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { |
| value = value.replace(rxhtmlTag, "<$1></$2>"); |
| try { |
| for ( var i = 0, l = this.length; i < l; i++ ) { |
| // Remove element nodes and prevent memory leaks |
| if ( this[i].nodeType === 1 ) { |
| jQuery.cleanData( this[i].getElementsByTagName("*") ); |
| this[i].innerHTML = value; |
| } |
| } |
| // If using innerHTML throws an exception, use the fallback method |
| } catch(e) { |
| this.empty().append( value ); |
| } |
| } else if ( jQuery.isFunction( value ) ) { |
| this.each(function(i){ |
| var self = jQuery( this ); |
| self.html( value.call(this, i, self.html()) ); |
| }); |
| } else { |
| this.empty().append( value ); |
| } |
| return this; |
| }, |
| replaceWith: function( value ) { |
| if ( this[0] && this[0].parentNode ) { |
| // Make sure that the elements are removed from the DOM before they are inserted |
| // this can help fix replacing a parent with child elements |
| if ( jQuery.isFunction( value ) ) { |
| return this.each(function(i) { |
| var self = jQuery(this), old = self.html(); |
| self.replaceWith( value.call( this, i, old ) ); |
| }); |
| } |
| if ( typeof value !== "string" ) { |
| value = jQuery( value ).detach(); |
| } |
| return this.each(function() { |
| var next = this.nextSibling, |
| parent = this.parentNode; |
| jQuery( this ).remove(); |
| if ( next ) { |
| jQuery(next).before( value ); |
| } else { |
| jQuery(parent).append( value ); |
| } |
| }); |
| } else { |
| return this.length ? |
| this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : |
| this; |
| } |
| }, |
| detach: function( selector ) { |
| return this.remove( selector, true ); |
| }, |
| domManip: function( args, table, callback ) { |
| var results, first, fragment, parent, |
| value = args[0], |
| scripts = []; |
| // We can't cloneNode fragments that contain checked, in WebKit |
| if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { |
| return this.each(function() { |
| jQuery(this).domManip( args, table, callback, true ); |
| }); |
| } |
| if ( jQuery.isFunction(value) ) { |
| return this.each(function(i) { |
| var self = jQuery(this); |
| args[0] = value.call(this, i, table ? self.html() : undefined); |
| self.domManip( args, table, callback ); |
| }); |
| } |
| if ( this[0] ) { |
| parent = value && value.parentNode; |
| // If we're in a fragment, just use that instead of building a new one |
| if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { |
| results = { fragment: parent }; |
| } else { |
| results = jQuery.buildFragment( args, this, scripts ); |
| } |
| fragment = results.fragment; |
| if ( fragment.childNodes.length === 1 ) { |
| first = fragment = fragment.firstChild; |
| } else { |
| first = fragment.firstChild; |
| } |
| if ( first ) { |
| table = table && jQuery.nodeName( first, "tr" ); |
| for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { |
| callback.call( |
| table ? |
| root(this[i], first) : |
| this[i], |
| // Make sure that we do not leak memory by inadvertently discarding |
| // the original fragment (which might have attached data) instead of |
| // using it; in addition, use the original fragment object for the last |
| // item instead of first because it can end up being emptied incorrectly |
| // in certain situations (Bug #8070). |
| // Fragments from the fragment cache must always be cloned and never used |
| // in place. |
| results.cacheable || ( l > 1 && i < lastIndex ) ? |
| jQuery.clone( fragment, true, true ) : |
| fragment |
| ); |
| } |
| } |
| if ( scripts.length ) { |
| jQuery.each( scripts, evalScript ); |
| } |
| } |
| return this; |
| } |
| }); |
| function root( elem, cur ) { |
| return jQuery.nodeName(elem, "table") ? |
| (elem.getElementsByTagName("tbody")[0] || |
| elem.appendChild(elem.ownerDocument.createElement("tbody"))) : |
| elem; |
| } |
| function cloneCopyEvent( src, dest ) { |
| if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { |
| return; |
| } |
| var type, i, l, |
| oldData = jQuery._data( src ), |
| curData = jQuery._data( dest, oldData ), |
| events = oldData.events; |
| if ( events ) { |
| delete curData.handle; |
| curData.events = {}; |
| for ( type in events ) { |
| for ( i = 0, l = events[ type ].length; i < l; i++ ) { |
| jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); |
| } |
| } |
| } |
| // make the cloned public data object a copy from the original |
| if ( curData.data ) { |
| curData.data = jQuery.extend( {}, curData.data ); |
| } |
| } |
| function cloneFixAttributes( src, dest ) { |
| var nodeName; |
| // We do not need to do anything for non-Elements |
| if ( dest.nodeType !== 1 ) { |
| return; |
| } |
| // clearAttributes removes the attributes, which we don't want, |
| // but also removes the attachEvent events, which we *do* want |
| if ( dest.clearAttributes ) { |
| dest.clearAttributes(); |
| } |
| // mergeAttributes, in contrast, only merges back on the |
| // original attributes, not the events |
| if ( dest.mergeAttributes ) { |
| dest.mergeAttributes( src ); |
| } |
| nodeName = dest.nodeName.toLowerCase(); |
| // IE6-8 fail to clone children inside object elements that use |
| // the proprietary classid attribute value (rather than the type |
| // attribute) to identify the type of content to display |
| if ( nodeName === "object" ) { |
| dest.outerHTML = src.outerHTML; |
| } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { |
| // IE6-8 fails to persist the checked state of a cloned checkbox |
| // or radio button. Worse, IE6-7 fail to give the cloned element |
| // a checked appearance if the defaultChecked value isn't also set |
| if ( src.checked ) { |
| dest.defaultChecked = dest.checked = src.checked; |
| } |
| // IE6-7 get confused and end up setting the value of a cloned |
| // checkbox/radio button to an empty string instead of "on" |
| if ( dest.value !== src.value ) { |
| dest.value = src.value; |
| } |
| // IE6-8 fails to return the selected option to the default selected |
| // state when cloning options |
| } else if ( nodeName === "option" ) { |
| dest.selected = src.defaultSelected; |
| // IE6-8 fails to set the defaultValue to the correct value when |
| // cloning other types of input fields |
| } else if ( nodeName === "input" || nodeName === "textarea" ) { |
| dest.defaultValue = src.defaultValue; |
| } |
| // Event data gets referenced instead of copied if the expando |
| // gets copied too |
| dest.removeAttribute( jQuery.expando ); |
| } |
| jQuery.buildFragment = function( args, nodes, scripts ) { |
| var fragment, cacheable, cacheresults, doc, |
| first = args[ 0 ]; |
| // nodes may contain either an explicit document object, |
| // a jQuery collection or context object. |
| // If nodes[0] contains a valid object to assign to doc |
| if ( nodes && nodes[0] ) { |
| doc = nodes[0].ownerDocument || nodes[0]; |
| } |
| // Ensure that an attr object doesn't incorrectly stand in as a document object |
| // Chrome and Firefox seem to allow this to occur and will throw exception |
| // Fixes #8950 |
| if ( !doc.createDocumentFragment ) { |
| doc = document; |
| } |
| // Only cache "small" (1/2 KB) HTML strings that are associated with the main document |
| // Cloning options loses the selected state, so don't cache them |
| // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment |
| // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache |
| // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 |
| if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && |
| first.charAt(0) === "<" && !rnocache.test( first ) && |
| (jQuery.support.checkClone || !rchecked.test( first )) && |
| (!jQuery.support.unknownElems && rnoshimcache.test( first )) ) { |
| cacheable = true; |
| cacheresults = jQuery.fragments[ first ]; |
| if ( cacheresults && cacheresults !== 1 ) { |
| fragment = cacheresults; |
| } |
| } |
| if ( !fragment ) { |
| fragment = doc.createDocumentFragment(); |
| jQuery.clean( args, doc, fragment, scripts ); |
| } |
| if ( cacheable ) { |
| jQuery.fragments[ first ] = cacheresults ? fragment : 1; |
| } |
| return { fragment: fragment, cacheable: cacheable }; |
| }; |
| jQuery.fragments = {}; |
| jQuery.each({ |
| appendTo: "append", |
| prependTo: "prepend", |
| insertBefore: "before", |
| insertAfter: "after", |
| replaceAll: "replaceWith" |
| }, function( name, original ) { |
| jQuery.fn[ name ] = function( selector ) { |
| var ret = [], |
| insert = jQuery( selector ), |
| parent = this.length === 1 && this[0].parentNode; |
| if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { |
| insert[ original ]( this[0] ); |
| return this; |
| } else { |
| for ( var i = 0, l = insert.length; i < l; i++ ) { |
| var elems = ( i > 0 ? this.clone(true) : this ).get(); |
| jQuery( insert[i] )[ original ]( elems ); |
| ret = ret.concat( elems ); |
| } |
| return this.pushStack( ret, name, insert.selector ); |
| } |
| }; |
| }); |
| function getAll( elem ) { |
| if ( typeof elem.getElementsByTagName !== "undefined" ) { |
| return elem.getElementsByTagName( "*" ); |
| } else if ( typeof elem.querySelectorAll !== "undefined" ) { |
| return elem.querySelectorAll( "*" ); |
| } else { |
| return []; |
| } |
| } |
| // Used in clean, fixes the defaultChecked property |
| function fixDefaultChecked( elem ) { |
| if ( elem.type === "checkbox" || elem.type === "radio" ) { |
| elem.defaultChecked = elem.checked; |
| } |
| } |
| // Finds all inputs and passes them to fixDefaultChecked |
| function findInputs( elem ) { |
| var nodeName = ( elem.nodeName || "" ).toLowerCase(); |
| if ( nodeName === "input" ) { |
| fixDefaultChecked( elem ); |
| // Skip scripts, get other children |
| } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { |
| jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); |
| } |
| } |
| jQuery.extend({ |
| clone: function( elem, dataAndEvents, deepDataAndEvents ) { |
| var clone = elem.cloneNode(true), |
| srcElements, |
| destElements, |
| i; |
| if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && |
| (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { |
| // IE copies events bound via attachEvent when using cloneNode. |
| // Calling detachEvent on the clone will also remove the events |
| // from the original. In order to get around this, we use some |
| // proprietary methods to clear the events. Thanks to MooTools |
| // guys for this hotness. |
| cloneFixAttributes( elem, clone ); |
| // Using Sizzle here is crazy slow, so we use getElementsByTagName |
| // instead |
| srcElements = getAll( elem ); |
| destElements = getAll( clone ); |
| // Weird iteration because IE will replace the length property |
| // with an element if you are cloning the body and one of the |
| // elements on the page has a name or id of "length" |
| for ( i = 0; srcElements[i]; ++i ) { |
| // Ensure that the destination node is not null; Fixes #9587 |
| if ( destElements[i] ) { |
| cloneFixAttributes( srcElements[i], destElements[i] ); |
| } |
| } |
| } |
| // Copy the events from the original to the clone |
| if ( dataAndEvents ) { |
| cloneCopyEvent( elem, clone ); |
| if ( deepDataAndEvents ) { |
| srcElements = getAll( elem ); |
| destElements = getAll( clone ); |
| for ( i = 0; srcElements[i]; ++i ) { |
| cloneCopyEvent( srcElements[i], destElements[i] ); |
| } |
| } |
| } |
| srcElements = destElements = null; |
| // Return the cloned set |
| return clone; |
| }, |
| clean: function( elems, context, fragment, scripts ) { |
| var checkScriptType; |
| context = context || document; |
| // !context.createElement fails in IE with an error but returns typeof 'object' |
| if ( typeof context.createElement === "undefined" ) { |
| context = context.ownerDocument || context[0] && context[0].ownerDocument || document; |
| } |
| var ret = [], j; |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { |
| if ( typeof elem === "number" ) { |
| elem += ""; |
| } |
| if ( !elem ) { |
| continue; |
| } |
| // Convert html string into DOM nodes |
| if ( typeof elem === "string" ) { |
| if ( !rhtml.test( elem ) ) { |
| elem = context.createTextNode( elem ); |
| } else { |
| // Fix "XHTML"-style tags in all browsers |
| elem = elem.replace(rxhtmlTag, "<$1></$2>"); |
| // Trim whitespace, otherwise indexOf won't work as expected |
| var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), |
| wrap = wrapMap[ tag ] || wrapMap._default, |
| depth = wrap[0], |
| div = context.createElement("div"); |
| // Append wrapper element to unknown element safe doc fragment |
| if ( context === document ) { |
| // Use the fragment we've already created for this document |
| safeFragment.appendChild( div ); |
| } else { |
| // Use a fragment created with the owner document |
| createSafeFragment( context ).appendChild( div ); |
| } |
| // Go to html and back, then peel off extra wrappers |
| div.innerHTML = wrap[1] + elem + wrap[2]; |
| // Move to the right depth |
| while ( depth-- ) { |
| div = div.lastChild; |
| } |
| // Remove IE's autoinserted <tbody> from table fragments |
| if ( !jQuery.support.tbody ) { |
| // String was a <table>, *may* have spurious <tbody> |
| var hasBody = rtbody.test(elem), |
| tbody = tag === "table" && !hasBody ? |
| div.firstChild && div.firstChild.childNodes : |
| // String was a bare <thead> or <tfoot> |
| wrap[1] === "<table>" && !hasBody ? |
| div.childNodes : |
| []; |
| for ( j = tbody.length - 1; j >= 0 ; --j ) { |
| if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { |
| tbody[ j ].parentNode.removeChild( tbody[ j ] ); |
| } |
| } |
| } |
| // IE completely kills leading whitespace when innerHTML is used |
| if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { |
| div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); |
| } |
| elem = div.childNodes; |
| } |
| } |
| // Resets defaultChecked for any radios and checkboxes |
| // about to be appended to the DOM in IE 6/7 (#8060) |
| var len; |
| if ( !jQuery.support.appendChecked ) { |
| if ( elem[0] && typeof (len = elem.length) === "number" ) { |
| for ( j = 0; j < len; j++ ) { |
| findInputs( elem[j] ); |
| } |
| } else { |
| findInputs( elem ); |
| } |
| } |
| if ( elem.nodeType ) { |
| ret.push( elem ); |
| } else { |
| ret = jQuery.merge( ret, elem ); |
| } |
| } |
| if ( fragment ) { |
| checkScriptType = function( elem ) { |
| return !elem.type || rscriptType.test( elem.type ); |
| }; |
| for ( i = 0; ret[i]; i++ ) { |
| if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { |
| scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); |
| } else { |
| if ( ret[i].nodeType === 1 ) { |
| var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); |
| ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); |
| } |
| fragment.appendChild( ret[i] ); |
| } |
| } |
| } |
| return ret; |
| }, |
| cleanData: function( elems ) { |
| var data, id, |
| cache = jQuery.cache, |
| special = jQuery.event.special, |
| deleteExpando = jQuery.support.deleteExpando; |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { |
| if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { |
| continue; |
| } |
| id = elem[ jQuery.expando ]; |
| if ( id ) { |
| data = cache[ id ]; |
| if ( data && data.events ) { |
| for ( var type in data.events ) { |
| if ( special[ type ] ) { |
| jQuery.event.remove( elem, type ); |
| // This is a shortcut to avoid jQuery.event.remove's overhead |
| } else { |
| jQuery.removeEvent( elem, type, data.handle ); |
| } |
| } |
| // Null the DOM reference to avoid IE6/7/8 leak (#7054) |
| if ( data.handle ) { |
| data.handle.elem = null; |
| } |
| } |
| if ( deleteExpando ) { |
| delete elem[ jQuery.expando ]; |
| } else if ( elem.removeAttribute ) { |
| elem.removeAttribute( jQuery.expando ); |
| } |
| delete cache[ id ]; |
| } |
| } |
| } |
| }); |
| function evalScript( i, elem ) { |
| if ( elem.src ) { |
| jQuery.ajax({ |
| url: elem.src, |
| async: false, |
| dataType: "script" |
| }); |
| } else { |
| jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); |
| } |
| if ( elem.parentNode ) { |
| elem.parentNode.removeChild( elem ); |
| } |
| } |
| var ralpha = /alpha\([^)]*\)/i, |
| ropacity = /opacity=([^)]*)/, |
| // fixed for IE9, see #8346 |
| rupper = /([A-Z]|^ms)/g, |
| rnumpx = /^-?\d+(?:px)?$/i, |
| rnum = /^-?\d/, |
| rrelNum = /^([\-+])=([\-+.\de]+)/, |
| cssShow = { position: "absolute", visibility: "hidden", display: "block" }, |
| cssWidth = [ "Left", "Right" ], |
| cssHeight = [ "Top", "Bottom" ], |
| curCSS, |
| getComputedStyle, |
| currentStyle; |
| jQuery.fn.css = function( name, value ) { |
| // Setting 'undefined' is a no-op |
| if ( arguments.length === 2 && value === undefined ) { |
| return this; |
| } |
| return jQuery.access( this, name, value, true, function( elem, name, value ) { |
| return value !== undefined ? |
| jQuery.style( elem, name, value ) : |
| jQuery.css( elem, name ); |
| }); |
| }; |
| jQuery.extend({ |
| // Add in style property hooks for overriding the default |
| // behavior of getting and setting a style property |
| cssHooks: { |
| opacity: { |
| get: function( elem, computed ) { |
| if ( computed ) { |
| // We should always get a number back from opacity |
| var ret = curCSS( elem, "opacity", "opacity" ); |
| return ret === "" ? "1" : ret; |
| } else { |
| return elem.style.opacity; |
| } |
| } |
| } |
| }, |
| // Exclude the following css properties to add px |
| cssNumber: { |
| "fillOpacity": true, |
| "fontWeight": true, |
| "lineHeight": true, |
| "opacity": true, |
| "orphans": true, |
| "widows": true, |
| "zIndex": true, |
| "zoom": true |
| }, |
| // Add in properties whose names you wish to fix before |
| // setting or getting the value |
| cssProps: { |
| // normalize float css property |
| "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" |
| }, |
| // Get and set the style property on a DOM Node |
| style: function( elem, name, value, extra ) { |
| // Don't set styles on text and comment nodes |
| if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { |
| return; |
| } |
| // Make sure that we're working with the right name |
| var ret, type, origName = jQuery.camelCase( name ), |
| style = elem.style, hooks = jQuery.cssHooks[ origName ]; |
| name = jQuery.cssProps[ origName ] || origName; |
| // Check if we're setting a value |
| if ( value !== undefined ) { |
| type = typeof value; |
| // convert relative number strings (+= or -=) to relative numbers. #7345 |
| if ( type === "string" && (ret = rrelNum.exec( value )) ) { |
| value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); |
| // Fixes bug #9237 |
| type = "number"; |
| } |
| // Make sure that NaN and null values aren't set. See: #7116 |
| if ( value == null || type === "number" && isNaN( value ) ) { |
| return; |
| } |
| // If a number was passed in, add 'px' to the (except for certain CSS properties) |
| if ( type === "number" && !jQuery.cssNumber[ origName ] ) { |
| value += "px"; |
| } |
| // If a hook was provided, use that value, otherwise just set the specified value |
| if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { |
| // Wrapped to prevent IE from throwing errors when 'invalid' values are provided |
| // Fixes bug #5509 |
| try { |
| style[ name ] = value; |
| } catch(e) {} |
| } |
| } else { |
| // If a hook was provided get the non-computed value from there |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { |
| return ret; |
| } |
| // Otherwise just get the value from the style object |
| return style[ name ]; |
| } |
| }, |
| css: function( elem, name, extra ) { |
| var ret, hooks; |
| // Make sure that we're working with the right name |
| name = jQuery.camelCase( name ); |
| hooks = jQuery.cssHooks[ name ]; |
| name = jQuery.cssProps[ name ] || name; |
| // cssFloat needs a special treatment |
| if ( name === "cssFloat" ) { |
| name = "float"; |
| } |
| // If a hook was provided get the computed value from there |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { |
| return ret; |
| // Otherwise, if a way to get the computed value exists, use that |
| } else if ( curCSS ) { |
| return curCSS( elem, name ); |
| } |
| }, |
| // A method for quickly swapping in/out CSS properties to get correct calculations |
| swap: function( elem, options, callback ) { |
| var old = {}; |
| // Remember the old values, and insert the new ones |
| for ( var name in options ) { |
| old[ name ] = elem.style[ name ]; |
| elem.style[ name ] = options[ name ]; |
| } |
| callback.call( elem ); |
| // Revert the old values |
| for ( name in options ) { |
| elem.style[ name ] = old[ name ]; |
| } |
| } |
| }); |
| // DEPRECATED, Use jQuery.css() instead |
| jQuery.curCSS = jQuery.css; |
| jQuery.each(["height", "width"], function( i, name ) { |
| jQuery.cssHooks[ name ] = { |
| get: function( elem, computed, extra ) { |
| var val; |
| if ( computed ) { |
| if ( elem.offsetWidth !== 0 ) { |
| return getWH( elem, name, extra ); |
| } else { |
| jQuery.swap( elem, cssShow, function() { |
| val = getWH( elem, name, extra ); |
| }); |
| } |
| return val; |
| } |
| }, |
| set: function( elem, value ) { |
| if ( rnumpx.test( value ) ) { |
| // ignore negative width and height values #1599 |
| value = parseFloat( value ); |
| if ( value >= 0 ) { |
| return value + "px"; |
| } |
| } else { |
| return value; |
| } |
| } |
| }; |
| }); |
| if ( !jQuery.support.opacity ) { |
| jQuery.cssHooks.opacity = { |
| get: function( elem, computed ) { |
| // IE uses filters for opacity |
| return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? |
| ( parseFloat( RegExp.$1 ) / 100 ) + "" : |
| computed ? "1" : ""; |
| }, |
| set: function( elem, value ) { |
| var style = elem.style, |
| currentStyle = elem.currentStyle, |
| opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", |
| filter = currentStyle && currentStyle.filter || style.filter || ""; |
| // IE has trouble with opacity if it does not have layout |
| // Force it by setting the zoom level |
| style.zoom = 1; |
| // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 |
| if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { |
| // Setting style.filter to null, "" & " " still leave "filter:" in the cssText |
| // if "filter:" is present at all, clearType is disabled, we want to avoid this |
| // style.removeAttribute is IE Only, but so apparently is this code path... |
| style.removeAttribute( "filter" ); |
| // if there there is no filter style applied in a css rule, we are done |
| if ( currentStyle && !currentStyle.filter ) { |
| return; |
| } |
| } |
| // otherwise, set new filter values |
| style.filter = ralpha.test( filter ) ? |
| filter.replace( ralpha, opacity ) : |
| filter + " " + opacity; |
| } |
| }; |
| } |
| jQuery(function() { |
| // This hook cannot be added until DOM ready because the support test |
| // for it is not run until after DOM ready |
| if ( !jQuery.support.reliableMarginRight ) { |
| jQuery.cssHooks.marginRight = { |
| get: function( elem, computed ) { |
| // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right |
| // Work around by temporarily setting element display to inline-block |
| var ret; |
| jQuery.swap( elem, { "display": "inline-block" }, function() { |
| if ( computed ) { |
| ret = curCSS( elem, "margin-right", "marginRight" ); |
| } else { |
| ret = elem.style.marginRight; |
| } |
| }); |
| return ret; |
| } |
| }; |
| } |
| }); |
| if ( document.defaultView && document.defaultView.getComputedStyle ) { |
| getComputedStyle = function( elem, name ) { |
| var ret, defaultView, computedStyle; |
| name = name.replace( rupper, "-$1" ).toLowerCase(); |
| if ( !(defaultView = elem.ownerDocument.defaultView) ) { |
| return undefined; |
| } |
| if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { |
| ret = computedStyle.getPropertyValue( name ); |
| if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { |
| ret = jQuery.style( elem, name ); |
| } |
| } |
| return ret; |
| }; |
| } |
| if ( document.documentElement.currentStyle ) { |
| currentStyle = function( elem, name ) { |
| var left, rsLeft, uncomputed, |
| ret = elem.currentStyle && elem.currentStyle[ name ], |
| style = elem.style; |
| // Avoid setting ret to empty string here |
| // so we don't default to auto |
| if ( ret === null && style && (uncomputed = style[ name ]) ) { |
| ret = uncomputed; |
| } |
| // From the awesome hack by Dean Edwards |
| // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 |
| // If we're not dealing with a regular pixel number |
| // but a number that has a weird ending, we need to convert it to pixels |
| if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { |
| // Remember the original values |
| left = style.left; |
| rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; |
| // Put in the new values to get a computed value out |
| if ( rsLeft ) { |
| elem.runtimeStyle.left = elem.currentStyle.left; |
| } |
| style.left = name === "fontSize" ? "1em" : ( ret || 0 ); |
| ret = style.pixelLeft + "px"; |
| // Revert the changed values |
| style.left = left; |
| if ( rsLeft ) { |
| elem.runtimeStyle.left = rsLeft; |
| } |
| } |
| return ret === "" ? "auto" : ret; |
| }; |
| } |
| curCSS = getComputedStyle || currentStyle; |
| function getWH( elem, name, extra ) { |
| // Start with offset property |
| var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, |
| which = name === "width" ? cssWidth : cssHeight; |
| if ( val > 0 ) { |
| if ( extra !== "border" ) { |
| jQuery.each( which, function() { |
| if ( !extra ) { |
| val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; |
| } |
| if ( extra === "margin" ) { |
| val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; |
| } else { |
| val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; |
| } |
| }); |
| } |
| return val + "px"; |
| } |
| // Fall back to computed then uncomputed css if necessary |
| val = curCSS( elem, name, name ); |
| if ( val < 0 || val == null ) { |
| val = elem.style[ name ] || 0; |
| } |
| // Normalize "", auto, and prepare for extra |
| val = parseFloat( val ) || 0; |
| // Add padding, border, margin |
| if ( extra ) { |
| jQuery.each( which, function() { |
| val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; |
| if ( extra !== "padding" ) { |
| val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; |
| } |
| if ( extra === "margin" ) { |
| val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; |
| } |
| }); |
| } |
| return val + "px"; |
| } |
| if ( jQuery.expr && jQuery.expr.filters ) { |
| jQuery.expr.filters.hidden = function( elem ) { |
| var width = elem.offsetWidth, |
| height = elem.offsetHeight; |
| return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); |
| }; |
| jQuery.expr.filters.visible = function( elem ) { |
| return !jQuery.expr.filters.hidden( elem ); |
| }; |
| } |
| var r20 = /%20/g, |
| rbracket = /\[\]$/, |
| rCRLF = /\r?\n/g, |
| rhash = /#.*$/, |
| rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL |
| rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, |
| // #7653, #8125, #8152: local protocol detection |
| rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, |
| rnoContent = /^(?:GET|HEAD)$/, |
| rprotocol = /^\/\//, |
| rquery = /\?/, |
| rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, |
| rselectTextarea = /^(?:select|textarea)/i, |
| rspacesAjax = /\s+/, |
| rts = /([?&])_=[^&]*/, |
| rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, |
| // Keep a copy of the old load method |
| _load = jQuery.fn.load, |
| /* Prefilters |
| * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) |
| * 2) These are called: |
| * - BEFORE asking for a transport |
| * - AFTER param serialization (s.data is a string if s.processData is true) |
| * 3) key is the dataType |
| * 4) the catchall symbol "*" can be used |
| * 5) execution will start with transport dataType and THEN continue down to "*" if needed |
| */ |
| prefilters = {}, |
| /* Transports bindings |
| * 1) key is the dataType |
| * 2) the catchall symbol "*" can be used |
| * 3) selection will start with transport dataType and THEN go to "*" if needed |
| */ |
| transports = {}, |
| // Document location |
| ajaxLocation, |
| // Document location segments |
| ajaxLocParts, |
| // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression |
| allTypes = ["*/"] + ["*"]; |
| // #8138, IE may throw an exception when accessing |
| // a field from window.location if document.domain has been set |
| try { |
| ajaxLocation = location.href; |
| } catch( e ) { |
| // Use the href attribute of an A element |
| // since IE will modify it given document.location |
| ajaxLocation = document.createElement( "a" ); |
| ajaxLocation.href = ""; |
| ajaxLocation = ajaxLocation.href; |
| } |
| // Segment location into parts |
| ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; |
| // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport |
| function addToPrefiltersOrTransports( structure ) { |
| // dataTypeExpression is optional and defaults to "*" |
| return function( dataTypeExpression, func ) { |
| if ( typeof dataTypeExpression !== "string" ) { |
| func = dataTypeExpression; |
| dataTypeExpression = "*"; |
| } |
| if ( jQuery.isFunction( func ) ) { |
| var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), |
| i = 0, |
| length = dataTypes.length, |
| dataType, |
| list, |
| placeBefore; |
| // For each dataType in the dataTypeExpression |
| for ( ; i < length; i++ ) { |
| dataType = dataTypes[ i ]; |
| // We control if we're asked to add before |
| // any existing element |
| placeBefore = /^\+/.test( dataType ); |
| if ( placeBefore ) { |
| dataType = dataType.substr( 1 ) || "*"; |
| } |
| list = structure[ dataType ] = structure[ dataType ] || []; |
| // then we add to the structure accordingly |
| list[ placeBefore ? "unshift" : "push" ]( func ); |
| } |
| } |
| }; |
| } |
| // Base inspection function for prefilters and transports |
| function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, |
| dataType /* internal */, inspected /* internal */ ) { |
| dataType = dataType || options.dataTypes[ 0 ]; |
| inspected = inspected || {}; |
| inspected[ dataType ] = true; |
| var list = structure[ dataType ], |
| i = 0, |
| length = list ? list.length : 0, |
| executeOnly = ( structure === prefilters ), |
| selection; |
| for ( ; i < length && ( executeOnly || !selection ); i++ ) { |
| selection = list[ i ]( options, originalOptions, jqXHR ); |
| // If we got redirected to another dataType |
| // we try there if executing only and not done already |
| if ( typeof selection === "string" ) { |
| if ( !executeOnly || inspected[ selection ] ) { |
| selection = undefined; |
| } else { |
| options.dataTypes.unshift( selection ); |
| selection = inspectPrefiltersOrTransports( |
| structure, options, originalOptions, jqXHR, selection, inspected ); |
| } |
| } |
| } |
| // If we're only executing or nothing was selected |
| // we try the catchall dataType if not done already |
| if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { |
| selection = inspectPrefiltersOrTransports( |
| structure, options, originalOptions, jqXHR, "*", inspected ); |
| } |
| // unnecessary when only executing (prefilters) |
| // but it'll be ignored by the caller in that case |
| return selection; |
| } |
| // A special extend for ajax options |
| // that takes "flat" options (not to be deep extended) |
| // Fixes #9887 |
| function ajaxExtend( target, src ) { |
| var key, deep, |
| flatOptions = jQuery.ajaxSettings.flatOptions || {}; |
| for ( key in src ) { |
| if ( src[ key ] !== undefined ) { |
| ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; |
| } |
| } |
| if ( deep ) { |
| jQuery.extend( true, target, deep ); |
| } |
| } |
| jQuery.fn.extend({ |
| load: function( url, params, callback ) { |
| if ( typeof url !== "string" && _load ) { |
| return _load.apply( this, arguments ); |
| // Don't do a request if no elements are being requested |
| } else if ( !this.length ) { |
| return this; |
| } |
| var off = url.indexOf( " " ); |
| if ( off >= 0 ) { |
| var selector = url.slice( off, url.length ); |
| url = url.slice( 0, off ); |
| } |
| // Default to a GET request |
| var type = "GET"; |
| // If the second parameter was provided |
| if ( params ) { |
| // If it's a function |
| if ( jQuery.isFunction( params ) ) { |
| // We assume that it's the callback |
| callback = params; |
| params = undefined; |
| // Otherwise, build a param string |
| } else if ( typeof params === "object" ) { |
| params = jQuery.param( params, jQuery.ajaxSettings.traditional ); |
| type = "POST"; |
| } |
| } |
| var self = this; |
| // Request the remote document |
| jQuery.ajax({ |
| url: url, |
| type: type, |
| dataType: "html", |
| data: params, |
| // Complete callback (responseText is used internally) |
| complete: function( jqXHR, status, responseText ) { |
| // Store the response as specified by the jqXHR object |
| responseText = jqXHR.responseText; |
| // If successful, inject the HTML into all the matched elements |
| if ( jqXHR.isResolved() ) { |
| // #4825: Get the actual response in case |
| // a dataFilter is present in ajaxSettings |
| jqXHR.done(function( r ) { |
| responseText = r; |
| }); |
| // See if a selector was specified |
| self.html( selector ? |
| // Create a dummy div to hold the results |
| jQuery("<div>") |
| // inject the contents of the document in, removing the scripts |
| // to avoid any 'Permission Denied' errors in IE |
| .append(responseText.replace(rscript, "")) |
| // Locate the specified elements |
| .find(selector) : |
| // If not, just inject the full result |
| responseText ); |
| } |
| if ( callback ) { |
| self.each( callback, [ responseText, status, jqXHR ] ); |
| } |
| } |
| }); |
| return this; |
| }, |
| serialize: function() { |
| return jQuery.param( this.serializeArray() ); |
| }, |
| serializeArray: function() { |
| return this.map(function(){ |
| return this.elements ? jQuery.makeArray( this.elements ) : this; |
| }) |
| .filter(function(){ |
| return this.name && !this.disabled && |
| ( this.checked || rselectTextarea.test( this.nodeName ) || |
| rinput.test( this.type ) ); |
| }) |
| .map(function( i, elem ){ |
| var val = jQuery( this ).val(); |
| return val == null ? |
| null : |
| jQuery.isArray( val ) ? |
| jQuery.map( val, function( val, i ){ |
| return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; |
| }) : |
| { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; |
| }).get(); |
| } |
| }); |
| // Attach a bunch of functions for handling common AJAX events |
| jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ |
| jQuery.fn[ o ] = function( f ){ |
| return this.bind( o, f ); |
| }; |
| }); |
| jQuery.each( [ "get", "post" ], function( i, method ) { |
| jQuery[ method ] = function( url, data, callback, type ) { |
| // shift arguments if data argument was omitted |
| if ( jQuery.isFunction( data ) ) { |
| type = type || callback; |
| callback = data; |
| data = undefined; |
| } |
| return jQuery.ajax({ |
| type: method, |
| url: url, |
| data: data, |
| success: callback, |
| dataType: type |
| }); |
| }; |
| }); |
| jQuery.extend({ |
| getScript: function( url, callback ) { |
| return jQuery.get( url, undefined, callback, "script" ); |
| }, |
| getJSON: function( url, data, callback ) { |
| return jQuery.get( url, data, callback, "json" ); |
| }, |
| // Creates a full fledged settings object into target |
| // with both ajaxSettings and settings fields. |
| // If target is omitted, writes into ajaxSettings. |
| ajaxSetup: function( target, settings ) { |
| if ( settings ) { |
| // Building a settings object |
| ajaxExtend( target, jQuery.ajaxSettings ); |
| } else { |
| // Extending ajaxSettings |
| settings = target; |
| target = jQuery.ajaxSettings; |
| } |
| ajaxExtend( target, settings ); |
| return target; |
| }, |
| ajaxSettings: { |
| url: ajaxLocation, |
| isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), |
| global: true, |
| type: "GET", |
| contentType: "application/x-www-form-urlencoded", |
| processData: true, |
| async: true, |
| /* |
| timeout: 0, |
| data: null, |
| dataType: null, |
| username: null, |
| password: null, |
| cache: null, |
| traditional: false, |
| headers: {}, |
| */ |
| accepts: { |
| xml: "application/xml, text/xml", |
| html: "text/html", |
| text: "text/plain", |
| json: "application/json, text/javascript", |
| "*": allTypes |
| }, |
| contents: { |
| xml: /xml/, |
| html: /html/, |
| json: /json/ |
| }, |
| responseFields: { |
| xml: "responseXML", |
| text: "responseText" |
| }, |
| // List of data converters |
| // 1) key format is "source_type destination_type" (a single space in-between) |
| // 2) the catchall symbol "*" can be used for source_type |
| converters: { |
| // Convert anything to text |
| "* text": window.String, |
| // Text to html (true = no transformation) |
| "text html": true, |
| // Evaluate text as a json expression |
| "text json": jQuery.parseJSON, |
| // Parse text as xml |
| "text xml": jQuery.parseXML |
| }, |
| // For options that shouldn't be deep extended: |
| // you can add your own custom options here if |
| // and when you create one that shouldn't be |
| // deep extended (see ajaxExtend) |
| flatOptions: { |
| context: true, |
| url: true |
| } |
| }, |
| ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), |
| ajaxTransport: addToPrefiltersOrTransports( transports ), |
| // Main method |
| ajax: function( url, options ) { |
| // If url is an object, simulate pre-1.5 signature |
| if ( typeof url === "object" ) { |
| options = url; |
| url = undefined; |
| } |
| // Force options to be an object |
| options = options || {}; |
| var // Create the final options object |
| s = jQuery.ajaxSetup( {}, options ), |
| // Callbacks context |
| callbackContext = s.context || s, |
| // Context for global events |
| // It's the callbackContext if one was provided in the options |
| // and if it's a DOM node or a jQuery collection |
| globalEventContext = callbackContext !== s && |
| ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? |
| jQuery( callbackContext ) : jQuery.event, |
| // Deferreds |
| deferred = jQuery.Deferred(), |
| completeDeferred = jQuery.Callbacks( "once memory" ), |
| // Status-dependent callbacks |
| statusCode = s.statusCode || {}, |
| // ifModified key |
| ifModifiedKey, |
| // Headers (they are sent all at once) |
| requestHeaders = {}, |
| requestHeadersNames = {}, |
| // Response headers |
| responseHeadersString, |
| responseHeaders, |
| // transport |
| transport, |
| // timeout handle |
| timeoutTimer, |
| // Cross-domain detection vars |
| parts, |
| // The jqXHR state |
| state = 0, |
| // To know if global events are to be dispatched |
| fireGlobals, |
| // Loop variable |
| i, |
| // Fake xhr |
| jqXHR = { |
| readyState: 0, |
| // Caches the header |
| setRequestHeader: function( name, value ) { |
| if ( !state ) { |
| var lname = name.toLowerCase(); |
| name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; |
| requestHeaders[ name ] = value; |
| } |
| return this; |
| }, |
| // Raw string |
| getAllResponseHeaders: function() { |
| return state === 2 ? responseHeadersString : null; |
| }, |
| // Builds headers hashtable if needed |
| getResponseHeader: function( key ) { |
| var match; |
| if ( state === 2 ) { |
| if ( !responseHeaders ) { |
| responseHeaders = {}; |
| while( ( match = rheaders.exec( responseHeadersString ) ) ) { |
| responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; |
| } |
| } |
| match = responseHeaders[ key.toLowerCase() ]; |
| } |
| return match === undefined ? null : match; |
| }, |
| // Overrides response content-type header |
| overrideMimeType: function( type ) { |
| if ( !state ) { |
| s.mimeType = type; |
| } |
| return this; |
| }, |
| // Cancel the request |
| abort: function( statusText ) { |
| statusText = statusText || "abort"; |
| if ( transport ) { |
| transport.abort( statusText ); |
| } |
| done( 0, statusText ); |
| return this; |
| } |
| }; |
| // Callback for when everything is done |
| // It is defined here because jslint complains if it is declared |
| // at the end of the function (which would be more logical and readable) |
| function done( status, nativeStatusText, responses, headers ) { |
| // Called once |
| if ( state === 2 ) { |
| return; |
| } |
| // State is "done" now |
| state = 2; |
| // Clear timeout if it exists |
| if ( timeoutTimer ) { |
| clearTimeout( timeoutTimer ); |
| } |
| // Dereference transport for early garbage collection |
| // (no matter how long the jqXHR object will be used) |
| transport = undefined; |
| // Cache response headers |
| responseHeadersString = headers || ""; |
| // Set readyState |
| jqXHR.readyState = status > 0 ? 4 : 0; |
| var isSuccess, |
| success, |
| error, |
| statusText = nativeStatusText, |
| response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, |
| lastModified, |
| etag; |
| // If successful, handle type chaining |
| if ( status >= 200 && status < 300 || status === 304 ) { |
| // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. |
| if ( s.ifModified ) { |
| if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { |
| jQuery.lastModified[ ifModifiedKey ] = lastModified; |
| } |
| if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { |
| jQuery.etag[ ifModifiedKey ] = etag; |
| } |
| } |
| // If not modified |
| if ( status === 304 ) { |
| statusText = "notmodified"; |
| isSuccess = true; |
| // If we have data |
| } else { |
| try { |
| success = ajaxConvert( s, response ); |
| statusText = "success"; |
| isSuccess = true; |
| } catch(e) { |
| // We have a parsererror |
| statusText = "parsererror"; |
| error = e; |
| } |
| } |
| } else { |
| // We extract error from statusText |
| // then normalize statusText and status for non-aborts |
| error = statusText; |
| if ( !statusText || status ) { |
| statusText = "error"; |
| if ( status < 0 ) { |
| status = 0; |
| } |
| } |
| } |
| // Set data for the fake xhr object |
| jqXHR.status = status; |
| jqXHR.statusText = "" + ( nativeStatusText || statusText ); |
| // Success/Error |
| if ( isSuccess ) { |
| deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); |
| } else { |
| deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); |
| } |
| // Status-dependent callbacks |
| jqXHR.statusCode( statusCode ); |
| statusCode = undefined; |
| if ( fireGlobals ) { |
| globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), |
| [ jqXHR, s, isSuccess ? success : error ] ); |
| } |
| // Complete |
| completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); |
| if ( fireGlobals ) { |
| globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); |
| // Handle the global AJAX counter |
| if ( !( --jQuery.active ) ) { |
| jQuery.event.trigger( "ajaxStop" ); |
| } |
| } |
| } |
| // Attach deferreds |
| deferred.promise( jqXHR ); |
| jqXHR.success = jqXHR.done; |
| jqXHR.error = jqXHR.fail; |
| jqXHR.complete = completeDeferred.add; |
| // Status-dependent callbacks |
| jqXHR.statusCode = function( map ) { |
| if ( map ) { |
| var tmp; |
| if ( state < 2 ) { |
| for ( tmp in map ) { |
| statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; |
| } |
| } else { |
| tmp = map[ jqXHR.status ]; |
| jqXHR.then( tmp, tmp ); |
| } |
| } |
| return this; |
| }; |
| // Remove hash character (#7531: and string promotion) |
| // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) |
| // We also use the url parameter if available |
| s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); |
| // Extract dataTypes list |
| s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); |
| // Determine if a cross-domain request is in order |
| if ( s.crossDomain == null ) { |
| parts = rurl.exec( s.url.toLowerCase() ); |
| s.crossDomain = !!( parts && |
| ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || |
| ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != |
| ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) |
| ); |
| } |
| // Convert data if not already a string |
| if ( s.data && s.processData && typeof s.data !== "string" ) { |
| s.data = jQuery.param( s.data, s.traditional ); |
| } |
| // Apply prefilters |
| inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); |
| // If request was aborted inside a prefiler, stop there |
| if ( state === 2 ) { |
| return false; |
| } |
| // We can fire global events as of now if asked to |
| fireGlobals = s.global; |
| // Uppercase the type |
| s.type = s.type.toUpperCase(); |
| // Determine if request has content |
| s.hasContent = !rnoContent.test( s.type ); |
| // Watch for a new set of requests |
| if ( fireGlobals && jQuery.active++ === 0 ) { |
| jQuery.event.trigger( "ajaxStart" ); |
| } |
| // More options handling for requests with no content |
| if ( !s.hasContent ) { |
| // If data is available, append data to url |
| if ( s.data ) { |
| s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; |
| // #9682: remove data so that it's not used in an eventual retry |
| delete s.data; |
| } |
| // Get ifModifiedKey before adding the anti-cache parameter |
| ifModifiedKey = s.url; |
| // Add anti-cache in url if needed |
| if ( s.cache === false ) { |
| var ts = jQuery.now(), |
| // try replacing _= if it is there |
| ret = s.url.replace( rts, "$1_=" + ts ); |
| // if nothing was replaced, add timestamp to the end |
| s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); |
| } |
| } |
| // Set the correct header, if data is being sent |
| if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { |
| jqXHR.setRequestHeader( "Content-Type", s.contentType ); |
| } |
| // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. |
| if ( s.ifModified ) { |
| ifModifiedKey = ifModifiedKey || s.url; |
| if ( jQuery.lastModified[ ifModifiedKey ] ) { |
| jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); |
| } |
| if ( jQuery.etag[ ifModifiedKey ] ) { |
| jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); |
| } |
| } |
| // Set the Accepts header for the server, depending on the dataType |
| jqXHR.setRequestHeader( |
| "Accept", |
| s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? |
| s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : |
| s.accepts[ "*" ] |
| ); |
| // Check for headers option |
| for ( i in s.headers ) { |
| jqXHR.setRequestHeader( i, s.headers[ i ] ); |
| } |
| // Allow custom headers/mimetypes and early abort |
| if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { |
| // Abort if not done already |
| jqXHR.abort(); |
| return false; |
| } |
| // Install callbacks on deferreds |
| for ( i in { success: 1, error: 1, complete: 1 } ) { |
| jqXHR[ i ]( s[ i ] ); |
| } |
| // Get transport |
| transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); |
| // If no transport, we auto-abort |
| if ( !transport ) { |
| done( -1, "No Transport" ); |
| } else { |
| jqXHR.readyState = 1; |
| // Send global event |
| if ( fireGlobals ) { |
| globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); |
| } |
| // Timeout |
| if ( s.async && s.timeout > 0 ) { |
| timeoutTimer = setTimeout( function(){ |
| jqXHR.abort( "timeout" ); |
| }, s.timeout ); |
| } |
| try { |
| state = 1; |
| transport.send( requestHeaders, done ); |
| } catch (e) { |
| // Propagate exception as error if not done |
| if ( state < 2 ) { |
| done( -1, e ); |
| // Simply rethrow otherwise |
| } else { |
| jQuery.error( e ); |
| } |
| } |
| } |
| return jqXHR; |
| }, |
| // Serialize an array of form elements or a set of |
| // key/values into a query string |
| param: function( a, traditional ) { |
| var s = [], |
| add = function( key, value ) { |
| // If value is a function, invoke it and return its value |
| value = jQuery.isFunction( value ) ? value() : value; |
| s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); |
| }; |
| // Set traditional to true for jQuery <= 1.3.2 behavior. |
| if ( traditional === undefined ) { |
| traditional = jQuery.ajaxSettings.traditional; |
| } |
| // If an array was passed in, assume that it is an array of form elements. |
| if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { |
| // Serialize the form elements |
| jQuery.each( a, function() { |
| add( this.name, this.value ); |
| }); |
| } else { |
| // If traditional, encode the "old" way (the way 1.3.2 or older |
| // did it), otherwise encode params recursively. |
| for ( var prefix in a ) { |
| buildParams( prefix, a[ prefix ], traditional, add ); |
| } |
| } |
| // Return the resulting serialization |
| return s.join( "&" ).replace( r20, "+" ); |
| } |
| }); |
| function buildParams( prefix, obj, traditional, add ) { |
| if ( jQuery.isArray( obj ) ) { |
| // Serialize array item. |
| jQuery.each( obj, function( i, v ) { |
| if ( traditional || rbracket.test( prefix ) ) { |
| // Treat each array item as a scalar. |
| add( prefix, v ); |
| } else { |
| // If array item is non-scalar (array or object), encode its |
| // numeric index to resolve deserialization ambiguity issues. |
| // Note that rack (as of 1.0.0) can't currently deserialize |
| // nested arrays properly, and attempting to do so may cause |
| // a server error. Possible fixes are to modify rack's |
| // deserialization algorithm or to provide an option or flag |
| // to force array serialization to be shallow. |
| buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); |
| } |
| }); |
| } else if ( !traditional && obj != null && typeof obj === "object" ) { |
| // Serialize object item. |
| for ( var name in obj ) { |
| buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); |
| } |
| } else { |
| // Serialize scalar item. |
| add( prefix, obj ); |
| } |
| } |
| // This is still on the jQuery object... for now |
| // Want to move this to jQuery.ajax some day |
| jQuery.extend({ |
| // Counter for holding the number of active queries |
| active: 0, |
| // Last-Modified header cache for next request |
| lastModified: {}, |
| etag: {} |
| }); |
| /* Handles responses to an ajax request: |
| * - sets all responseXXX fields accordingly |
| * - finds the right dataType (mediates between content-type and expected dataType) |
| * - returns the corresponding response |
| */ |
| function ajaxHandleResponses( s, jqXHR, responses ) { |
| var contents = s.contents, |
| dataTypes = s.dataTypes, |
| responseFields = s.responseFields, |
| ct, |
| type, |
| finalDataType, |
| firstDataType; |
| // Fill responseXXX fields |
| for ( type in responseFields ) { |
| if ( type in responses ) { |
| jqXHR[ responseFields[type] ] = responses[ type ]; |
| } |
| } |
| // Remove auto dataType and get content-type in the process |
| while( dataTypes[ 0 ] === "*" ) { |
| dataTypes.shift(); |
| if ( ct === undefined ) { |
| ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); |
| } |
| } |
| // Check if we're dealing with a known content-type |
| if ( ct ) { |
| for ( type in contents ) { |
| if ( contents[ type ] && contents[ type ].test( ct ) ) { |
| dataTypes.unshift( type ); |
| break; |
| } |
| } |
| } |
| // Check to see if we have a response for the expected dataType |
| if ( dataTypes[ 0 ] in responses ) { |
| finalDataType = dataTypes[ 0 ]; |
| } else { |
| // Try convertible dataTypes |
| for ( type in responses ) { |
| if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { |
| finalDataType = type; |
| break; |
| } |
| if ( !firstDataType ) { |
| firstDataType = type; |
| } |
| } |
| // Or just use first one |
| finalDataType = finalDataType || firstDataType; |
| } |
| // If we found a dataType |
| // We add the dataType to the list if needed |
| // and return the corresponding response |
| if ( finalDataType ) { |
| if ( finalDataType !== dataTypes[ 0 ] ) { |
| dataTypes.unshift( finalDataType ); |
| } |
| return responses[ finalDataType ]; |
| } |
| } |
| // Chain conversions given the request and the original response |
| function ajaxConvert( s, response ) { |
| // Apply the dataFilter if provided |
| if ( s.dataFilter ) { |
| response = s.dataFilter( response, s.dataType ); |
| } |
| var dataTypes = s.dataTypes, |
| converters = {}, |
| i, |
| key, |
| length = dataTypes.length, |
| tmp, |
| // Current and previous dataTypes |
| current = dataTypes[ 0 ], |
| prev, |
| // Conversion expression |
| conversion, |
| // Conversion function |
| conv, |
| // Conversion functions (transitive conversion) |
| conv1, |
| conv2; |
| // For each dataType in the chain |
| for ( i = 1; i < length; i++ ) { |
| // Create converters map |
| // with lowercased keys |
| if ( i === 1 ) { |
| for ( key in s.converters ) { |
| if ( typeof key === "string" ) { |
| converters[ key.toLowerCase() ] = s.converters[ key ]; |
| } |
| } |
| } |
| // Get the dataTypes |
| prev = current; |
| current = dataTypes[ i ]; |
| // If current is auto dataType, update it to prev |
| if ( current === "*" ) { |
| current = prev; |
| // If no auto and dataTypes are actually different |
| } else if ( prev !== "*" && prev !== current ) { |
| // Get the converter |
| conversion = prev + " " + current; |
| conv = converters[ conversion ] || converters[ "* " + current ]; |
| // If there is no direct converter, search transitively |
| if ( !conv ) { |
| conv2 = undefined; |
| for ( conv1 in converters ) { |
| tmp = conv1.split( " " ); |
| if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { |
| conv2 = converters[ tmp[1] + " " + current ]; |
| if ( conv2 ) { |
| conv1 = converters[ conv1 ]; |
| if ( conv1 === true ) { |
| conv = conv2; |
| } else if ( conv2 === true ) { |
| conv = conv1; |
| } |
| break; |
| } |
| } |
| } |
| } |
| // If we found no converter, dispatch an error |
| if ( !( conv || conv2 ) ) { |
| jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); |
| } |
| // If found converter is not an equivalence |
| if ( conv !== true ) { |
| // Convert with 1 or 2 converters accordingly |
| response = conv ? conv( response ) : conv2( conv1(response) ); |
| } |
| } |
| } |
| return response; |
| } |
| var jsc = jQuery.now(), |
| jsre = /(\=)\?(&|$)|\?\?/i; |
| // Default jsonp settings |
| jQuery.ajaxSetup({ |
| jsonp: "callback", |
| jsonpCallback: function() { |
| return jQuery.expando + "_" + ( jsc++ ); |
| } |
| }); |
| // Detect, normalize options and install callbacks for jsonp requests |
| jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { |
| var inspectData = s.contentType === "application/x-www-form-urlencoded" && |
| ( typeof s.data === "string" ); |
| if ( s.dataTypes[ 0 ] === "jsonp" || |
| s.jsonp !== false && ( jsre.test( s.url ) || |
| inspectData && jsre.test( s.data ) ) ) { |
| var responseContainer, |
| jsonpCallback = s.jsonpCallback = |
| jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, |
| previous = window[ jsonpCallback ], |
| url = s.url, |
| data = s.data, |
| replace = "$1" + jsonpCallback + "$2"; |
| if ( s.jsonp !== false ) { |
| url = url.replace( jsre, replace ); |
| if ( s.url === url ) { |
| if ( inspectData ) { |
| data = data.replace( jsre, replace ); |
| } |
| if ( s.data === data ) { |
| // Add callback manually |
| url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; |
| } |
| } |
| } |
| s.url = url; |
| s.data = data; |
| // Install callback |
| window[ jsonpCallback ] = function( response ) { |
| responseContainer = [ response ]; |
| }; |
| // Clean-up function |
| jqXHR.always(function() { |
| // Set callback back to previous value |
| window[ jsonpCallback ] = previous; |
| // Call if it was a function and we have a response |
| if ( responseContainer && jQuery.isFunction( previous ) ) { |
| window[ jsonpCallback ]( responseContainer[ 0 ] ); |
| } |
| }); |
| // Use data converter to retrieve json after script execution |
| s.converters["script json"] = function() { |
| if ( !responseContainer ) { |
| jQuery.error( jsonpCallback + " was not called" ); |
| } |
| return responseContainer[ 0 ]; |
| }; |
| // force json dataType |
| s.dataTypes[ 0 ] = "json"; |
| // Delegate to script |
| return "script"; |
| } |
| }); |
| // Install script dataType |
| jQuery.ajaxSetup({ |
| accepts: { |
| script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" |
| }, |
| contents: { |
| script: /javascript|ecmascript/ |
| }, |
| converters: { |
| "text script": function( text ) { |
| jQuery.globalEval( text ); |
| return text; |
| } |
| } |
| }); |
| // Handle cache's special case and global |
| jQuery.ajaxPrefilter( "script", function( s ) { |
| if ( s.cache === undefined ) { |
| s.cache = false; |
| } |
| if ( s.crossDomain ) { |
| s.type = "GET"; |
| s.global = false; |
| } |
| }); |
| // Bind script tag hack transport |
| jQuery.ajaxTransport( "script", function(s) { |
| // This transport only deals with cross domain requests |
| if ( s.crossDomain ) { |
| var script, |
| head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; |
| return { |
| send: function( _, callback ) { |
| script = document.createElement( "script" ); |
| script.async = "async"; |
| if ( s.scriptCharset ) { |
| script.charset = s.scriptCharset; |
| } |
| script.src = s.url; |
| // Attach handlers for all browsers |
| script.onload = script.onreadystatechange = function( _, isAbort ) { |
| if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { |
| // Handle memory leak in IE |
| script.onload = script.onreadystatechange = null; |
| // Remove the script |
| if ( head && script.parentNode ) { |
| head.removeChild( script ); |
| } |
| // Dereference the script |
| script = undefined; |
| // Callback if not abort |
| if ( !isAbort ) { |
| callback( 200, "success" ); |
| } |
| } |
| }; |
| // Use insertBefore instead of appendChild to circumvent an IE6 bug. |
| // This arises when a base node is used (#2709 and #4378). |
| head.insertBefore( script, head.firstChild ); |
| }, |
| abort: function() { |
| if ( script ) { |
| script.onload( 0, 1 ); |
| } |
| } |
| }; |
| } |
| }); |
| var // #5280: Internet Explorer will keep connections alive if we don't abort on unload |
| xhrOnUnloadAbort = window.ActiveXObject ? function() { |
| // Abort all pending requests |
| for ( var key in xhrCallbacks ) { |
| xhrCallbacks[ key ]( 0, 1 ); |
| } |
| } : false, |
| xhrId = 0, |
| xhrCallbacks; |
| // Functions to create xhrs |
| function createStandardXHR() { |
| try { |
| return new window.XMLHttpRequest(); |
| } catch( e ) {} |
| } |
| function createActiveXHR() { |
| try { |
| return new window.ActiveXObject( "Microsoft.XMLHTTP" ); |
| } catch( e ) {} |
| } |
| // Create the request object |
| // (This is still attached to ajaxSettings for backward compatibility) |
| jQuery.ajaxSettings.xhr = window.ActiveXObject ? |
| /* Microsoft failed to properly |
| * implement the XMLHttpRequest in IE7 (can't request local files), |
| * so we use the ActiveXObject when it is available |
| * Additionally XMLHttpRequest can be disabled in IE7/IE8 so |
| * we need a fallback. |
| */ |
| function() { |
| return !this.isLocal && createStandardXHR() || createActiveXHR(); |
| } : |
| // For all other browsers, use the standard XMLHttpRequest object |
| createStandardXHR; |
| // Determine support properties |
| (function( xhr ) { |
| jQuery.extend( jQuery.support, { |
| ajax: !!xhr, |
| cors: !!xhr && ( "withCredentials" in xhr ) |
| }); |
| })( jQuery.ajaxSettings.xhr() ); |
| // Create transport if the browser can provide an xhr |
| if ( jQuery.support.ajax ) { |
| jQuery.ajaxTransport(function( s ) { |
| // Cross domain only allowed if supported through XMLHttpRequest |
| if ( !s.crossDomain || jQuery.support.cors ) { |
| var callback; |
| return { |
| send: function( headers, complete ) { |
| // Get a new xhr |
| var xhr = s.xhr(), |
| handle, |
| i; |
| // Open the socket |
| // Passing null username, generates a login popup on Opera (#2865) |
| if ( s.username ) { |
| xhr.open( s.type, s.url, s.async, s.username, s.password ); |
| } else { |
| xhr.open( s.type, s.url, s.async ); |
| } |
| // Apply custom fields if provided |
| if ( s.xhrFields ) { |
| for ( i in s.xhrFields ) { |
| xhr[ i ] = s.xhrFields[ i ]; |
| } |
| } |
| // Override mime type if needed |
| if ( s.mimeType && xhr.overrideMimeType ) { |
| xhr.overrideMimeType( s.mimeType ); |
| } |
| // X-Requested-With header |
| // For cross-domain requests, seeing as conditions for a preflight are |
| // akin to a jigsaw puzzle, we simply never set it to be sure. |
| // (it can always be set on a per-request basis or even using ajaxSetup) |
| // For same-domain requests, won't change header if already provided. |
| if ( !s.crossDomain && !headers["X-Requested-With"] ) { |
| headers[ "X-Requested-With" ] = "XMLHttpRequest"; |
| } |
| // Need an extra try/catch for cross domain requests in Firefox 3 |
| try { |
| for ( i in headers ) { |
| xhr.setRequestHeader( i, headers[ i ] ); |
| } |
| } catch( _ ) {} |
| // Do send the request |
| // This may raise an exception which is actually |
| // handled in jQuery.ajax (so no try/catch here) |
| xhr.send( ( s.hasContent && s.data ) || null ); |
| // Listener |
| callback = function( _, isAbort ) { |
| var status, |
| statusText, |
| responseHeaders, |
| responses, |
| xml; |
| // Firefox throws exceptions when accessing properties |
| // of an xhr when a network error occured |
| // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) |
| try { |
| // Was never called and is aborted or complete |
| if ( callback && ( isAbort || xhr.readyState === 4 ) ) { |
| // Only called once |
| callback = undefined; |
| // Do not keep as active anymore |
| if ( handle ) { |
| xhr.onreadystatechange = jQuery.noop; |
| if ( xhrOnUnloadAbort ) { |
| delete xhrCallbacks[ handle ]; |
| } |
| } |
| // If it's an abort |
| if ( isAbort ) { |
| // Abort it manually if needed |
| if ( xhr.readyState !== 4 ) { |
| xhr.abort(); |
| } |
| } else { |
| status = xhr.status; |
| responseHeaders = xhr.getAllResponseHeaders(); |
| responses = {}; |
| xml = xhr.responseXML; |
| // Construct response list |
| if ( xml && xml.documentElement /* #4958 */ ) { |
| responses.xml = xml; |
| } |
| responses.text = xhr.responseText; |
| // Firefox throws an exception when accessing |
| // statusText for faulty cross-domain requests |
| try { |
| statusText = xhr.statusText; |
| } catch( e ) { |
| // We normalize with Webkit giving an empty statusText |
| statusText = ""; |
| } |
| // Filter status for non standard behaviors |
| // If the request is local and we have data: assume a success |
| // (success with no data won't get notified, that's the best we |
| // can do given current implementations) |
| if ( !status && s.isLocal && !s.crossDomain ) { |
| status = responses.text ? 200 : 404; |
| // IE - #1450: sometimes returns 1223 when it should be 204 |
| } else if ( status === 1223 ) { |
| status = 204; |
| } |
| } |
| } |
| } catch( firefoxAccessException ) { |
| if ( !isAbort ) { |
| complete( -1, firefoxAccessException ); |
| } |
| } |
| // Call complete if needed |
| if ( responses ) { |
| complete( status, statusText, responses, responseHeaders ); |
| } |
| }; |
| // if we're in sync mode or it's in cache |
| // and has been retrieved directly (IE6 & IE7) |
| // we need to manually fire the callback |
| if ( !s.async || xhr.readyState === 4 ) { |
| callback(); |
| } else { |
| handle = ++xhrId; |
| if ( xhrOnUnloadAbort ) { |
| // Create the active xhrs callbacks list if needed |
| // and attach the unload handler |
| if ( !xhrCallbacks ) { |
| xhrCallbacks = {}; |
| jQuery( window ).unload( xhrOnUnloadAbort ); |
| } |
| // Add to list of active xhrs callbacks |
| xhrCallbacks[ handle ] = callback; |
| } |
| xhr.onreadystatechange = callback; |
| } |
| }, |
| abort: function() { |
| if ( callback ) { |
| callback(0,1); |
| } |
| } |
| }; |
| } |
| }); |
| } |
| var elemdisplay = {}, |
| iframe, iframeDoc, |
| rfxtypes = /^(?:toggle|show|hide)$/, |
| rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, |
| timerId, |
| fxAttrs = [ |
| // height animations |
| [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], |
| // width animations |
| [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], |
| // opacity animations |
| [ "opacity" ] |
| ], |
| fxNow; |
| jQuery.fn.extend({ |
| show: function( speed, easing, callback ) { |
| var elem, display; |
| if ( speed || speed === 0 ) { |
| return this.animate( genFx("show", 3), speed, easing, callback ); |
| } else { |
| for ( var i = 0, j = this.length; i < j; i++ ) { |
| elem = this[ i ]; |
| if ( elem.style ) { |
| display = elem.style.display; |
| // Reset the inline display of this element to learn if it is |
| // being hidden by cascaded rules or not |
| if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { |
| display = elem.style.display = ""; |
| } |
| // Set elements which have been overridden with display: none |
| // in a stylesheet to whatever the default browser style is |
| // for such an element |
| if ( display === "" && jQuery.css(elem, "display") === "none" ) { |
| jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); |
| } |
| } |
| } |
| // Set the display of most of the elements in a second loop |
| // to avoid the constant reflow |
| for ( i = 0; i < j; i++ ) { |
| elem = this[ i ]; |
| if ( elem.style ) { |
| display = elem.style.display; |
| if ( display === "" || display === "none" ) { |
| elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; |
| } |
| } |
| } |
| return this; |
| } |
| }, |
| hide: function( speed, easing, callback ) { |
| if ( speed || speed === 0 ) { |
| return this.animate( genFx("hide", 3), speed, easing, callback); |
| } else { |
| var elem, display, |
| i = 0, |
| j = this.length; |
| for ( ; i < j; i++ ) { |
| elem = this[i]; |
| if ( elem.style ) { |
| display = jQuery.css( elem, "display" ); |
| if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { |
| jQuery._data( elem, "olddisplay", display ); |
| } |
| } |
| } |
| // Set the display of the elements in a second loop |
| // to avoid the constant reflow |
| for ( i = 0; i < j; i++ ) { |
| if ( this[i].style ) { |
| this[i].style.display = "none"; |
| } |
| } |
| return this; |
| } |
| }, |
| // Save the old toggle function |
| _toggle: jQuery.fn.toggle, |
| toggle: function( fn, fn2, callback ) { |
| var bool = typeof fn === "boolean"; |
| if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { |
| this._toggle.apply( this, arguments ); |
| } else if ( fn == null || bool ) { |
| this.each(function() { |
| var state = bool ? fn : jQuery(this).is(":hidden"); |
| jQuery(this)[ state ? "show" : "hide" ](); |
| }); |
| } else { |
| this.animate(genFx("toggle", 3), fn, fn2, callback); |
| } |
| return this; |
| }, |
| fadeTo: function( speed, to, easing, callback ) { |
| return this.filter(":hidden").css("opacity", 0).show().end() |
| .animate({opacity: to}, speed, easing, callback); |
| }, |
| animate: function( prop, speed, easing, callback ) { |
| var optall = jQuery.speed( speed, easing, callback ); |
| if ( jQuery.isEmptyObject( prop ) ) { |
| return this.each( optall.complete, [ false ] ); |
| } |
| // Do not change referenced properties as per-property easing will be lost |
| prop = jQuery.extend( {}, prop ); |
| function doAnimation() { |
| // XXX 'this' does not always have a nodeName when running the |
| // test suite |
| if ( optall.queue === false ) { |
| jQuery._mark( this ); |
| } |
| var opt = jQuery.extend( {}, optall ), |
| isElement = this.nodeType === 1, |
| hidden = isElement && jQuery(this).is(":hidden"), |
| name, val, p, e, |
| parts, start, end, unit, |
| method; |
| // will store per property easing and be used to determine when an animation is complete |
| opt.animatedProperties = {}; |
| for ( p in prop ) { |
| // property name normalization |
| name = jQuery.camelCase( p ); |
| if ( p !== name ) { |
| prop[ name ] = prop[ p ]; |
| delete prop[ p ]; |
| } |
| val = prop[ name ]; |
| // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) |
| if ( jQuery.isArray( val ) ) { |
| opt.animatedProperties[ name ] = val[ 1 ]; |
| val = prop[ name ] = val[ 0 ]; |
| } else { |
| opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; |
| } |
| if ( val === "hide" && hidden || val === "show" && !hidden ) { |
| return opt.complete.call( this ); |
| } |
| if ( isElement && ( name === "height" || name === "width" ) ) { |
| // Make sure that nothing sneaks out |
| // Record all 3 overflow attributes because IE does not |
| // change the overflow attribute when overflowX and |
| // overflowY are set to the same value |
| opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; |
| // Set display property to inline-block for height/width |
| // animations on inline elements that are having width/height animated |
| if ( jQuery.css( this, "display" ) === "inline" && |
| jQuery.css( this, "float" ) === "none" ) { |
| // inline-level elements accept inline-block; |
| // block-level elements need to be inline with layout |
| if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { |
| this.style.display = "inline-block"; |
| } else { |
| this.style.zoom = 1; |
| } |
| } |
| } |
| } |
| if ( opt.overflow != null ) { |
| this.style.overflow = "hidden"; |
| } |
| for ( p in prop ) { |
| e = new jQuery.fx( this, opt, p ); |
| val = prop[ p ]; |
| if ( rfxtypes.test( val ) ) { |
| // Tracks whether to show or hide based on private |
| // data attached to the element |
| method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); |
| if ( method ) { |
| jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); |
| e[ method ](); |
| } else { |
| e[ val ](); |
| } |
| } else { |
| parts = rfxnum.exec( val ); |
| start = e.cur(); |
| if ( parts ) { |
| end = parseFloat( parts[2] ); |
| unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); |
| // We need to compute starting value |
| if ( unit !== "px" ) { |
| jQuery.style( this, p, (end || 1) + unit); |
| start = ( (end || 1) / e.cur() ) * start; |
| jQuery.style( this, p, start + unit); |
| } |
| // If a +=/-= token was provided, we're doing a relative animation |
| if ( parts[1] ) { |
| end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; |
| } |
| e.custom( start, end, unit ); |
| } else { |
| e.custom( start, val, "" ); |
| } |
| } |
| } |
| // For JS strict compliance |
| return true; |
| } |
| return optall.queue === false ? |
| this.each( doAnimation ) : |
| this.queue( optall.queue, doAnimation ); |
| }, |
| stop: function( type, clearQueue, gotoEnd ) { |
| if ( typeof type !== "string" ) { |
| gotoEnd = clearQueue; |
| clearQueue = type; |
| type = undefined; |
| } |
| if ( clearQueue && type !== false ) { |
| this.queue( type || "fx", [] ); |
| } |
| return this.each(function() { |
| var i, |
| hadTimers = false, |
| timers = jQuery.timers, |
| data = jQuery._data( this ); |
| // clear marker counters if we know they won't be |
| if ( !gotoEnd ) { |
| jQuery._unmark( true, this ); |
| } |
| function stopQueue( elem, data, i ) { |
| var hooks = data[ i ]; |
| jQuery.removeData( elem, i, true ); |
| hooks.stop( gotoEnd ); |
| } |
| if ( type == null ) { |
| for ( i in data ) { |
| if ( data[ i ].stop && i.indexOf(".run") === i.length - 4 ) { |
| stopQueue( this, data, i ); |
| } |
| } |
| } else if ( data[ i = type + ".run" ] && data[ i ].stop ){ |
| stopQueue( this, data, i ); |
| } |
| for ( i = timers.length; i--; ) { |
| if ( timers[ i ].elem === this && (type == null || timers[ i ].queue === type) ) { |
| if ( gotoEnd ) { |
| // force the next step to be the last |
| timers[ i ]( true ); |
| } else { |
| timers[ i ].saveState(); |
| } |
| hadTimers = true; |
| timers.splice( i, 1 ); |
| } |
| } |
| // start the next in the queue if the last step wasn't forced |
| // timers currently will call their complete callbacks, which will dequeue |
| // but only if they were gotoEnd |
| if ( !( gotoEnd && hadTimers ) ) { |
| jQuery.dequeue( this, type ); |
| } |
| }); |
| } |
| }); |
| // Animations created synchronously will run synchronously |
| function createFxNow() { |
| setTimeout( clearFxNow, 0 ); |
| return ( fxNow = jQuery.now() ); |
| } |
| function clearFxNow() { |
| fxNow = undefined; |
| } |
| // Generate parameters to create a standard animation |
| function genFx( type, num ) { |
| var obj = {}; |
| jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { |
| obj[ this ] = type; |
| }); |
| return obj; |
| } |
| // Generate shortcuts for custom animations |
| jQuery.each({ |
| slideDown: genFx( "show", 1 ), |
| slideUp: genFx( "hide", 1 ), |
| slideToggle: genFx( "toggle", 1 ), |
| fadeIn: { opacity: "show" }, |
| fadeOut: { opacity: "hide" }, |
| fadeToggle: { opacity: "toggle" } |
| }, function( name, props ) { |
| jQuery.fn[ name ] = function( speed, easing, callback ) { |
| return this.animate( props, speed, easing, callback ); |
| }; |
| }); |
| jQuery.extend({ |
| speed: function( speed, easing, fn ) { |
| var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { |
| complete: fn || !fn && easing || |
| jQuery.isFunction( speed ) && speed, |
| duration: speed, |
| easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing |
| }; |
| opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : |
| opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; |
| // normalize opt.queue - true/undefined/null -> "fx" |
| if ( opt.queue == null || opt.queue === true ) { |
| opt.queue = "fx"; |
| } |
| // Queueing |
| opt.old = opt.complete; |
| opt.complete = function( noUnmark ) { |
| if ( jQuery.isFunction( opt.old ) ) { |
| opt.old.call( this ); |
| } |
| if ( opt.queue ) { |
| jQuery.dequeue( this, opt.queue ); |
| } else if ( noUnmark !== false ) { |
| jQuery._unmark( this ); |
| } |
| }; |
| return opt; |
| }, |
| easing: { |
| linear: function( p, n, firstNum, diff ) { |
| return firstNum + diff * p; |
| }, |
| swing: function( p, n, firstNum, diff ) { |
| return ( ( -Math.cos( p*Math.PI ) / 2 ) + 0.5 ) * diff + firstNum; |
| } |
| }, |
| timers: [], |
| fx: function( elem, options, prop ) { |
| this.options = options; |
| this.elem = elem; |
| this.prop = prop; |
| options.orig = options.orig || {}; |
| } |
| }); |
| jQuery.fx.prototype = { |
| // Simple function for setting a style value |
| update: function() { |
| if ( this.options.step ) { |
| this.options.step.call( this.elem, this.now, this ); |
| } |
| ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); |
| }, |
| // Get the current size |
| cur: function() { |
| if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { |
| return this.elem[ this.prop ]; |
| } |
| var parsed, |
| r = jQuery.css( this.elem, this.prop ); |
| // Empty strings, null, undefined and "auto" are converted to 0, |
| // complex values such as "rotate(1rad)" are returned as is, |
| // simple values such as "10px" are parsed to Float. |
| return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; |
| }, |
| // Start an animation from one number to another |
| custom: function( from, to, unit ) { |
| var self = this, |
| fx = jQuery.fx; |
| this.startTime = fxNow || createFxNow(); |
| this.end = to; |
| this.now = this.start = from; |
| this.pos = this.state = 0; |
| this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); |
| function t( gotoEnd ) { |
| return self.step( gotoEnd ); |
| } |
| t.queue = this.options.queue; |
| t.elem = this.elem; |
| t.saveState = function() { |
| if ( self.options.hide && jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { |
| jQuery._data( self.elem, "fxshow" + self.prop, self.start ); |
| } |
| }; |
| if ( t() && jQuery.timers.push(t) && !timerId ) { |
| timerId = setInterval( fx.tick, fx.interval ); |
| } |
| }, |
| // Simple 'show' function |
| show: function() { |
| var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); |
| // Remember where we started, so that we can go back to it later |
| this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); |
| this.options.show = true; |
| // Begin the animation |
| // Make sure that we start at a small width/height to avoid any flash of content |
| if ( dataShow !== undefined ) { |
| // This show is picking up where a previous hide or show left off |
| this.custom( this.cur(), dataShow ); |
| } else { |
| this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); |
| } |
| // Start by showing the element |
| jQuery( this.elem ).show(); |
| }, |
| // Simple 'hide' function |
| hide: function() { |
| // Remember where we started, so that we can go back to it later |
| this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); |
| this.options.hide = true; |
| // Begin the animation |
| this.custom( this.cur(), 0 ); |
| }, |
| // Each step of an animation |
| step: function( gotoEnd ) { |
| var p, n, complete, |
| t = fxNow || createFxNow(), |
| done = true, |
| elem = this.elem, |
| options = this.options; |
| if ( gotoEnd || t >= options.duration + this.startTime ) { |
| this.now = this.end; |
| this.pos = this.state = 1; |
| this.update(); |
| options.animatedProperties[ this.prop ] = true; |
| for ( p in options.animatedProperties ) { |
| if ( options.animatedProperties[ p ] !== true ) { |
| done = false; |
| } |
| } |
| if ( done ) { |
| // Reset the overflow |
| if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { |
| jQuery.each( [ "", "X", "Y" ], function( index, value ) { |
| elem.style[ "overflow" + value ] = options.overflow[ index ]; |
| }); |
| } |
| // Hide the element if the "hide" operation was done |
| if ( options.hide ) { |
| jQuery( elem ).hide(); |
| } |
| // Reset the properties, if the item has been hidden or shown |
| if ( options.hide || options.show ) { |
| for ( p in options.animatedProperties ) { |
| jQuery.style( elem, p, options.orig[ p ] ); |
| jQuery.removeData( elem, "fxshow" + p, true ); |
| // Toggle data is no longer needed |
| jQuery.removeData( elem, "toggle" + p, true ); |
| } |
| } |
| // Execute the complete function |
| // in the event that the complete function throws an exception |
| // we must ensure it won't be called twice. #5684 |
| complete = options.complete; |
| if ( complete ) { |
| options.complete = false; |
| complete.call( elem ); |
| } |
| } |
| return false; |
| } else { |
| // classical easing cannot be used with an Infinity duration |
| if ( options.duration == Infinity ) { |
| this.now = t; |
| } else { |
| n = t - this.startTime; |
| this.state = n / options.duration; |
| // Perform the easing function, defaults to swing |
| this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); |
| this.now = this.start + ( (this.end - this.start) * this.pos ); |
| } |
| // Perform the next step of the animation |
| this.update(); |
| } |
| return true; |
| } |
| }; |
| jQuery.extend( jQuery.fx, { |
| tick: function() { |
| var timer, |
| timers = jQuery.timers, |
| i = 0; |
| for ( ; i < timers.length; i++ ) { |
| timer = timers[ i ]; |
| // Checks the timer has not already been removed |
| if ( !timer() && timers[ i ] === timer ) { |
| timers.splice( i--, 1 ); |
| } |
| } |
| if ( !timers.length ) { |
| jQuery.fx.stop(); |
| } |
| }, |
| interval: 13, |
| stop: function() { |
| clearInterval( timerId ); |
| timerId = null; |
| }, |
| speeds: { |
| slow: 600, |
| fast: 200, |
| // Default speed |
| _default: 400 |
| }, |
| step: { |
| opacity: function( fx ) { |
| jQuery.style( fx.elem, "opacity", fx.now ); |
| }, |
| _default: function( fx ) { |
| if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { |
| fx.elem.style[ fx.prop ] = fx.now + fx.unit; |
| } else { |
| fx.elem[ fx.prop ] = fx.now; |
| } |
| } |
| } |
| }); |
| // Adds width/height step functions |
| // Do not set anything below 0 |
| jQuery.each([ "width", "height" ], function( i, prop ) { |
| jQuery.fx.step[ prop ] = function( fx ) { |
| jQuery.style( fx.elem, prop, Math.max(0, fx.now) ); |
| }; |
| }); |
| if ( jQuery.expr && jQuery.expr.filters ) { |
| jQuery.expr.filters.animated = function( elem ) { |
| return jQuery.grep(jQuery.timers, function( fn ) { |
| return elem === fn.elem; |
| }).length; |
| }; |
| } |
| // Try to restore the default display value of an element |
| function defaultDisplay( nodeName ) { |
| if ( !elemdisplay[ nodeName ] ) { |
| var body = document.body, |
| elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), |
| display = elem.css( "display" ); |
| elem.remove(); |
| // If the simple way fails, |
| // get element's real default display by attaching it to a temp iframe |
| if ( display === "none" || display === "" ) { |
| // No iframe to use yet, so create it |
| if ( !iframe ) { |
| iframe = document.createElement( "iframe" ); |
| iframe.frameBorder = iframe.width = iframe.height = 0; |
| } |
| body.appendChild( iframe ); |
| // Create a cacheable copy of the iframe document on first call. |
| // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML |
| // document to it; WebKit & Firefox won't allow reusing the iframe document. |
| if ( !iframeDoc || !iframe.createElement ) { |
| iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; |
| iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); |
| iframeDoc.close(); |
| } |
| elem = iframeDoc.createElement( nodeName ); |
| iframeDoc.body.appendChild( elem ); |
| display = jQuery.css( elem, "display" ); |
| body.removeChild( iframe ); |
| } |
| // Store the correct default display |
| elemdisplay[ nodeName ] = display; |
| } |
| return elemdisplay[ nodeName ]; |
| } |
| var rtable = /^t(?:able|d|h)$/i, |
| rroot = /^(?:body|html)$/i; |
| if ( "getBoundingClientRect" in document.documentElement ) { |
| jQuery.fn.offset = function( options ) { |
| var elem = this[0], box; |
| if ( options ) { |
| return this.each(function( i ) { |
| jQuery.offset.setOffset( this, options, i ); |
| }); |
| } |
| if ( !elem || !elem.ownerDocument ) { |
| return null; |
| } |
| if ( elem === elem.ownerDocument.body ) { |
| return jQuery.offset.bodyOffset( elem ); |
| } |
| try { |
| box = elem.getBoundingClientRect(); |
| } catch(e) {} |
| var doc = elem.ownerDocument, |
| docElem = doc.documentElement; |
| // Make sure we're not dealing with a disconnected DOM node |
| if ( !box || !jQuery.contains( docElem, elem ) ) { |
| return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; |
| } |
| var body = doc.body, |
| win = getWindow(doc), |
| clientTop = docElem.clientTop || body.clientTop || 0, |
| clientLeft = docElem.clientLeft || body.clientLeft || 0, |
| scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, |
| scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, |
| top = box.top + scrollTop - clientTop, |
| left = box.left + scrollLeft - clientLeft; |
| return { top: top, left: left }; |
| }; |
| } else { |
| jQuery.fn.offset = function( options ) { |
| var elem = this[0]; |
| if ( options ) { |
| return this.each(function( i ) { |
| jQuery.offset.setOffset( this, options, i ); |
| }); |
| } |
| if ( !elem || !elem.ownerDocument ) { |
| return null; |
| } |
| if ( elem === elem.ownerDocument.body ) { |
| return jQuery.offset.bodyOffset( elem ); |
| } |
| var computedStyle, |
| offsetParent = elem.offsetParent, |
| prevOffsetParent = elem, |
| doc = elem.ownerDocument, |
| docElem = doc.documentElement, |
| body = doc.body, |
| defaultView = doc.defaultView, |
| prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, |
| top = elem.offsetTop, |
| left = elem.offsetLeft; |
| while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { |
| if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { |
| break; |
| } |
| computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; |
| top -= elem.scrollTop; |
| left -= elem.scrollLeft; |
| if ( elem === offsetParent ) { |
| top += elem.offsetTop; |
| left += elem.offsetLeft; |
| if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { |
| top += parseFloat( computedStyle.borderTopWidth ) || 0; |
| left += parseFloat( computedStyle.borderLeftWidth ) || 0; |
| } |
| prevOffsetParent = offsetParent; |
| offsetParent = elem.offsetParent; |
| } |
| if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { |
| top += parseFloat( computedStyle.borderTopWidth ) || 0; |
| left += parseFloat( computedStyle.borderLeftWidth ) || 0; |
| } |
| prevComputedStyle = computedStyle; |
| } |
| if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { |
| top += body.offsetTop; |
| left += body.offsetLeft; |
| } |
| if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { |
| top += Math.max( docElem.scrollTop, body.scrollTop ); |
| left += Math.max( docElem.scrollLeft, body.scrollLeft ); |
| } |
| return { top: top, left: left }; |
| }; |
| } |
| jQuery.offset = { |
| bodyOffset: function( body ) { |
| var top = body.offsetTop, |
| left = body.offsetLeft; |
| if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { |
| top += parseFloat( jQuery.css(body, "marginTop") ) || 0; |
| left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; |
| } |
| return { top: top, left: left }; |
| }, |
| setOffset: function( elem, options, i ) { |
| var position = jQuery.css( elem, "position" ); |
| // set position first, in-case top/left are set even on static elem |
| if ( position === "static" ) { |
| elem.style.position = "relative"; |
| } |
| var curElem = jQuery( elem ), |
| curOffset = curElem.offset(), |
| curCSSTop = jQuery.css( elem, "top" ), |
| curCSSLeft = jQuery.css( elem, "left" ), |
| calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, |
| props = {}, curPosition = {}, curTop, curLeft; |
| // need to be able to calculate position if either top or left is auto and position is either absolute or fixed |
| if ( calculatePosition ) { |
| curPosition = curElem.position(); |
| curTop = curPosition.top; |
| curLeft = curPosition.left; |
| } else { |
| curTop = parseFloat( curCSSTop ) || 0; |
| curLeft = parseFloat( curCSSLeft ) || 0; |
| } |
| if ( jQuery.isFunction( options ) ) { |
| options = options.call( elem, i, curOffset ); |
| } |
| if ( options.top != null ) { |
| props.top = ( options.top - curOffset.top ) + curTop; |
| } |
| if ( options.left != null ) { |
| props.left = ( options.left - curOffset.left ) + curLeft; |
| } |
| if ( "using" in options ) { |
| options.using.call( elem, props ); |
| } else { |
| curElem.css( props ); |
| } |
| } |
| }; |
| jQuery.fn.extend({ |
| position: function() { |
| if ( !this[0] ) { |
| return null; |
| } |
| var elem = this[0], |
| // Get *real* offsetParent |
| offsetParent = this.offsetParent(), |
| // Get correct offsets |
| offset = this.offset(), |
| parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); |
| // Subtract element margins |
| // note: when an element has margin: auto the offsetLeft and marginLeft |
| // are the same in Safari causing offset.left to incorrectly be 0 |
| offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; |
| offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; |
| // Add offsetParent borders |
| parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; |
| parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; |
| // Subtract the two offsets |
| return { |
| top: offset.top - parentOffset.top, |
| left: offset.left - parentOffset.left |
| }; |
| }, |
| offsetParent: function() { |
| return this.map(function() { |
| var offsetParent = this.offsetParent || document.body; |
| while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { |
| offsetParent = offsetParent.offsetParent; |
| } |
| return offsetParent; |
| }); |
| } |
| }); |
| // Create scrollLeft and scrollTop methods |
| jQuery.each( ["Left", "Top"], function( i, name ) { |
| var method = "scroll" + name; |
| jQuery.fn[ method ] = function( val ) { |
| var elem, win; |
| if ( val === undefined ) { |
| elem = this[ 0 ]; |
| if ( !elem ) { |
| return null; |
| } |
| win = getWindow( elem ); |
| // Return the scroll offset |
| return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : |
| jQuery.support.boxModel && win.document.documentElement[ method ] || |
| win.document.body[ method ] : |
| elem[ method ]; |
| } |
| // Set the scroll offset |
| return this.each(function() { |
| win = getWindow( this ); |
| if ( win ) { |
| win.scrollTo( |
| !i ? val : jQuery( win ).scrollLeft(), |
| i ? val : jQuery( win ).scrollTop() |
| ); |
| } else { |
| this[ method ] = val; |
| } |
| }); |
| }; |
| }); |
| function getWindow( elem ) { |
| return jQuery.isWindow( elem ) ? |
| elem : |
| elem.nodeType === 9 ? |
| elem.defaultView || elem.parentWindow : |
| false; |
| } |
| // Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods |
| jQuery.each([ "Height", "Width" ], function( i, name ) { |
| var type = name.toLowerCase(); |
| // innerHeight and innerWidth |
| jQuery.fn[ "inner" + name ] = function() { |
| var elem = this[0]; |
| return elem ? |
| elem.style ? |
| parseFloat( jQuery.css( elem, type, "padding" ) ) : |
| this[ type ]() : |
| null; |
| }; |
| // outerHeight and outerWidth |
| jQuery.fn[ "outer" + name ] = function( margin ) { |
| var elem = this[0]; |
| return elem ? |
| elem.style ? |
| parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : |
| this[ type ]() : |
| null; |
| }; |
| jQuery.fn[ type ] = function( size ) { |
| // Get window width or height |
| var elem = this[0]; |
| if ( !elem ) { |
| return size == null ? null : this; |
| } |
| if ( jQuery.isFunction( size ) ) { |
| return this.each(function( i ) { |
| var self = jQuery( this ); |
| self[ type ]( size.call( this, i, self[ type ]() ) ); |
| }); |
| } |
| if ( jQuery.isWindow( elem ) ) { |
| // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode |
| // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat |
| var docElemProp = elem.document.documentElement[ "client" + name ], |
| body = elem.document.body; |
| return elem.document.compatMode === "CSS1Compat" && docElemProp || |
| body && body[ "client" + name ] || docElemProp; |
| // Get document width or height |
| } else if ( elem.nodeType === 9 ) { |
| // Either scroll[Width/Height] or offset[Width/Height], whichever is greater |
| return Math.max( |
| elem.documentElement["client" + name], |
| elem.body["scroll" + name], elem.documentElement["scroll" + name], |
| elem.body["offset" + name], elem.documentElement["offset" + name] |
| ); |
| // Get or set width or height on the element |
| } else if ( size === undefined ) { |
| var orig = jQuery.css( elem, type ), |
| ret = parseFloat( orig ); |
| return jQuery.isNumeric( ret ) ? ret : orig; |
| // Set the width or height on the element (default to pixels if value is unitless) |
| } else { |
| return this.css( type, typeof size === "string" ? size : size + "px" ); |
| } |
| }; |
| }); |
| // Expose jQuery to the global object |
| window.jQuery = window.$ = jQuery; |
| })( window ); |
| Property changes: |
| Added: svn:executable |
| +* |
| \ No newline at end of property |
| /trunk/presentations/scripts/jquery.fancybox-1.3.4.pack.js |
|---|
| New file |
| 0,0 → 1,46 |
| /* |
| * FancyBox - jQuery Plugin |
| * Simple and fancy lightbox alternative |
| * |
| * Examples and documentation at: http://fancybox.net |
| * |
| * Copyright (c) 2008 - 2010 Janis Skarnelis |
| * That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated. |
| * |
| * Version: 1.3.4 (11/11/2010) |
| * Requires: jQuery v1.3+ |
| * |
| * Dual licensed under the MIT and GPL licenses: |
| * http://www.opensource.org/licenses/mit-license.php |
| * http://www.gnu.org/licenses/gpl.html |
| */ |
| ;(function(b){var m,t,u,f,D,j,E,n,z,A,q=0,e={},o=[],p=0,d={},l=[],G=null,v=new Image,J=/\.(jpg|gif|png|bmp|jpeg)(.*)?$/i,W=/[^\.]\.(swf)\s*$/i,K,L=1,y=0,s="",r,i,h=false,B=b.extend(b("<div/>")[0],{prop:0}),M=b.browser.msie&&b.browser.version<7&&!window.XMLHttpRequest,N=function(){t.hide();v.onerror=v.onload=null;G&&G.abort();m.empty()},O=function(){if(false===e.onError(o,q,e)){t.hide();h=false}else{e.titleShow=false;e.width="auto";e.height="auto";m.html('<p id="fancybox-error">The requested content cannot be loaded.<br />Please try again later.</p>'); |
| F()}},I=function(){var a=o[q],c,g,k,C,P,w;N();e=b.extend({},b.fn.fancybox.defaults,typeof b(a).data("fancybox")=="undefined"?e:b(a).data("fancybox"));w=e.onStart(o,q,e);if(w===false)h=false;else{if(typeof w=="object")e=b.extend(e,w);k=e.title||(a.nodeName?b(a).attr("title"):a.title)||"";if(a.nodeName&&!e.orig)e.orig=b(a).children("img:first").length?b(a).children("img:first"):b(a);if(k===""&&e.orig&&e.titleFromAlt)k=e.orig.attr("alt");c=e.href||(a.nodeName?b(a).attr("href"):a.href)||null;if(/^(?:javascript)/i.test(c)|| |
| c=="#")c=null;if(e.type){g=e.type;if(!c)c=e.content}else if(e.content)g="html";else if(c)g=c.match(J)?"image":c.match(W)?"swf":b(a).hasClass("iframe")?"iframe":c.indexOf("#")===0?"inline":"ajax";if(g){if(g=="inline"){a=c.substr(c.indexOf("#"));g=b(a).length>0?"inline":"ajax"}e.type=g;e.href=c;e.title=k;if(e.autoDimensions)if(e.type=="html"||e.type=="inline"||e.type=="ajax"){e.width="auto";e.height="auto"}else e.autoDimensions=false;if(e.modal){e.overlayShow=true;e.hideOnOverlayClick=false;e.hideOnContentClick= |
| false;e.enableEscapeButton=false;e.showCloseButton=false}e.padding=parseInt(e.padding,10);e.margin=parseInt(e.margin,10);m.css("padding",e.padding+e.margin);b(".fancybox-inline-tmp").unbind("fancybox-cancel").bind("fancybox-change",function(){b(this).replaceWith(j.children())});switch(g){case "html":m.html(e.content);F();break;case "inline":if(b(a).parent().is("#fancybox-content")===true){h=false;break}b('<div class="fancybox-inline-tmp" />').hide().insertBefore(b(a)).bind("fancybox-cleanup",function(){b(this).replaceWith(j.children())}).bind("fancybox-cancel", |
| function(){b(this).replaceWith(m.children())});b(a).appendTo(m);F();break;case "image":h=false;b.fancybox.showActivity();v=new Image;v.onerror=function(){O()};v.onload=function(){h=true;v.onerror=v.onload=null;e.width=v.width;e.height=v.height;b("<img />").attr({id:"fancybox-img",src:v.src,alt:e.title}).appendTo(m);Q()};v.src=c;break;case "swf":e.scrolling="no";C='<object classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="'+e.width+'" height="'+e.height+'"><param name="movie" value="'+c+ |
| '"></param>';P="";b.each(e.swf,function(x,H){C+='<param name="'+x+'" value="'+H+'"></param>';P+=" "+x+'="'+H+'"'});C+='<embed src="'+c+'" type="application/x-shockwave-flash" width="'+e.width+'" height="'+e.height+'"'+P+"></embed></object>";m.html(C);F();break;case "ajax":h=false;b.fancybox.showActivity();e.ajax.win=e.ajax.success;G=b.ajax(b.extend({},e.ajax,{url:c,data:e.ajax.data||{},error:function(x){x.status>0&&O()},success:function(x,H,R){if((typeof R=="object"?R:G).status==200){if(typeof e.ajax.win== |
| "function"){w=e.ajax.win(c,x,H,R);if(w===false){t.hide();return}else if(typeof w=="string"||typeof w=="object")x=w}m.html(x);F()}}}));break;case "iframe":Q()}}else O()}},F=function(){var a=e.width,c=e.height;a=a.toString().indexOf("%")>-1?parseInt((b(window).width()-e.margin*2)*parseFloat(a)/100,10)+"px":a=="auto"?"auto":a+"px";c=c.toString().indexOf("%")>-1?parseInt((b(window).height()-e.margin*2)*parseFloat(c)/100,10)+"px":c=="auto"?"auto":c+"px";m.wrapInner('<div style="width:'+a+";height:"+c+ |
| ";overflow: "+(e.scrolling=="auto"?"auto":e.scrolling=="yes"?"scroll":"hidden")+';position:relative;"></div>');e.width=m.width();e.height=m.height();Q()},Q=function(){var a,c;t.hide();if(f.is(":visible")&&false===d.onCleanup(l,p,d)){b.event.trigger("fancybox-cancel");h=false}else{h=true;b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");f.is(":visible")&&d.titlePosition!=="outside"&&f.css("height",f.height());l=o;p=q;d=e;if(d.overlayShow){u.css({"background-color":d.overlayColor, |
| opacity:d.overlayOpacity,cursor:d.hideOnOverlayClick?"pointer":"auto",height:b(document).height()});if(!u.is(":visible")){M&&b("select:not(#fancybox-tmp select)").filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one("fancybox-cleanup",function(){this.style.visibility="inherit"});u.show()}}else u.hide();i=X();s=d.title||"";y=0;n.empty().removeAttr("style").removeClass();if(d.titleShow!==false){if(b.isFunction(d.titleFormat))a=d.titleFormat(s,l,p,d);else a=s&&s.length? |
| d.titlePosition=="float"?'<table id="fancybox-title-float-wrap" cellpadding="0" cellspacing="0"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">'+s+'</td><td id="fancybox-title-float-right"></td></tr></table>':'<div id="fancybox-title-'+d.titlePosition+'">'+s+"</div>":false;s=a;if(!(!s||s==="")){n.addClass("fancybox-title-"+d.titlePosition).html(s).appendTo("body").show();switch(d.titlePosition){case "inside":n.css({width:i.width-d.padding*2,marginLeft:d.padding,marginRight:d.padding}); |
| y=n.outerHeight(true);n.appendTo(D);i.height+=y;break;case "over":n.css({marginLeft:d.padding,width:i.width-d.padding*2,bottom:d.padding}).appendTo(D);break;case "float":n.css("left",parseInt((n.width()-i.width-40)/2,10)*-1).appendTo(f);break;default:n.css({width:i.width-d.padding*2,paddingLeft:d.padding,paddingRight:d.padding}).appendTo(f)}}}n.hide();if(f.is(":visible")){b(E.add(z).add(A)).hide();a=f.position();r={top:a.top,left:a.left,width:f.width(),height:f.height()};c=r.width==i.width&&r.height== |
| i.height;j.fadeTo(d.changeFade,0.3,function(){var g=function(){j.html(m.contents()).fadeTo(d.changeFade,1,S)};b.event.trigger("fancybox-change");j.empty().removeAttr("filter").css({"border-width":d.padding,width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2});if(c)g();else{B.prop=0;b(B).animate({prop:1},{duration:d.changeSpeed,easing:d.easingChange,step:T,complete:g})}})}else{f.removeAttr("style");j.css("border-width",d.padding);if(d.transitionIn=="elastic"){r=V();j.html(m.contents()); |
| f.show();if(d.opacity)i.opacity=0;B.prop=0;b(B).animate({prop:1},{duration:d.speedIn,easing:d.easingIn,step:T,complete:S})}else{d.titlePosition=="inside"&&y>0&&n.show();j.css({width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2}).html(m.contents());f.css(i).fadeIn(d.transitionIn=="none"?0:d.speedIn,S)}}}},Y=function(){if(d.enableEscapeButton||d.enableKeyboardNav)b(document).bind("keydown.fb",function(a){if(a.keyCode==27&&d.enableEscapeButton){a.preventDefault();b.fancybox.close()}else if((a.keyCode== |
| 37||a.keyCode==39)&&d.enableKeyboardNav&&a.target.tagName!=="INPUT"&&a.target.tagName!=="TEXTAREA"&&a.target.tagName!=="SELECT"){a.preventDefault();b.fancybox[a.keyCode==37?"prev":"next"]()}});if(d.showNavArrows){if(d.cyclic&&l.length>1||p!==0)z.show();if(d.cyclic&&l.length>1||p!=l.length-1)A.show()}else{z.hide();A.hide()}},S=function(){if(!b.support.opacity){j.get(0).style.removeAttribute("filter");f.get(0).style.removeAttribute("filter")}e.autoDimensions&&j.css("height","auto");f.css("height","auto"); |
| s&&s.length&&n.show();d.showCloseButton&&E.show();Y();d.hideOnContentClick&&j.bind("click",b.fancybox.close);d.hideOnOverlayClick&&u.bind("click",b.fancybox.close);b(window).bind("resize.fb",b.fancybox.resize);d.centerOnScroll&&b(window).bind("scroll.fb",b.fancybox.center);if(d.type=="iframe")b('<iframe id="fancybox-frame" name="fancybox-frame'+(new Date).getTime()+'" frameborder="0" hspace="0" '+(b.browser.msie?'allowtransparency="true""':"")+' scrolling="'+e.scrolling+'" src="'+d.href+'"></iframe>').appendTo(j); |
| f.show();h=false;b.fancybox.center();d.onComplete(l,p,d);var a,c;if(l.length-1>p){a=l[p+1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}if(p>0){a=l[p-1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}},T=function(a){var c={width:parseInt(r.width+(i.width-r.width)*a,10),height:parseInt(r.height+(i.height-r.height)*a,10),top:parseInt(r.top+(i.top-r.top)*a,10),left:parseInt(r.left+(i.left-r.left)*a,10)};if(typeof i.opacity!=="undefined")c.opacity=a<0.5?0.5:a;f.css(c); |
| j.css({width:c.width-d.padding*2,height:c.height-y*a-d.padding*2})},U=function(){return[b(window).width()-d.margin*2,b(window).height()-d.margin*2,b(document).scrollLeft()+d.margin,b(document).scrollTop()+d.margin]},X=function(){var a=U(),c={},g=d.autoScale,k=d.padding*2;c.width=d.width.toString().indexOf("%")>-1?parseInt(a[0]*parseFloat(d.width)/100,10):d.width+k;c.height=d.height.toString().indexOf("%")>-1?parseInt(a[1]*parseFloat(d.height)/100,10):d.height+k;if(g&&(c.width>a[0]||c.height>a[1]))if(e.type== |
| "image"||e.type=="swf"){g=d.width/d.height;if(c.width>a[0]){c.width=a[0];c.height=parseInt((c.width-k)/g+k,10)}if(c.height>a[1]){c.height=a[1];c.width=parseInt((c.height-k)*g+k,10)}}else{c.width=Math.min(c.width,a[0]);c.height=Math.min(c.height,a[1])}c.top=parseInt(Math.max(a[3]-20,a[3]+(a[1]-c.height-40)*0.5),10);c.left=parseInt(Math.max(a[2]-20,a[2]+(a[0]-c.width-40)*0.5),10);return c},V=function(){var a=e.orig?b(e.orig):false,c={};if(a&&a.length){c=a.offset();c.top+=parseInt(a.css("paddingTop"), |
| 10)||0;c.left+=parseInt(a.css("paddingLeft"),10)||0;c.top+=parseInt(a.css("border-top-width"),10)||0;c.left+=parseInt(a.css("border-left-width"),10)||0;c.width=a.width();c.height=a.height();c={width:c.width+d.padding*2,height:c.height+d.padding*2,top:c.top-d.padding-20,left:c.left-d.padding-20}}else{a=U();c={width:d.padding*2,height:d.padding*2,top:parseInt(a[3]+a[1]*0.5,10),left:parseInt(a[2]+a[0]*0.5,10)}}return c},Z=function(){if(t.is(":visible")){b("div",t).css("top",L*-40+"px");L=(L+1)%12}else clearInterval(K)}; |
| b.fn.fancybox=function(a){if(!b(this).length)return this;b(this).data("fancybox",b.extend({},a,b.metadata?b(this).metadata():{})).unbind("click.fb").bind("click.fb",function(c){c.preventDefault();if(!h){h=true;b(this).blur();o=[];q=0;c=b(this).attr("rel")||"";if(!c||c==""||c==="nofollow")o.push(this);else{o=b("a[rel="+c+"], area[rel="+c+"]");q=o.index(this)}I()}});return this};b.fancybox=function(a,c){var g;if(!h){h=true;g=typeof c!=="undefined"?c:{};o=[];q=parseInt(g.index,10)||0;if(b.isArray(a)){for(var k= |
| 0,C=a.length;k<C;k++)if(typeof a[k]=="object")b(a[k]).data("fancybox",b.extend({},g,a[k]));else a[k]=b({}).data("fancybox",b.extend({content:a[k]},g));o=jQuery.merge(o,a)}else{if(typeof a=="object")b(a).data("fancybox",b.extend({},g,a));else a=b({}).data("fancybox",b.extend({content:a},g));o.push(a)}if(q>o.length||q<0)q=0;I()}};b.fancybox.showActivity=function(){clearInterval(K);t.show();K=setInterval(Z,66)};b.fancybox.hideActivity=function(){t.hide()};b.fancybox.next=function(){return b.fancybox.pos(p+ |
| 1)};b.fancybox.prev=function(){return b.fancybox.pos(p-1)};b.fancybox.pos=function(a){if(!h){a=parseInt(a);o=l;if(a>-1&&a<l.length){q=a;I()}else if(d.cyclic&&l.length>1){q=a>=l.length?0:l.length-1;I()}}};b.fancybox.cancel=function(){if(!h){h=true;b.event.trigger("fancybox-cancel");N();e.onCancel(o,q,e);h=false}};b.fancybox.close=function(){function a(){u.fadeOut("fast");n.empty().hide();f.hide();b.event.trigger("fancybox-cleanup");j.empty();d.onClosed(l,p,d);l=e=[];p=q=0;d=e={};h=false}if(!(h||f.is(":hidden"))){h= |
| true;if(d&&false===d.onCleanup(l,p,d))h=false;else{N();b(E.add(z).add(A)).hide();b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");j.find("iframe").attr("src",M&&/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank");d.titlePosition!=="inside"&&n.empty();f.stop();if(d.transitionOut=="elastic"){r=V();var c=f.position();i={top:c.top,left:c.left,width:f.width(),height:f.height()};if(d.opacity)i.opacity=1;n.empty().hide();B.prop=1; |
| b(B).animate({prop:0},{duration:d.speedOut,easing:d.easingOut,step:T,complete:a})}else f.fadeOut(d.transitionOut=="none"?0:d.speedOut,a)}}};b.fancybox.resize=function(){u.is(":visible")&&u.css("height",b(document).height());b.fancybox.center(true)};b.fancybox.center=function(a){var c,g;if(!h){g=a===true?1:0;c=U();!g&&(f.width()>c[0]||f.height()>c[1])||f.stop().animate({top:parseInt(Math.max(c[3]-20,c[3]+(c[1]-j.height()-40)*0.5-d.padding)),left:parseInt(Math.max(c[2]-20,c[2]+(c[0]-j.width()-40)*0.5- |
| d.padding))},typeof a=="number"?a:200)}};b.fancybox.init=function(){if(!b("#fancybox-wrap").length){b("body").append(m=b('<div id="fancybox-tmp"></div>'),t=b('<div id="fancybox-loading"><div></div></div>'),u=b('<div id="fancybox-overlay"></div>'),f=b('<div id="fancybox-wrap"></div>'));D=b('<div id="fancybox-outer"></div>').append('<div class="fancybox-bg" id="fancybox-bg-n"></div><div class="fancybox-bg" id="fancybox-bg-ne"></div><div class="fancybox-bg" id="fancybox-bg-e"></div><div class="fancybox-bg" id="fancybox-bg-se"></div><div class="fancybox-bg" id="fancybox-bg-s"></div><div class="fancybox-bg" id="fancybox-bg-sw"></div><div class="fancybox-bg" id="fancybox-bg-w"></div><div class="fancybox-bg" id="fancybox-bg-nw"></div>').appendTo(f); |
| D.append(j=b('<div id="fancybox-content"></div>'),E=b('<a id="fancybox-close"></a>'),n=b('<div id="fancybox-title"></div>'),z=b('<a href="javascript:;" id="fancybox-left"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),A=b('<a href="javascript:;" id="fancybox-right"><span class="fancy-ico" id="fancybox-right-ico"></span></a>'));E.click(b.fancybox.close);t.click(b.fancybox.cancel);z.click(function(a){a.preventDefault();b.fancybox.prev()});A.click(function(a){a.preventDefault();b.fancybox.next()}); |
| b.fn.mousewheel&&f.bind("mousewheel.fb",function(a,c){if(h)a.preventDefault();else if(b(a.target).get(0).clientHeight==0||b(a.target).get(0).scrollHeight===b(a.target).get(0).clientHeight){a.preventDefault();b.fancybox[c>0?"prev":"next"]()}});b.support.opacity||f.addClass("fancybox-ie");if(M){t.addClass("fancybox-ie6");f.addClass("fancybox-ie6");b('<iframe id="fancybox-hide-sel-frame" src="'+(/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank")+'" scrolling="no" border="0" frameborder="0" tabindex="-1"></iframe>').prependTo(D)}}}; |
| b.fn.fancybox.defaults={padding:10,margin:40,opacity:false,modal:false,cyclic:false,scrolling:"auto",width:560,height:340,autoScale:true,autoDimensions:true,centerOnScroll:false,ajax:{},swf:{wmode:"transparent"},hideOnOverlayClick:true,hideOnContentClick:false,overlayShow:true,overlayOpacity:0.7,overlayColor:"#777",titleShow:true,titlePosition:"float",titleFormat:null,titleFromAlt:false,transitionIn:"fade",transitionOut:"fade",speedIn:300,speedOut:300,changeSpeed:300,changeFade:"fast",easingIn:"swing", |
| easingOut:"swing",showCloseButton:true,showNavArrows:true,enableEscapeButton:true,enableKeyboardNav:true,onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}};b(document).ready(function(){b.fancybox.init()})})(jQuery); |
| /trunk/presentations/scripts/jquery.cookie.js |
|---|
| New file |
| 0,0 → 1,47 |
| /** |
| * jQuery Cookie plugin |
| * |
| * Copyright (c) 2010 Klaus Hartl (stilbuero.de) |
| * Dual licensed under the MIT and GPL licenses: |
| * http://www.opensource.org/licenses/mit-license.php |
| * http://www.gnu.org/licenses/gpl.html |
| * |
| */ |
| (function($) { |
| $.cookie = function(key, value, options) { |
| // key and at least value given, set cookie... |
| if (arguments.length > 1 && (!/Object/.test(Object.prototype.toString.call(value)) || value === null || value === undefined)) { |
| options = $.extend({}, options); |
| if (value === null || value === undefined) { |
| options.expires = -1; |
| } |
| if (typeof options.expires === 'number') { |
| var days = options.expires, t = options.expires = new Date(); |
| t.setDate(t.getDate() + days); |
| } |
| value = String(value); |
| return (document.cookie = [ |
| encodeURIComponent(key), '=', options.raw ? value : encodeURIComponent(value), |
| options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE |
| options.path ? '; path=' + options.path : '', |
| options.domain ? '; domain=' + options.domain : '', |
| options.secure ? '; secure' : '' |
| ].join('')); |
| } |
| // key and possibly options given, get cookie... |
| options = value || {}; |
| var decode = options.raw ? function(s) { return s; } : decodeURIComponent; |
| var pairs = document.cookie.split('; '); |
| for (var i = 0, pair; pair = pairs[i] && pairs[i].split('='); i++) { |
| if (decode(pair[0]) === key) return decode(pair[1] || ''); // IE saves cookies with empty string as "c; ", e.g. without "=" as opposed to EOMB, thus pair[1] may be undefined |
| } |
| return null; |
| }; |
| })(jQuery); |
| /trunk/presentations/scripts/jquery.mousewheel-3.0.4.pack.js |
|---|
| New file |
| 0,0 → 1,14 |
| /*! Copyright (c) 2010 Brandon Aaron (http://brandonaaron.net) |
| * Licensed under the MIT License (LICENSE.txt). |
| * |
| * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers. |
| * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix. |
| * Thanks to: Seamus Leahy for adding deltaX and deltaY |
| * |
| * Version: 3.0.4 |
| * |
| * Requires: 1.2.2+ |
| */ |
| (function(d){function g(a){var b=a||window.event,i=[].slice.call(arguments,1),c=0,h=0,e=0;a=d.event.fix(b);a.type="mousewheel";if(a.wheelDelta)c=a.wheelDelta/120;if(a.detail)c=-a.detail/3;e=c;if(b.axis!==undefined&&b.axis===b.HORIZONTAL_AXIS){e=0;h=-1*c}if(b.wheelDeltaY!==undefined)e=b.wheelDeltaY/120;if(b.wheelDeltaX!==undefined)h=-1*b.wheelDeltaX/120;i.unshift(a,c,h,e);return d.event.handle.apply(this,i)}var f=["DOMMouseScroll","mousewheel"];d.event.special.mousewheel={setup:function(){if(this.addEventListener)for(var a= |
| f.length;a;)this.addEventListener(f[--a],g,false);else this.onmousewheel=g},teardown:function(){if(this.removeEventListener)for(var a=f.length;a;)this.removeEventListener(f[--a],g,false);else this.onmousewheel=null}};d.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}})})(jQuery); |
| /trunk/presentations/scripts/recherche.js |
|---|
| 1,154 → 1,121 |
| /**-------------------------- Objets globaux -----------------------------------*/ |
| /* |
| * Liste des noms scientifiques reçus pour la mise en gras des noms valide |
| */ |
| var listeNomsScientifiques = new Object(); |
| /* |
| * Les variables suivantes sont ajoutée automatiquement dans le squelette du moteur de |
| * recherche par php, elles sont commentées ici pour qu'elles n'aient pas l'air |
| * de sortir de la cuisse de Jupiter |
| * |
| * var AUTOCOMPLETION_ELEMENTS_NBRE : indique le nombre d'éléments à afficher dans la liste d'autocomplétion. |
| * |
| * var URL_SERVICE_AUTOCOMPLETION_NOM_SCI : url de base du service de complétion de noms scientifiques |
| * var urlServiceAutocompletionNomsSci : url de base du service de complétion de noms scientifiques |
| * pour le projet en cours de consultation. |
| * Exemple : http://localhost/service:eflore:0.1/bdtfx/noms?recherche=etendue&retour.format=min&masque=Ace%mo |
| * |
| * var URL_SERVICE_AUTOCOMPLETION_NOM_VERNA : url de base du service de complétion de noms vernaculaires |
| * var urlServiceAutocompletionNomsVerna : url de base du service de complétion de noms vernaculaires |
| * pour le projet en cours de consultation. |
| * Exemple : http://localhost/service:eflore:0.1/nvjfl/noms-vernaculaires?recherche=etendue&retour.format=oss&masque=aca&masque.lg=fra |
| * |
| * var VALEUR_DEFAUT_NOM_SCI : Contient la valeur par défaut affichée dans le formulaire en mode sci |
| * var valeurDefautNomSci : Contient la valeur par défaut affichée dans le formulaire en mode sci |
| * Exemple: Rechercher un nom scientifique |
| * |
| * var VALEUR_DEFAUT_NOM_VERNA : Contient la valeur par défaut affichée dans le formulaire en mode verna |
| * var valeurDefautNomVerna : Contient la valeur par défaut affichée dans le formulaire en mode verna |
| * Exemple: Recherche un nom commun |
| */ |
| $(document).ready(function() { |
| ajouterAutocompletionNoms(); |
| ajouterActionClicSurTexteRecherche(); |
| gererAffichageValeursParDefaut(); |
| afficherValeurParDefaut(); |
| }); |
| /**------------------- Fonctions de gestion de l'autocompletion ---------------------------------*/ |
| function ajouterAutocompletionNoms() { |
| $('#nom').autocomplete({ |
| source: function(requete, add){ |
| // la variable de requête doit être vidée car sinon le parametre "term" est ajouté |
| requete = ""; |
| var url = getUrlAppelCompletion(); |
| $.getJSON(url, requete, function(data) { |
| var suggestions = []; |
| if (nomVernaculaireEstDemande()) { |
| suggestions = traiterRetourNomsVerna(data); |
| } else if (nomSciEstDemande()) { |
| suggestions = traiterRetourNomsSci(data); |
| /**------------ Fonctions de détection de l'état du formulaire ------------------*/ |
| function nomSciEstDemande() { |
| var boutonRadioNomSci = $('#type_nom_scientifique'); |
| return (boutonRadioNomSci.attr("checked") != "undefined" && boutonRadioNomSci.attr("checked") == "checked"); |
| } |
| add(suggestions); |
| }); |
| }, |
| html: true |
| }); |
| $("nom").bind("autocompleteselect", function(event, ui) { |
| console.log('LA'); |
| if (ui.item.retenu == true) { |
| $("#nom").addClass('ns-retenu'); |
| console.log('ici'); |
| } else { |
| $("#nom").removeClass('ns-retenu'); |
| function nomVernaculaireEstDemande() { |
| var boutonRadioNomSci = $('#type_nom_vernaculaire'); |
| return (boutonRadioNomSci.attr("checked") != "undefined" && boutonRadioNomSci.attr("checked") == "checked"); |
| } |
| }); |
| /**------------ Fonctions de gestion des urls d'autocompletion et des fiches ------------------*/ |
| function getUrlAutocompletion(baseUrl, requete, format) { |
| return baseUrl+"?recherche=etendue&retour.format="+format+"&navigation.limite=50&masque="+requete; |
| } |
| function getUrlAutocompletionNomsVerna(requete) { |
| return getUrlAutocompletion(urlServiceAutocompletionNomsVerna, requete, 'oss')+"&masque.lg=fra"; |
| } |
| function getUrlAutocompletionNomsSci(requete) { |
| return getUrlAutocompletion(urlServiceAutocompletionNomsSci, requete, 'min'); |
| } |
| function getUrlAppelCompletion(requete) { |
| var url = getUrlAutocompletionNomsSci(requete); |
| if(nomVernaculaireEstDemande()) { |
| requete = requete.replace(' ',' '); |
| requete = requete.replace(' ','_'); |
| var url = getUrlAutocompletionNomsVerna(requete); |
| } |
| return url; |
| } |
| /**------------------- Fonctions de gestion de l'autocompletion ---------------------------------*/ |
| function traiterRetourNomsSci(data) { |
| var suggestions = []; |
| if (data.resultat != undefined) { |
| $.each(data.resultat, function(i, val) { |
| val.nn = i; |
| var nom = {label : '', value : '', retenu : false}; |
| if (suggestions.length >= AUTOCOMPLETION_ELEMENTS_NBRE) { |
| nom.label = "..."; |
| nom.value = $('#nom').val(); |
| suggestions.push(nom); |
| return false; |
| } else { |
| nom.label = val.nom_sci_complet; |
| nom.value = val.nom_sci; |
| nom.nn = val.nn; |
| nom.retenu = (val.retenu == 'false') ? false : true; |
| suggestions.push(nom); |
| } |
| val.num_tax = i; |
| listeNomsScientifiques[val.nom_sci] = val; |
| suggestions.push(val.nom_sci); |
| }); |
| } |
| if(suggestions.length >= 50) { |
| suggestions.push("..."); |
| } |
| return suggestions; |
| } |
| function traiterRetourNomsVerna(data) { |
| var suggestions = []; |
| if (jQuery.type(data) == "array") { |
| $.each(data[1], function(i, val){ |
| var nom = {label : '', value : ''}; |
| if (suggestions.length >= AUTOCOMPLETION_ELEMENTS_NBRE) { |
| nom.label = "..."; |
| nom.value = $('#nom').val(); |
| suggestions.push(nom); |
| return false; |
| } else { |
| nom.label = val; |
| nom.value = val; |
| suggestions.push(val); |
| } |
| }); |
| } |
| return suggestions; |
| } |
| /**------------ Fonctions de gestion des urls d'autocompletion et des fiches ------------------*/ |
| function getUrlAppelCompletion() { |
| var url = ''; |
| var mots = $('#nom').val(); |
| if (nomSciEstDemande()) { |
| url = getUrlAutocompletionNomsSci(mots); |
| } else if (nomVernaculaireEstDemande()) { |
| mots = mots.replace(' ',' '); |
| mots = mots.replace(' ','_'); |
| url = getUrlAutocompletionNomsVerna(mots); |
| if(suggestions.length >= 50) { |
| suggestions.push("..."); |
| } |
| return url; |
| } |
| function getUrlAutocompletionNomsSci(requete) { |
| var url = getUrlAutocompletion(URL_SERVICE_AUTOCOMPLETION_NOM_SCI, requete, 'min')+ |
| "&ns.structure=au,an"; |
| return url; |
| return suggestions; |
| } |
| function getUrlAutocompletionNomsVerna(requete) { |
| var url = getUrlAutocompletion(URL_SERVICE_AUTOCOMPLETION_NOM_VERNA, requete, 'oss')+ |
| "&masque.lg=fra"; |
| return url; |
| } |
| function ajouterAutocompletionNoms() { |
| $('#nom').autocomplete({ |
| source: function(req, add){ |
| // la variable de requête doit être vidée car sinon le parametre "term" est ajouté |
| req = ""; |
| $.getJSON(getUrlAppelCompletion($('#nom').val()), req, function(data) { |
| function getUrlAutocompletion(baseUrl, requete, format) { |
| var url = baseUrl+"?"+ |
| "masque="+requete+"&"+ |
| "recherche=etendue&"+ |
| "retour.format="+format+"&"+ |
| "navigation.limite="+AUTOCOMPLETION_ELEMENTS_NBRE; |
| return url; |
| if(nomVernaculaireEstDemande()) { |
| suggestions = traiterRetourNomsVerna(data); |
| } else { |
| suggestions = traiterRetourNomsSci(data); |
| } |
| /**------------ Fonctions de détection de l'état du formulaire ------------------*/ |
| function nomSciEstDemande() { |
| var boutonRadioNomSci = $('#type_nom_scientifique'); |
| return (boutonRadioNomSci.attr("checked") != "undefined" && boutonRadioNomSci.attr("checked") == "checked"); |
| add(suggestions); |
| }); |
| }, |
| html: true |
| }); |
| } |
| function nomVernaculaireEstDemande() { |
| var boutonRadioNomSci = $('#type_nom_vernaculaire'); |
| return (boutonRadioNomSci.attr("checked") != "undefined" && boutonRadioNomSci.attr("checked") == "checked"); |
| } |
| /**------------ Fonctions de gestion de l'affichage des valeurs par defaut ----------------------*/ |
| function ajouterActionClicSurTexteRecherche() { |
| $('#nom').click(function() { |
| 155,6 → 122,7 |
| if (formulaireAfficheValeurParDefaut()) { |
| $('#nom').val(''); |
| } |
| if ($('#nom').hasClass('valeur-defaut-recherche')) { |
| $('#nom').removeClass('valeur-defaut-recherche'); |
| } |
| 164,7 → 132,7 |
| function formulaireAfficheValeurParDefaut() { |
| valeur_form = $('#nom').val(); |
| valeur_form = $.trim(valeur_form); |
| return valeur_form == '' || valeur_form == VALEUR_DEFAUT_NOM_SCI || valeur_form == VALEUR_DEFAUT_NOM_VERNA; |
| return valeur_form == '' || valeur_form == valeurDefautNomSci || valeur_form == valeurDefautNomVerna; |
| } |
| function gererAffichageValeursParDefaut() { |
| 188,10 → 156,10 |
| valeur_form = $.trim(valeur_form); |
| if (formulaireAfficheValeurParDefaut()) { |
| if (nomSciEstDemande()) { |
| $('#nom').val(VALEUR_DEFAUT_NOM_SCI); |
| $('#nom').val(valeurDefautNomSci); |
| $('#eflore_nomenclature_fiche').show(); |
| } else { |
| $('#nom').val(VALEUR_DEFAUT_NOM_VERNA); |
| $('#nom').val(valeurDefautNomVerna); |
| $('#eflore_nomenclature_fiche').hide(); |
| } |
| $('#nom').addClass('valeur-defaut-recherche'); |
| 199,6 → 167,13 |
| } |
| } |
| $(document).ready(function() { |
| ajouterAutocompletionNoms(); |
| ajouterActionClicSurTexteRecherche(); |
| gererAffichageValeursParDefaut(); |
| afficherValeurParDefaut(); |
| }); |
| /* |
| * jQuery UI Autocomplete HTML Extension |
| * |
| 210,6 → 185,7 |
| * Adaptation par Aurélien Peronnet pour la mise en gras des noms de taxons valides |
| */ |
| (function( $ ) { |
| var proto = $.ui.autocomplete.prototype, |
| initSource = proto._initSource; |
| 231,10 → 207,14 |
| } |
| }, |
| _renderItem: function( ul, item) { |
| if (item.retenu == true) { |
| item.label = "<strong>"+item.label+"</strong>"; |
| if(listeNomsScientifiques[item.label] != undefined && listeNomsScientifiques[item.label].retenu == "true") { |
| item.label = "<b>"+item.label+"</b>"; |
| } |
| if(item.label == '...') { |
| item.label = "<b>"+item.label+"</b>"; |
| } |
| return $("<li></li>") |
| .data("item.autocomplete", item) |
| .append( $("<a></a>")[ this.options.html ? "html" : "text" ](item.label)) |
| 241,4 → 221,5 |
| .appendTo(ul); |
| } |
| }); |
| })( jQuery ); |
| })( jQuery ); |